isavuconazole
(DDFOUSQFMYRUQK-RCDICMHDSA-N)
Structure
- SMILES
- N#Cc1ccc(cc1)c1csc(n1)[C@@H]([C@@](c1cc(F)ccc1F)(Cn1cncn1)O)C
- Type(s)
- Approved; Investigational
- ATC code(s)
- J02AC05
- Molecular Formula:
- C22H17F2N5OS
- Molecular Weight:
- 437.465
- Log P:
- 4.2430
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 1
- TPSA:
- 115.86
- CAS Number(s):
- 241479-67-4; 1286730-05-9
Synonym(s)
1.
isavuconazole
2.
BAL 8557
3.
BAL-8557
4.
BAL8557
5.
Cresemba
6.
isavuconazonium sulfate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Product use in unapproved indication | FAERS: 45 | US FAERS | |
| 2 | Infection | FAERS: 9 | US FAERS | |
| 3 | Hepatotoxicity | FAERS: 8 | US FAERS | |
| 4 | Pneumonia | FAERS: 8 | US FAERS | |
| 5 | Therapy non-responder | FAERS: 8 | US FAERS | |
| 6 | Nausea | FAERS: 7 | US FAERS | |
| 7 | Fatigue | FAERS: 6 | US FAERS | |
| 8 | Febrile Neutropenia | FAERS: 6 | US FAERS | |
| 9 | nervous system disorder | FAERS: 5 | US FAERS | |
| 10 | Vomiting | FAERS: 4 | US FAERS | |
| 11 | Dehydration | FAERS: 3 | US FAERS | |
| 12 | Sepsis | FAERS: 3 | US FAERS | |
| 13 | Thrombosis | FAERS: 3 | US FAERS | |
| 14 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 15 | Visual Impairment | FAERS: 3 | US FAERS | |
| 16 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 17 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 18 | Chronic sinusitis | FAERS: 2 | US FAERS | |
| 19 | Drug ineffective | FAERS: 2 | US FAERS | |
| 20 | Drug level increased | FAERS: 2 | US FAERS | |
| 21 | Dyspepsia | FAERS: 2 | US FAERS | |
| 22 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 23 | Oncologic complication | FAERS: 2 | US FAERS | |
| 24 | Product dose omission | FAERS: 2 | US FAERS | |
| 25 | Septic Shock | FAERS: 2 | US FAERS | |
| 26 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 27 | Agitation | FAERS: 1 | US FAERS | |
| 28 | Alopecia | FAERS: 1 | US FAERS | |
| 29 | Anxiety | FAERS: 1 | US FAERS | |
| 30 | Apparent death | FAERS: 1 | US FAERS | |
| 31 | Asthenia | FAERS: 1 | US FAERS | |
| 32 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 33 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 34 | Blood urea increased | FAERS: 1 | US FAERS | |
| 35 | Blood viscosity decreased | FAERS: 1 | US FAERS | |
| 36 | Chest discomfort | FAERS: 1 | US FAERS | |
| 37 | Coccidioidomycosis | FAERS: 1 | US FAERS | |
| 38 | Complications of bone marrow transplant | FAERS: 1 | US FAERS | |
| 39 | Critical Illness | FAERS: 1 | US FAERS | |
| 40 | Delirium | FAERS: 1 | US FAERS | |
| 41 | Dementia | FAERS: 1 | US FAERS | |
| 42 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 43 | Disease Progression | FAERS: 1 | US FAERS | |
| 44 | Drug administration error | FAERS: 1 | US FAERS | |
| 45 | Drug dose omission | FAERS: 1 | US FAERS | |
| 46 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 47 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 48 | Drug resistance | FAERS: 1 | US FAERS | |
| 49 | Endocarditis | FAERS: 1 | US FAERS | |
| 50 | Enzyme level decreased | FAERS: 1 | US FAERS | |
| 51 | Facial Pain | FAERS: 1 | US FAERS | |
| 52 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 53 | Gait inability | FAERS: 1 | US FAERS | |
| 54 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 55 | Graft versus host disease in liver | FAERS: 1 | US FAERS | |
| 56 | Headache | FAERS: 1 | US FAERS | |
| 57 | Hernia | FAERS: 1 | US FAERS | |
| 58 | Immobile | FAERS: 1 | US FAERS | |
| 59 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 60 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 61 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 62 | Intestinal resection | FAERS: 1 | US FAERS | |
| 63 | Lethargy | FAERS: 1 | US FAERS | |
| 64 | Limb injury | FAERS: 1 | US FAERS | |
| 65 | Lymphoma | FAERS: 1 | US FAERS | |
| 66 | Malaise | FAERS: 1 | US FAERS | |
| 67 | Mouth swelling | FAERS: 1 | US FAERS | |
| 68 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 69 | Neutropenia | FAERS: 1 | US FAERS | |
| 70 | Oral pain | FAERS: 1 | US FAERS | |
| 71 | Pain | FAERS: 1 | US FAERS | |
| 72 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 73 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 74 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 75 | Post procedural discharge | FAERS: 1 | US FAERS | |
| 76 | Product administration error | FAERS: 1 | US FAERS | |
| 77 | Product supply issue | FAERS: 1 | US FAERS | |
| 78 | Product use issue | FAERS: 1 | US FAERS | |
| 79 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 80 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 81 | Respiratory distress | FAERS: 1 | US FAERS | |
| 82 | Scopulariopsis infection | FAERS: 1 | US FAERS | |
| 83 | Shock symptom | FAERS: 1 | US FAERS | |
| 84 | Tachycardia | FAERS: 1 | US FAERS | |
| 85 | Terminal state | FAERS: 1 | US FAERS | |
| 86 | Transaminases increased | FAERS: 1 | US FAERS | |
| 87 | Transplant | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.