betamethasone dipropionate, calcipotriol drug combination
(CNXNMLQATFFYLX-ICTDYHGOSA-N)
Structure
- SMILES
- O[C@H]1C[C@H](O)C(=C)/C(=C\C=C\2/CCC[C@]3([C@H]2CC[C@@H]3[C@@H](/C=C/[C@H](C2CC2)O)C)C)/C1.CCC(=O)O[C@@]1([C@@H](C)C[C@@H]2[C@]1(C)C[C@H](O)[C@]1([C@H]2CCC2=CC(=O)C=C[C@]12C)F)C(=O)COC(=O)CC
- Molecular Formula:
- C55H77FO10
- Molecular Weight:
- 917.192
- Log P:
- 8.9081
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 4
- TPSA:
- 167.66
- CAS Number(s):
- 485805-18-3
Synonym(s)
1.
betamethasone dipropionate, calcipotriol drug combination
2.
Daivobet
3.
Dovobet
4.
Taclonex
5.
Xamiol gel
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 38 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 2 | Medication residue present | FAERS: 31 | US FAERS | |
| 3 | Inappropriate schedule of drug administration | FAERS: 24 | US FAERS | |
| 4 | Product use issue | FAERS: 16 | US FAERS | |
| 5 | Psoriasis | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Pruritus | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Drug administered at inappropriate site | FAERS: 13 | US FAERS | |
| 8 | Erythema | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Headache | FAERS: 11 | US FAERS | |
| 10 | Alopecia | FAERS: 9 | US FAERS | |
| 11 | Cataract | FAERS: 9 | US FAERS | |
| 12 | Incorrect drug administration duration | FAERS: 9 | US FAERS | |
| 13 | Burning sensation | FAERS: 8 | US FAERS | |
| 14 | Hypersensitivity | FAERS: 8 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 15 | Erythrodermic psoriasis | FAERS: 7 | US FAERS | |
| 16 | Product use in unapproved indication | FAERS: 7 | US FAERS | |
| 17 | Scab | FAERS: 7 | US FAERS | |
| 18 | Dizziness | FAERS: 6 | US FAERS | |
| 19 | Drug administered to patient of inappropriate age | FAERS: 6 | US FAERS | |
| 20 | Application site pain | FAERS: 5 | US FAERS | |
| 21 | Arthralgia | FAERS: 5 | US FAERS | |
| 22 | Expired product administered | FAERS: 5 | US FAERS | |
| 23 | Folliculitis | FAERS: 5 | US FAERS | |
| 24 | Product quality issue | FAERS: 5 | US FAERS | |
| 25 | Rebound psoriasis | FAERS: 5 | US FAERS | |
| 26 | Swelling | FAERS: 5 | US FAERS | |
| 27 | Fatigue | FAERS: 4 | US FAERS | |
| 28 | Inflammation | FAERS: 4 | US FAERS | |
| 29 | Nephrolithiasis | FAERS: 4 | US FAERS | |
| 30 | Oropharyngeal pain | FAERS: 4 | US FAERS | |
| 31 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 32 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 33 | Application site erythema | FAERS: 3 | US FAERS | |
| 34 | Back Pain | FAERS: 3 | US FAERS | |
| 35 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 36 | Discomfort | FAERS: 3 | US FAERS | |
| 37 | Malaise | FAERS: 3 | US FAERS | |
| 38 | No adverse event | FAERS: 3 | US FAERS | |
| 39 | Pain of skin | FAERS: 3 | US FAERS | |
| 40 | Pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Product administered at inappropriate site | FAERS: 3 | US FAERS | |
| 42 | Skin irritation | FAERS: 3 | US FAERS | |
| 43 | Therapeutic response unexpected | FAERS: 3 | US FAERS | |
| 44 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 45 | Abasia | FAERS: 2 | US FAERS | |
| 46 | Ageusia | FAERS: 2 | US FAERS | |
| 47 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 48 | Angioedema | FAERS: 2 | US FAERS | |
| 49 | Application site erosion | FAERS: 2 | US FAERS | |
| 50 | Application site inflammation | FAERS: 2 | US FAERS | |
| 51 | Application site irritation | FAERS: 2 | US FAERS | |
| 52 | Application site reaction | FAERS: 2 | US FAERS | |
| 53 | Application site swelling | FAERS: 2 | US FAERS | |
| 54 | Auricular swelling | FAERS: 2 | US FAERS | |
| 55 | Blood cortisol decreased | FAERS: 2 | US FAERS | |
| 56 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 57 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 58 | Cellulitis | FAERS: 2 | US FAERS | |
| 59 | Diabetic Ketoacidosis | FAERS: 2 | US FAERS | |
| 60 | Drug administration error | FAERS: 2 | US FAERS | |
| 61 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 62 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 63 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 64 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 65 | Dry skin | FAERS: 2 | US FAERS | |
| 66 | Endocarditis | FAERS: 2 | US FAERS | |
| 67 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 68 | Infection | FAERS: 2 | US FAERS | |
| 69 | Myalgia | FAERS: 2 | US FAERS | |
| 70 | Mycosis Fungoides | FAERS: 2 | US FAERS | |
| 71 | Nausea | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Palpitations | FAERS: 2 | US FAERS | |
| 73 | Papule | FAERS: 2 | US FAERS | |
| 74 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 75 | Pneumonia | FAERS: 2 | US FAERS | |
| 76 | Product container issue | FAERS: 2 | US FAERS | |
| 77 | Right ventricular failure | FAERS: 2 | US FAERS | |
| 78 | Rosacea | FAERS: 2 | US FAERS | |
| 79 | Urticaria | FAERS: 2 | US FAERS | |
| 80 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 81 | Anxiety | FAERS: 1 | US FAERS | |
| 82 | Aortic Rupture | FAERS: 1 | US FAERS | |
| 83 | Application site discharge | FAERS: 1 | US FAERS | |
| 84 | Application site hypersensitivity | FAERS: 1 | US FAERS | |
| 85 | Application site pruritus | FAERS: 1 | US FAERS | |
| 86 | Application site warmth | FAERS: 1 | US FAERS | |
| 87 | Arthritis | FAERS: 1 | US FAERS | |
| 88 | Asthenia | FAERS: 1 | US FAERS | |
| 89 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 90 | Bone pain | FAERS: 1 | US FAERS | |
| 91 | Bursitis | FAERS: 1 | US FAERS | |
| 92 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 93 | Chemical burn of skin | FAERS: 1 | US FAERS | |
| 94 | Chills | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Contraindicated product prescribed | FAERS: 1 | US FAERS | |
| 96 | Dermatitis | FAERS: 1 | US FAERS | |
| 97 | Disease Progression | FAERS: 1 | US FAERS | |
| 98 | Drug dose omission | FAERS: 1 | US FAERS | |
| 99 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 100 | Dysgeusia | FAERS: 1 | US FAERS | |
| 101 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 102 | Eye irritation | FAERS: 1 | US FAERS | |
| 103 | Feeling Cold | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 104 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 105 | Formication | FAERS: 1 | US FAERS | |
| 106 | Glaucoma | FAERS: 1 | US FAERS | |
| 107 | Gout | FAERS: 1 | US FAERS | |
| 108 | Hair injury | FAERS: 1 | US FAERS | |
| 109 | Head Banging | FAERS: 1 | US FAERS | |
| 110 | Hyperparathyroidism | FAERS: 1 | US FAERS | |
| 111 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 112 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 113 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 114 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 115 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 116 | Myoclonus | FAERS: 1 | US FAERS | |
| 117 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 118 | Onychoclasis | FAERS: 1 | US FAERS | |
| 119 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 120 | Osteoporosis | FAERS: 1 | US FAERS | |
| 121 | Peritonitis | FAERS: 1 | US FAERS | |
| 122 | Pharyngitis | FAERS: 1 | US FAERS | |
| 123 | Photophobia | FAERS: 1 | US FAERS | |
| 124 | Post procedural bile leak | FAERS: 1 | US FAERS | |
| 125 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 126 | Psychological Trauma | FAERS: 1 | US FAERS | |
| 127 | Pustular psoriasis | FAERS: 1 | US FAERS | |
| 128 | Rebound effect | FAERS: 1 | US FAERS | |
| 129 | Sense of oppression | FAERS: 1 | US FAERS | |
| 130 | Septic Shock | FAERS: 1 | US FAERS | |
| 131 | Skin Erosion | FAERS: 1 | US FAERS | |
| 132 | Skin discomfort | FAERS: 1 | US FAERS | |
| 133 | Skin tightness | FAERS: 1 | US FAERS | |
| 134 | Sudden death | FAERS: 1 | US FAERS | |
| 135 | Sunburn | FAERS: 1 | US FAERS | |
| 136 | Tension | FAERS: 1 | US FAERS | |
| 137 | Therapeutic product effective for unapproved indication | FAERS: 1 | US FAERS | |
| 138 | Thrombosis | FAERS: 1 | US FAERS | |
| 139 | Tremor | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 140 | Ulcer | FAERS: 1 | US FAERS | |
| 141 | Unevaluable event | FAERS: 1 | US FAERS | |
| 142 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 143 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 144 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 145 | Wound infection staphylococcal | FAERS: 1 | US FAERS | |
| 146 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 147 | Application site vesicles | Canada Vigilance: 1 | Canada Vigilance | |
| 148 | Chest discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 149 | Cold sweat | Canada Vigilance: 1 | Canada Vigilance | |
| 150 | Ecchymosis | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.