Penicillin G Benzathine
(BVGLIYRKPOITBQ-ANPZCEIESA-N)
Structure
- SMILES
- N(Cc1ccccc1)CCNCc1ccccc1.O=C(Cc1ccccc1)N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C.O=C(Cc1ccccc1)N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C
- Molecular Formula:
- C48H56N6O8S2
- Molecular Weight:
- 909.124
- Log P:
- 5.7270
- Hydrogen Bond Acceptor:
- 16
- Hydrogen Bond Donor:
- 6
- TPSA:
- 248.08
- CAS Number(s):
- 1538-09-6
Synonym(s)
1.
Penicillin G Benzathine
2.
Benzathine Penicillin
3.
Bencelin
4.
Benzathine Benzylpenicillin
5.
Benzathine Benzylpénicilline Panpharma
6.
Benzetacil
7.
Bicillin
8.
Bicillin L-A
9.
Brevicilina
10.
Cepacilina
11.
Debecillin
12.
Extencilline
13.
Pendepon
14.
Penduran
15.
Pendysin
16.
Penicillin G Benzathine Anhydrous
17.
Penidural
18.
Peniroger Retard
19.
Permapen
20.
Provipen Benzatina
21.
Tardocillin
22.
Benzathine, Penicillin G
23.
Benzylpenicillin, Benzathine
24.
Bicillin L A
25.
Bicillin LA
26.
Penicillin, Benzathine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Injection site pain | FAERS: 40 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 2 | No adverse event | FAERS: 39 | US FAERS | |
| 3 | Pain | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Injection site erythema | FAERS: 14 | US FAERS | |
| 5 | Expired drug administered | FAERS: 13 | US FAERS | |
| 6 | Injection site abscess | FAERS: 8 | US FAERS | |
| 7 | Injection site cellulitis | FAERS: 8 | US FAERS | |
| 8 | Malaise | FAERS: 7 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 9 | Incorrect dose administered | FAERS: 6 | US FAERS | |
| 10 | Injection site mass | FAERS: 6 | US FAERS | |
| 11 | Poor quality drug administered | FAERS: 6 | US FAERS | |
| 12 | Vomiting | FAERS: 6 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 13 | Injection site warmth | FAERS: 5 | US FAERS | |
| 14 | Asthenia | FAERS: 4 | US FAERS | |
| 15 | Dizziness | FAERS: 4 | US FAERS | |
| 16 | Ecchymosis | FAERS: 4 | US FAERS | |
| 17 | Erythema | FAERS: 4 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 18 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 19 | Drug administration error | FAERS: 3 | US FAERS | |
| 20 | Feeling abnormal | FAERS: 3 | US FAERS | |
| 21 | Headache | FAERS: 3 | US FAERS | |
| 22 | Incorrect product storage | FAERS: 3 | US FAERS | |
| 23 | Incorrect route of drug administration | FAERS: 3 | US FAERS | |
| 24 | Injection Site Reaction | FAERS: 3 | US FAERS | |
| 25 | Injection site infection | FAERS: 3 | US FAERS | |
| 26 | Injection site scar | FAERS: 3 | US FAERS | |
| 27 | Medication Error | FAERS: 3 | US FAERS | |
| 28 | Needle issue | FAERS: 3 | US FAERS | |
| 29 | Product quality issue | FAERS: 3 | US FAERS | |
| 30 | Urticaria | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 31 | Wrong technique in drug usage process | FAERS: 3 | US FAERS | |
| 32 | Acne | FAERS: 2 | US FAERS | |
| 33 | Agitation | FAERS: 2 | US FAERS | |
| 34 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 35 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 36 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 37 | Blood alcohol abnormal | FAERS: 2 | US FAERS | |
| 38 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 39 | Chills | FAERS: 2 | US FAERS | |
| 40 | Discomfort | FAERS: 2 | US FAERS | |
| 41 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 42 | Drug ineffective | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 44 | Epistaxis | FAERS: 2 | US FAERS | |
| 45 | Fatigue | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Flushing | FAERS: 2 | US FAERS | |
| 47 | Incorrect storage of drug | FAERS: 2 | US FAERS | |
| 48 | Injection site discharge | FAERS: 2 | US FAERS | |
| 49 | Injection site nodule | FAERS: 2 | US FAERS | |
| 50 | Injection site vesicles | FAERS: 2 | US FAERS | |
| 51 | Lividity | FAERS: 2 | US FAERS | |
| 52 | Lyme Disease | FAERS: 2 | US FAERS | |
| 53 | Myalgia | FAERS: 2 | US FAERS | |
| 54 | Palpitations | FAERS: 2 | US FAERS | |
| 55 | Panic Disorder | FAERS: 2 | US FAERS | |
| 56 | Poor quality product administered | FAERS: 2 | US FAERS | |
| 57 | Product packaging issue | FAERS: 2 | US FAERS | |
| 58 | Product use issue | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Pruritus | FAERS: 2 | US FAERS | |
| 60 | Purulent discharge | FAERS: 2 | US FAERS | |
| 61 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 62 | Skin necrosis | FAERS: 2 | US FAERS | |
| 63 | Swelling | FAERS: 2 | US FAERS | |
| 64 | Syncope | FAERS: 2 | US FAERS | |
| 65 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 66 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 67 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 68 | jaundice | FAERS: 2 | US FAERS | |
| 69 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 70 | Anal infection | FAERS: 1 | US FAERS | |
| 71 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 72 | Anorexia | FAERS: 1 | US FAERS | |
| 73 | Anxiety | FAERS: 1 | US FAERS | |
| 74 | Arthralgia | FAERS: 1 | US FAERS | |
| 75 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 76 | Blepharospasm | FAERS: 1 | US FAERS | |
| 77 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 78 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 79 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 80 | Burning sensation | FAERS: 1 | US FAERS | |
| 81 | Cellulitis | FAERS: 1 | US FAERS | |
| 82 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 83 | Chromaturia | FAERS: 1 | US FAERS | |
| 84 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 85 | Cyanosis | FAERS: 1 | US FAERS | |
| 86 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 87 | Delirium | FAERS: 1 | US FAERS | |
| 88 | Diplopia | FAERS: 1 | US FAERS | |
| 89 | Disease recurrence | FAERS: 1 | US FAERS | |
| 90 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 91 | Drug administered at inappropriate site | FAERS: 1 | US FAERS | |
| 92 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 93 | Drug dose omission | FAERS: 1 | US FAERS | |
| 94 | Dysgeusia | FAERS: 1 | US FAERS | |
| 95 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 96 | Enterocolitis | FAERS: 1 | US FAERS | |
| 97 | Eye Infection | FAERS: 1 | US FAERS | |
| 98 | Feeling Cold | FAERS: 1 | US FAERS | |
| 99 | Gangrene | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 100 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 101 | Granuloma | FAERS: 1 | US FAERS | |
| 102 | Hypokinesia | FAERS: 1 | US FAERS | |
| 103 | Hypotension | FAERS: 1 | US FAERS | |
| 104 | Hypoxia | FAERS: 1 | US FAERS | |
| 105 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 106 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 107 | Induration | FAERS: 1 | US FAERS | |
| 108 | Infection | FAERS: 1 | US FAERS | |
| 109 | Injection site necrosis | FAERS: 1 | US FAERS | |
| 110 | Injection site pruritus | FAERS: 1 | US FAERS | |
| 111 | Injury associated with device | FAERS: 1 | US FAERS | |
| 112 | Limb injury | FAERS: 1 | US FAERS | |
| 113 | Lip swelling | FAERS: 1 | US FAERS | |
| 114 | Memory impairment | FAERS: 1 | US FAERS | |
| 115 | Mental impairment | FAERS: 1 | US FAERS | |
| 116 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 117 | Monoplegia | FAERS: 1 | US FAERS | |
| 118 | Muscle tightness | FAERS: 1 | US FAERS | |
| 119 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 120 | Necrosis | FAERS: 1 | US FAERS | |
| 121 | Nerve injury | FAERS: 1 | US FAERS | |
| 122 | Overdose | FAERS: 1 | US FAERS | |
| 123 | Pallor | FAERS: 1 | US FAERS | |
| 124 | Paranoia | FAERS: 1 | US FAERS | |
| 125 | Paraplegia | FAERS: 1 | US FAERS | |
| 126 | Paresis | FAERS: 1 | US FAERS | |
| 127 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 128 | Physical disability | FAERS: 1 | US FAERS | |
| 129 | Product label issue | FAERS: 1 | US FAERS | |
| 130 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 131 | Product storage error | FAERS: 1 | US FAERS | |
| 132 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 133 | Respiratory distress | FAERS: 1 | US FAERS | |
| 134 | Schizophrenia | FAERS: 1 | US FAERS | |
| 135 | Septic Shock | FAERS: 1 | US FAERS | |
| 136 | Shock | FAERS: 1 | US FAERS | |
| 137 | Sinusitis | FAERS: 1 | US FAERS | |
| 138 | Somnolence | FAERS: 1 | US FAERS | |
| 139 | Stupor | FAERS: 1 | US FAERS | |
| 140 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 141 | Syringe issue | FAERS: 1 | US FAERS | |
| 142 | Tremor | FAERS: 1 | US FAERS | |
| 143 | Vasculitis | FAERS: 1 | US FAERS | |
| 144 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 145 | Wrong technique in product usage process | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 146 | Chest discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 147 | Injection site bruising | Canada Vigilance: 1 | Canada Vigilance | |
| 148 | Injection site inflammation | Canada Vigilance: 2 | Canada Vigilance | |
| 149 | Lethargy | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120269
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.