Haloperidol lactate
(BVUSNQJCSYDJJG-UHFFFAOYSA-N)
Structure
- SMILES
- OC(=O)C(O)C.Fc1ccc(cc1)C(=O)CCCN1CCC(CC1)(O)c1ccc(cc1)Cl
- Molecular Formula:
- C24H29ClFNO5
- Molecular Weight:
- 465.942
- Log P:
- 3.8153
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 3
- TPSA:
- 98.07
- CAS Number(s):
- 53515-91-6
Synonym(s)
1.
Haloperidol lactate
External Link(s)
| PubChem Compound | 16051968 |
| CHEMBL | CHEMBL4297147 |
| KEGG | dr:D08035 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Toxicity to various agents | FAERS: 48 | US FAERS | |
| 2 | Somnolence | FAERS: 8 | US FAERS | |
| 3 | Circumstance or information capable of leading to medication error | FAERS: 6 | US FAERS | |
| 4 | Medication Error | FAERS: 6 | US FAERS | |
| 5 | Myalgia | FAERS: 5 | US FAERS | |
| 6 | Muscle Rigidity | FAERS: 4 | US FAERS | |
| 7 | Neuroleptic Malignant Syndrome | FAERS: 4 | US FAERS | |
| 8 | Pulmonary Embolism | FAERS: 4 | US FAERS | |
| 9 | Torticollis | FAERS: 4 | US FAERS | |
| 10 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 11 | Ataxia | FAERS: 3 | US FAERS | |
| 12 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 13 | Dystonia | FAERS: 3 | US FAERS | |
| 14 | Cyanosis | FAERS: 2 | US FAERS | |
| 15 | Dysarthria | FAERS: 2 | US FAERS | |
| 16 | Hypotension | FAERS: 2 | US FAERS | |
| 17 | Respiratory distress | FAERS: 2 | US FAERS | |
| 18 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 19 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 20 | Stridor | FAERS: 2 | US FAERS | |
| 21 | Tardive Dyskinesia | FAERS: 2 | US FAERS | |
| 22 | Trismus | FAERS: 2 | US FAERS | |
| 23 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 24 | Agitation | FAERS: 1 | US FAERS | |
| 25 | Akathisia | FAERS: 1 | US FAERS | |
| 26 | Angioedema | FAERS: 1 | US FAERS | |
| 27 | Anxiety | FAERS: 1 | US FAERS | |
| 28 | Asthenia | FAERS: 1 | US FAERS | |
| 29 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 30 | Bradykinesia | FAERS: 1 | US FAERS | |
| 31 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 32 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 33 | Carotid Artery Thrombosis | FAERS: 1 | US FAERS | |
| 34 | Catheter site pain | FAERS: 1 | US FAERS | |
| 35 | Cerebellar Ataxia | FAERS: 1 | US FAERS | |
| 36 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 37 | Chest Pain | FAERS: 1 | US FAERS | |
| 38 | Choking sensation | FAERS: 1 | US FAERS | |
| 39 | Colonic Pseudo-Obstruction | FAERS: 1 | US FAERS | |
| 40 | Crying | FAERS: 1 | US FAERS | |
| 41 | Disorientation | FAERS: 1 | US FAERS | |
| 42 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 43 | Drug toxicity | FAERS: 1 | US FAERS | |
| 44 | Facial asymmetry | FAERS: 1 | US FAERS | |
| 45 | Flushing | FAERS: 1 | US FAERS | |
| 46 | Gene Mutation | FAERS: 1 | US FAERS | |
| 47 | Hyperreflexia | FAERS: 1 | US FAERS | |
| 48 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 49 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 50 | Leukocytosis | FAERS: 1 | US FAERS | |
| 51 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 52 | Long QT Syndrome | FAERS: 1 | US FAERS | |
| 53 | Mental status changes | FAERS: 1 | US FAERS | |
| 54 | Moaning | FAERS: 1 | US FAERS | |
| 55 | Nuchal Rigidity | FAERS: 1 | US FAERS | |
| 56 | Opisthotonus | FAERS: 1 | US FAERS | |
| 57 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 58 | Product name confusion | FAERS: 1 | US FAERS | |
| 59 | Rash erythematous | FAERS: 1 | US FAERS | |
| 60 | Resting Tremor | FAERS: 1 | US FAERS | |
| 61 | Septic Shock | FAERS: 1 | US FAERS | |
| 62 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 63 | Suicide attempt | FAERS: 1 | US FAERS | |
| 64 | Syncope | FAERS: 1 | US FAERS | |
| 65 | Tachycardia | FAERS: 1 | US FAERS | |
| 66 | Tremor | FAERS: 1 | US FAERS | |
| 67 | Unevaluable event | FAERS: 1 | US FAERS | |
| 68 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 69 | Upper airway obstruction | FAERS: 1 | US FAERS | |
| 70 | Wrong drug administered | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.