Formoterol Fumarate
(BPZSYCZIITTYBL-UHFFFAOYSA-N)
Structure
- SMILES
- O=CNc1cc(ccc1O)C(CNC(Cc1ccc(cc1)OC)C)O
- Type(s)
- Approved; Investigational
- ATC code(s)
- R03AC13; R03AK07; R03AK08; R03AK09; R03AK11; R03AL05; R03AL07; R03AL09
- Molecular Formula:
- C19H24N2O4
- Molecular Weight:
- 344.405
- Log P:
- 3.3231
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 4
- TPSA:
- 90.82
- CAS Number(s):
- 73573-87-2
Synonym(s)
1.
Formoterol Fumarate
2.
3-Formylamino-4-hydroxy-alpha-(N-1-methyl-2-p-methoxyphenethylaminomethyl)benzyl alcohol.hemifumarate
3.
Arformoterol
4.
BD 40A
5.
Eformoterol
6.
Foradil
7.
Formoterol
8.
Formoterol Fumarate, ((R*,R*)-(+-))-isomer
9.
Formoterol, ((R*,R*)-(+-))-isomer
10.
Oxis
External Link(s)
| MeSH | D000068759 |
| PubChem Compound | 3410 |
| BindingDB | 86453 |
| ChEBI | 63082 |
| CHEMBL | CHEMBL1256786 |
| DrugBank | DB00983 |
| DrugCentral | 1239 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 3465 |
| KEGG | cpd:C07805 dr:D07990 |
| Therapeutic Target Database | D04KJO |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Incorrect route of drug administration | FAERS: 46 | US FAERS | |
| 2 | Device malfunction | FAERS: 34 | US FAERS | |
| 3 | Asthma | FAERS: 32 | US FAERS | |
| 4 | Tremor | FAERS: 23 | US FAERS | |
| 5 | Foreign body aspiration | FAERS: 16 | US FAERS | |
| 6 | Drug ineffective | FAERS: 15 | US FAERS | |
| 7 | Medication Error | FAERS: 15 | US FAERS | |
| 8 | Pneumonia | FAERS: 13 | US FAERS | |
| 9 | Feeling abnormal | FAERS: 12 | US FAERS | |
| 10 | Pharmaceutical product complaint | FAERS: 12 | US FAERS | |
| 11 | Dizziness | FAERS: 11 | US FAERS | |
| 12 | Device Failure | FAERS: 9 | US FAERS | |
| 13 | Headache | FAERS: 9 | US FAERS | |
| 14 | Myocardial Infarction | FAERS: 9 | US FAERS | |
| 15 | Throat irritation | FAERS: 9 | US FAERS | |
| 16 | Choking | FAERS: 8 | US FAERS | |
| 17 | Product physical issue | FAERS: 8 | US FAERS | |
| 18 | Productive Cough | FAERS: 8 | US FAERS | |
| 19 | Tachycardia | FAERS: 8 | US FAERS | |
| 20 | Chest Pain | FAERS: 7 | US FAERS | |
| 21 | Chills | FAERS: 7 | US FAERS | |
| 22 | Fatigue | FAERS: 7 | US FAERS | |
| 23 | Incorrect dose administered | FAERS: 7 | US FAERS | |
| 24 | Malaise | FAERS: 7 | US FAERS | |
| 25 | Wrong technique in product usage process | FAERS: 7 | US FAERS | |
| 26 | Overdose | FAERS: 6 | US FAERS | |
| 27 | Wrong technique in drug usage process | FAERS: 6 | US FAERS | |
| 28 | Anxiety | FAERS: 5 | US FAERS | |
| 29 | Erythema | FAERS: 5 | US FAERS | |
| 30 | Nausea | FAERS: 5 | US FAERS | |
| 31 | Palpitations | FAERS: 5 | US FAERS | |
| 32 | Restlessness | FAERS: 5 | US FAERS | |
| 33 | Wheezing | FAERS: 5 | US FAERS | |
| 34 | Accidental exposure | FAERS: 4 | US FAERS | |
| 35 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 36 | Chest discomfort | FAERS: 4 | US FAERS | |
| 37 | Disease Progression | FAERS: 4 | US FAERS | |
| 38 | Drug toxicity | FAERS: 4 | US FAERS | |
| 39 | Glaucoma | FAERS: 4 | US FAERS | |
| 40 | Product use issue | FAERS: 4 | US FAERS | |
| 41 | Arthritis | FAERS: 3 | US FAERS | |
| 42 | Asthenia | FAERS: 3 | US FAERS | |
| 43 | Bronchitis | FAERS: 3 | US FAERS | |
| 44 | Bronchospasm | FAERS: 3 | US FAERS | |
| 45 | Dysphonia | FAERS: 3 | US FAERS | |
| 46 | Electrocardiogram abnormal | FAERS: 3 | US FAERS | |
| 47 | Joint injury | FAERS: 3 | US FAERS | |
| 48 | Pain | FAERS: 3 | US FAERS | |
| 49 | Pallor | FAERS: 3 | US FAERS | |
| 50 | Product quality issue | FAERS: 3 | US FAERS | |
| 51 | Pulmonary Fibrosis | FAERS: 3 | US FAERS | |
| 52 | Respiratory arrest | FAERS: 3 | US FAERS | |
| 53 | Spinal fusion surgery | FAERS: 3 | US FAERS | |
| 54 | Visual disturbance | FAERS: 3 | US FAERS | |
| 55 | Asphyxia | FAERS: 2 | US FAERS | |
| 56 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 57 | Bedridden | FAERS: 2 | US FAERS | |
| 58 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 59 | Bradycardia | FAERS: 2 | US FAERS | |
| 60 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 61 | Concomitant disease progression | FAERS: 2 | US FAERS | |
| 62 | Depressed mood | FAERS: 2 | US FAERS | |
| 63 | Device difficult to use | FAERS: 2 | US FAERS | |
| 64 | Device material issue | FAERS: 2 | US FAERS | |
| 65 | Device use error | FAERS: 2 | US FAERS | |
| 66 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 67 | Feeling jittery | FAERS: 2 | US FAERS | |
| 68 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 69 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 70 | Hernia | FAERS: 2 | US FAERS | |
| 71 | Hypertensive heart disease | FAERS: 2 | US FAERS | |
| 72 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 73 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 74 | Infarction | FAERS: 2 | US FAERS | |
| 75 | Intentional drug misuse | FAERS: 2 | US FAERS | |
| 76 | Intestinal cyst | FAERS: 2 | US FAERS | |
| 77 | Limb discomfort | FAERS: 2 | US FAERS | |
| 78 | Memory impairment | FAERS: 2 | US FAERS | |
| 79 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 80 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 81 | Nervousness | FAERS: 2 | US FAERS | |
| 82 | Oral fungal infection | FAERS: 2 | US FAERS | |
| 83 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 84 | Pneumothorax | FAERS: 2 | US FAERS | |
| 85 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 86 | Post procedural complication | FAERS: 2 | US FAERS | |
| 87 | Product closure removal difficult | FAERS: 2 | US FAERS | |
| 88 | Retching | FAERS: 2 | US FAERS | |
| 89 | Stress | FAERS: 2 | US FAERS | |
| 90 | Suicide attempt | FAERS: 2 | US FAERS | |
| 91 | Thrombosis | FAERS: 2 | US FAERS | |
| 92 | Transaminases increased | FAERS: 2 | US FAERS | |
| 93 | Urticaria | FAERS: 2 | US FAERS | |
| 94 | Vomiting | FAERS: 2 | US FAERS | |
| 95 | nervous system disorder | FAERS: 2 | US FAERS | |
| 96 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 97 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 98 | Agitation | FAERS: 1 | US FAERS | |
| 99 | Allergic cough | FAERS: 1 | US FAERS | |
| 100 | Apathy | FAERS: 1 | US FAERS | |
| 101 | Aphonia | FAERS: 1 | US FAERS | |
| 102 | Arthralgia | FAERS: 1 | US FAERS | |
| 103 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 104 | Back Pain | FAERS: 1 | US FAERS | |
| 105 | Back disorder | FAERS: 1 | US FAERS | |
| 106 | Biopsy tongue normal | FAERS: 1 | US FAERS | |
| 107 | Blindness | FAERS: 1 | US FAERS | |
| 108 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 109 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 110 | Bronchial irritation | FAERS: 1 | US FAERS | |
| 111 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 112 | Burning sensation | FAERS: 1 | US FAERS | |
| 113 | Candidiasis | FAERS: 1 | US FAERS | |
| 114 | Capsule issue | FAERS: 1 | US FAERS | |
| 115 | Cardiac Hypertrophy | FAERS: 1 | US FAERS | |
| 116 | Cartilage injury | FAERS: 1 | US FAERS | |
| 117 | Cataract | FAERS: 1 | US FAERS | |
| 118 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 119 | Chromaturia | FAERS: 1 | US FAERS | |
| 120 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 121 | Compression fracture | FAERS: 1 | US FAERS | |
| 122 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 123 | Dehydration | FAERS: 1 | US FAERS | |
| 124 | Device damage | FAERS: 1 | US FAERS | |
| 125 | Device ineffective | FAERS: 1 | US FAERS | |
| 126 | Device use issue | FAERS: 1 | US FAERS | |
| 127 | Diplopia | FAERS: 1 | US FAERS | |
| 128 | Discomfort | FAERS: 1 | US FAERS | |
| 129 | Drowning | FAERS: 1 | US FAERS | |
| 130 | Drug administration error | FAERS: 1 | US FAERS | |
| 131 | Drug dose omission | FAERS: 1 | US FAERS | |
| 132 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 133 | Dysgraphia | FAERS: 1 | US FAERS | |
| 134 | Ear discomfort | FAERS: 1 | US FAERS | |
| 135 | Eczema | FAERS: 1 | US FAERS | |
| 136 | Epistaxis | FAERS: 1 | US FAERS | |
| 137 | Expired product administered | FAERS: 1 | US FAERS | |
| 138 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 139 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 140 | Gastrointestinal candidiasis | FAERS: 1 | US FAERS | |
| 141 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 142 | Hypokinesia | FAERS: 1 | US FAERS | |
| 143 | Hypotension | FAERS: 1 | US FAERS | |
| 144 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 145 | Increased viscosity of bronchial secretion | FAERS: 1 | US FAERS | |
| 146 | Infection | FAERS: 1 | US FAERS | |
| 147 | Influenza | FAERS: 1 | US FAERS | |
| 148 | Intermittent Claudication | FAERS: 1 | US FAERS | |
| 149 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 150 | Lung hyperinflation | FAERS: 1 | US FAERS | |
| 151 | Mastication disorder | FAERS: 1 | US FAERS | |
| 152 | Medical device complication | FAERS: 1 | US FAERS | |
| 153 | Muscle strain | FAERS: 1 | US FAERS | |
| 154 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 155 | Myalgia | FAERS: 1 | US FAERS | |
| 156 | Neck Pain | FAERS: 1 | US FAERS | |
| 157 | Nerve injury | FAERS: 1 | US FAERS | |
| 158 | Ocular Hypertension | FAERS: 1 | US FAERS | |
| 159 | Oral pruritus | FAERS: 1 | US FAERS | |
| 160 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 161 | Oxygen supplementation | FAERS: 1 | US FAERS | |
| 162 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 163 | Pharyngitis | FAERS: 1 | US FAERS | |
| 164 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 165 | Pneumonitis | FAERS: 1 | US FAERS | |
| 166 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 167 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 168 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 169 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 170 | Pulmonary radiation injury | FAERS: 1 | US FAERS | |
| 171 | Purpura | FAERS: 1 | US FAERS | |
| 172 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 173 | Renal pain | FAERS: 1 | US FAERS | |
| 174 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 175 | Respiratory distress | FAERS: 1 | US FAERS | |
| 176 | Respiratory tract infection viral | FAERS: 1 | US FAERS | |
| 177 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 178 | Sense of oppression | FAERS: 1 | US FAERS | |
| 179 | Sinusitis | FAERS: 1 | US FAERS | |
| 180 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 181 | Tolosa-Hunt Syndrome | FAERS: 1 | US FAERS | |
| 182 | Tongue exfoliation | FAERS: 1 | US FAERS | |
| 183 | Tracheobronchitis | FAERS: 1 | US FAERS | |
| 184 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 185 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 186 | Vertigo | FAERS: 1 | US FAERS | |
| 187 | Visual Impairment | FAERS: 1 | US FAERS | |
| 188 | Weight decreased | FAERS: 1 | US FAERS | |
| 189 | Wrong device used | FAERS: 1 | US FAERS | |
| 190 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 191 | muscle injury | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.