salmon calcitonin
(BBBFJLBPOGFECG-VJVYQDLKSA-N)
Structure
- SMILES
- NCCCC[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N)[C@H](O)C)CO)[C@H](O)C)CC(=O)N)[C@H](O)C)CCCNC(=N)N)Cc1ccc(cc1)O)[C@H](O)C)CCC(=O)N)CC(C)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)[C@@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N1)[C@H](O)C)CO)CC(C)C)CC(=O)N)CC(C)C)CCCCN)CC(C)C)CO)CCC(=O)N)CCC(=O)O)CC(C)C)Cc1[nH]cnc1
- Molecular Formula:
- C145H240N44O48S2
- Molecular Weight:
- 3431.850
- Log P:
- -3.8963
- Hydrogen Bond Acceptor:
- 93
- Hydrogen Bond Donor:
- 52
- TPSA:
- 1558.81
- CAS Number(s):
- N/A
Synonym(s)
1.
salmon calcitonin
2.
Calcihexal
3.
Calcimar
4.
Forcaltonin
5.
Fortical
6.
Miacalcic
7.
Miacalcin
8.
calcitonin salmon
9.
recombinant salmon calcitonin
10.
salcatonin
11.
salmon calcitonin (1-32)
12.
synthetic salmon calcitonin
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 10 | US FAERS | |
| 2 | Epistaxis | FAERS: 9 | US FAERS | |
| 3 | Chest discomfort | FAERS: 8 | US FAERS | |
| 4 | Flushing | FAERS: 8 | US FAERS | |
| 5 | Drug ineffective | FAERS: 7 | US FAERS | |
| 6 | Drug ineffective for unapproved indication | FAERS: 7 | US FAERS | |
| 7 | Nasal discomfort | FAERS: 7 | US FAERS | |
| 8 | Back Pain | FAERS: 6 | US FAERS | |
| 9 | Dizziness | FAERS: 6 | US FAERS | |
| 10 | Headache | FAERS: 6 | US FAERS | |
| 11 | Product substitution issue | FAERS: 6 | US FAERS | |
| 12 | Product use issue | FAERS: 6 | US FAERS | |
| 13 | Chills | FAERS: 5 | US FAERS | |
| 14 | Burning sensation | FAERS: 4 | US FAERS | |
| 15 | Incorrect product storage | FAERS: 4 | US FAERS | |
| 16 | Myalgia | FAERS: 4 | US FAERS | |
| 17 | Pain | FAERS: 4 | US FAERS | |
| 18 | Vomiting | FAERS: 4 | US FAERS | |
| 19 | Arthralgia | FAERS: 3 | US FAERS | |
| 20 | Atrial Fibrillation | FAERS: 3 | US FAERS | |
| 21 | Disease Progression | FAERS: 3 | US FAERS | |
| 22 | Hypersensitivity | FAERS: 3 | US FAERS | |
| 23 | Osteoma | FAERS: 3 | US FAERS | |
| 24 | Palpitations | FAERS: 3 | US FAERS | |
| 25 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 26 | Tremor | FAERS: 3 | US FAERS | |
| 27 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 28 | Anxiety | FAERS: 2 | US FAERS | |
| 29 | Asthenia | FAERS: 2 | US FAERS | |
| 30 | Asthma | FAERS: 2 | US FAERS | |
| 31 | Device malfunction | FAERS: 2 | US FAERS | |
| 32 | Disease recurrence | FAERS: 2 | US FAERS | |
| 33 | Disorientation | FAERS: 2 | US FAERS | |
| 34 | Drug administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 35 | Fatigue | FAERS: 2 | US FAERS | |
| 36 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 37 | Pruritus | FAERS: 2 | US FAERS | |
| 38 | Swelling | FAERS: 2 | US FAERS | |
| 39 | Terminal state | FAERS: 2 | US FAERS | |
| 40 | Ulcer | FAERS: 2 | US FAERS | |
| 41 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 42 | Accidental exposure | FAERS: 1 | US FAERS | |
| 43 | Anosmia | FAERS: 1 | US FAERS | |
| 44 | Apparent death | FAERS: 1 | US FAERS | |
| 45 | Application site pain | FAERS: 1 | US FAERS | |
| 46 | Arthritis | FAERS: 1 | US FAERS | |
| 47 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 48 | Blepharospasm | FAERS: 1 | US FAERS | |
| 49 | Bone density increased | FAERS: 1 | US FAERS | |
| 50 | Bone fissure | FAERS: 1 | US FAERS | |
| 51 | Bone formation decreased | FAERS: 1 | US FAERS | |
| 52 | Bone lesion | FAERS: 1 | US FAERS | |
| 53 | Bronchitis | FAERS: 1 | US FAERS | |
| 54 | Bruxism | FAERS: 1 | US FAERS | |
| 55 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 56 | Constipation | FAERS: 1 | US FAERS | |
| 57 | Croup infectious | FAERS: 1 | US FAERS | |
| 58 | Cyanosis | FAERS: 1 | US FAERS | |
| 59 | Dehydration | FAERS: 1 | US FAERS | |
| 60 | Device component issue | FAERS: 1 | US FAERS | |
| 61 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 62 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 63 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 64 | Drug dose omission | FAERS: 1 | US FAERS | |
| 65 | Dysgeusia | FAERS: 1 | US FAERS | |
| 66 | Eye irritation | FAERS: 1 | US FAERS | |
| 67 | Eye pain | FAERS: 1 | US FAERS | |
| 68 | Incorrect dose administered by device | FAERS: 1 | US FAERS | |
| 69 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 70 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 71 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 72 | Increased viscosity of upper respiratory secretion | FAERS: 1 | US FAERS | |
| 73 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 74 | Joint swelling | FAERS: 1 | US FAERS | |
| 75 | Limb asymmetry | FAERS: 1 | US FAERS | |
| 76 | Mental Fatigue | FAERS: 1 | US FAERS | |
| 77 | Multifocal motor neuropathy | FAERS: 1 | US FAERS | |
| 78 | Muscle strain | FAERS: 1 | US FAERS | |
| 79 | Nasal Polyps | FAERS: 1 | US FAERS | |
| 80 | Nasal mucosal disorder | FAERS: 1 | US FAERS | |
| 81 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 82 | Night sweats | FAERS: 1 | US FAERS | |
| 83 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 84 | Osteopenia | FAERS: 1 | US FAERS | |
| 85 | Osteosclerosis | FAERS: 1 | US FAERS | |
| 86 | Pallor | FAERS: 1 | US FAERS | |
| 87 | Plantar erythema | FAERS: 1 | US FAERS | |
| 88 | Pneumonia | FAERS: 1 | US FAERS | |
| 89 | Polyuria | FAERS: 1 | US FAERS | |
| 90 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 91 | Product formulation issue | FAERS: 1 | US FAERS | |
| 92 | Product quality issue | FAERS: 1 | US FAERS | |
| 93 | Product storage error | FAERS: 1 | US FAERS | |
| 94 | Product supply issue | FAERS: 1 | US FAERS | |
| 95 | Rash erythematous | FAERS: 1 | US FAERS | |
| 96 | Renal pain | FAERS: 1 | US FAERS | |
| 97 | Retching | FAERS: 1 | US FAERS | |
| 98 | Rhinalgia | FAERS: 1 | US FAERS | |
| 99 | Rhinitis | FAERS: 1 | US FAERS | |
| 100 | Scab | FAERS: 1 | US FAERS | |
| 101 | Secretion discharge | FAERS: 1 | US FAERS | |
| 102 | Sinus headache | FAERS: 1 | US FAERS | |
| 103 | Skin irritation | FAERS: 1 | US FAERS | |
| 104 | Sneezing | FAERS: 1 | US FAERS | |
| 105 | Stomatitis | FAERS: 1 | US FAERS | |
| 106 | Syncope | FAERS: 1 | US FAERS | |
| 107 | Temporal Arteritis | FAERS: 1 | US FAERS | |
| 108 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 109 | Thirst | FAERS: 1 | US FAERS | |
| 110 | Urticaria | FAERS: 1 | US FAERS | |
| 111 | Vertigo | FAERS: 1 | US FAERS | |
| 112 | Weight decreased | FAERS: 1 | US FAERS | |
| 113 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 114 | treatment failure | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.