Pseudoephedrine
(BALXUFOVQVENIU-KXNXZCPBSA-N)
Structure
- SMILES
- CN[C@H]([C@H](c1ccccc1)O)C.Cl
- Molecular Formula:
- C10H16ClNO
- Molecular Weight:
- 201.693
- Log P:
- 2.5208
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 3
- TPSA:
- 32.26
- CAS Number(s):
- 345-78-8
Synonym(s)
1.
Pseudoephedrine
2.
Isoephedrine
3.
Pseudoephedrine HCl
4.
Pseudoephedrine Hydrochloride
5.
Sudafed
6.
Threo Isomer of Ephedrine
7.
Ephedrine Threo Isomer
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 108 | US FAERS | |
| 2 | Incorrect dose administered | FAERS: 93 | US FAERS | |
| 3 | Product use in unapproved indication | FAERS: 44 | US FAERS | |
| 4 | Dizziness | FAERS: 43 | US FAERS | |
| 5 | Overdose | FAERS: 43 | US FAERS | |
| 6 | Product use issue | FAERS: 41 | US FAERS | |
| 7 | Therapeutic response unexpected | FAERS: 34 | US FAERS | |
| 8 | Extra dose administered | FAERS: 30 | US FAERS | |
| 9 | Headache | FAERS: 28 | US FAERS | |
| 10 | Inappropriate schedule of drug administration | FAERS: 28 | US FAERS | |
| 11 | Drug ineffective for unapproved indication | FAERS: 26 | US FAERS | |
| 12 | Expired product administered | FAERS: 21 | US FAERS | |
| 13 | Drug screen positive | FAERS: 20 | US FAERS | |
| 14 | Incorrect drug administration duration | FAERS: 20 | US FAERS | |
| 15 | Palpitations | FAERS: 20 | US FAERS | |
| 16 | Wrong technique in product usage process | FAERS: 20 | US FAERS | |
| 17 | Dysuria | FAERS: 19 | US FAERS | |
| 18 | Drug effect incomplete | FAERS: 18 | US FAERS | |
| 19 | Nausea | FAERS: 18 | US FAERS | |
| 20 | Product quality issue | FAERS: 17 | US FAERS | |
| 21 | Vomiting | FAERS: 15 | US FAERS | |
| 22 | Tremor | FAERS: 14 | US FAERS | |
| 23 | Feeling jittery | FAERS: 13 | US FAERS | |
| 24 | Nervousness | FAERS: 13 | US FAERS | |
| 25 | Anxiety | FAERS: 11 | US FAERS | |
| 26 | Drug administration error | FAERS: 11 | US FAERS | |
| 27 | Somnolence | FAERS: 11 | US FAERS | |
| 28 | Drug exposure during pregnancy | FAERS: 10 | US FAERS | |
| 29 | Feeling abnormal | FAERS: 10 | US FAERS | |
| 30 | Tachycardia | FAERS: 10 | US FAERS | |
| 31 | Constipation | FAERS: 9 | US FAERS | |
| 32 | Hypersensitivity | FAERS: 9 | US FAERS | |
| 33 | Pruritus | FAERS: 8 | US FAERS | |
| 34 | Sudden infant death syndrome | FAERS: 8 | US FAERS | |
| 35 | Urinary Retention | FAERS: 8 | US FAERS | |
| 36 | Accidental overdose | FAERS: 7 | US FAERS | |
| 37 | Asthenia | FAERS: 7 | US FAERS | |
| 38 | Intentional product misuse | FAERS: 7 | US FAERS | |
| 39 | Malaise | FAERS: 7 | US FAERS | |
| 40 | Poor quality sleep | FAERS: 7 | US FAERS | |
| 41 | Product packaging issue | FAERS: 7 | US FAERS | |
| 42 | Wrong drug administered | FAERS: 7 | US FAERS | |
| 43 | Dehydration | FAERS: 6 | US FAERS | |
| 44 | Drug toxicity | FAERS: 6 | US FAERS | |
| 45 | Erectile dysfunction | FAERS: 6 | US FAERS | |
| 46 | Erythema | FAERS: 6 | US FAERS | |
| 47 | Fatigue | FAERS: 6 | US FAERS | |
| 48 | Myocardial Infarction | FAERS: 6 | US FAERS | |
| 49 | Product label issue | FAERS: 6 | US FAERS | |
| 50 | Accidental exposure to product | FAERS: 5 | US FAERS | |
| 51 | Cerebral vasoconstriction | FAERS: 5 | US FAERS | |
| 52 | Drug Dependence | FAERS: 5 | US FAERS | |
| 53 | Medication Error | FAERS: 5 | US FAERS | |
| 54 | Thirst | FAERS: 5 | US FAERS | |
| 55 | Urticaria | FAERS: 5 | US FAERS | |
| 56 | Abdominal Pain | FAERS: 4 | US FAERS | |
| 57 | Adverse event | FAERS: 4 | US FAERS | |
| 58 | Agitation | FAERS: 4 | US FAERS | |
| 59 | Anoxic Encephalopathy | FAERS: 4 | US FAERS | |
| 60 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 61 | Chest Pain | FAERS: 4 | US FAERS | |
| 62 | Discomfort | FAERS: 4 | US FAERS | |
| 63 | Dysgeusia | FAERS: 4 | US FAERS | |
| 64 | Epistaxis | FAERS: 4 | US FAERS | |
| 65 | Inappropriate schedule of product administration | FAERS: 4 | US FAERS | |
| 66 | Intentional drug misuse | FAERS: 4 | US FAERS | |
| 67 | Pain | FAERS: 4 | US FAERS | |
| 68 | Product expiration date issue | FAERS: 4 | US FAERS | |
| 69 | Product formulation issue | FAERS: 4 | US FAERS | |
| 70 | Product lot number issue | FAERS: 4 | US FAERS | |
| 71 | Product tampering | FAERS: 4 | US FAERS | |
| 72 | Restlessness | FAERS: 4 | US FAERS | |
| 73 | Tinnitus | FAERS: 4 | US FAERS | |
| 74 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 75 | Accidental drug intake by child | FAERS: 3 | US FAERS | |
| 76 | Back Pain | FAERS: 3 | US FAERS | |
| 77 | Incorrect product administration duration | FAERS: 3 | US FAERS | |
| 78 | Lip swelling | FAERS: 3 | US FAERS | |
| 79 | Medication residue present | FAERS: 3 | US FAERS | |
| 80 | Middle insomnia | FAERS: 3 | US FAERS | |
| 81 | No adverse event | FAERS: 3 | US FAERS | |
| 82 | Product physical issue | FAERS: 3 | US FAERS | |
| 83 | Unresponsive to stimuli | FAERS: 3 | US FAERS | |
| 84 | Urine flow decreased | FAERS: 3 | US FAERS | |
| 85 | Visual Impairment | FAERS: 3 | US FAERS | |
| 86 | Weight decreased | FAERS: 3 | US FAERS | |
| 87 | Amnesia | FAERS: 2 | US FAERS | |
| 88 | Anuria | FAERS: 2 | US FAERS | |
| 89 | Aphasia | FAERS: 2 | US FAERS | |
| 90 | Blindness | FAERS: 2 | US FAERS | |
| 91 | Burning sensation | FAERS: 2 | US FAERS | |
| 92 | Cardiac Arrest | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 93 | Chest discomfort | FAERS: 2 | US FAERS | |
| 94 | Chills | FAERS: 2 | US FAERS | |
| 95 | Contraindicated product administered | FAERS: 2 | US FAERS | |
| 96 | Drug abuse | FAERS: 2 | US FAERS | |
| 97 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 98 | Dry skin | FAERS: 2 | US FAERS | |
| 99 | Dysarthria | FAERS: 2 | US FAERS | |
| 100 | Euphoric mood | FAERS: 2 | US FAERS | |
| 101 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 102 | Gastroschisis | FAERS: 2 | US FAERS | |
| 103 | Head discomfort | FAERS: 2 | US FAERS | |
| 104 | Hypotension | FAERS: 2 | US FAERS | |
| 105 | Hysterectomy | FAERS: 2 | US FAERS | |
| 106 | Idiosyncratic drug reaction | FAERS: 2 | US FAERS | |
| 107 | Inflammation | FAERS: 2 | US FAERS | |
| 108 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 109 | Lethargy | FAERS: 2 | US FAERS | |
| 110 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 111 | Myocarditis | FAERS: 2 | US FAERS | |
| 112 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 113 | Nocturia | FAERS: 2 | US FAERS | |
| 114 | Product counterfeit | FAERS: 2 | US FAERS | |
| 115 | Rash erythematous | FAERS: 2 | US FAERS | |
| 116 | Stress | FAERS: 2 | US FAERS | |
| 117 | Syncope | FAERS: 2 | US FAERS | |
| 118 | Unintentional use for unapproved indication | FAERS: 2 | US FAERS | |
| 119 | Vertigo | FAERS: 2 | US FAERS | |
| 120 | Wrong product administered | FAERS: 2 | US FAERS | |
| 121 | Acne | FAERS: 1 | US FAERS | |
| 122 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 123 | Acute psychosis | FAERS: 1 | US FAERS | |
| 124 | Acute sinusitis | FAERS: 1 | US FAERS | |
| 125 | Ageusia | FAERS: 1 | US FAERS | |
| 126 | Alopecia | FAERS: 1 | US FAERS | |
| 127 | Amblyopia | FAERS: 1 | US FAERS | |
| 128 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 129 | Aneurysm | FAERS: 1 | US FAERS | |
| 130 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 131 | Anosmia | FAERS: 1 | US FAERS | |
| 132 | Arthropathy | FAERS: 1 | US FAERS | |
| 133 | Asthma | FAERS: 1 | US FAERS | |
| 134 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 135 | Azoospermia | FAERS: 1 | US FAERS | |
| 136 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 137 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 138 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 139 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 140 | Blood pH increased | FAERS: 1 | US FAERS | |
| 141 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 142 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 143 | Blood urine present | FAERS: 1 | US FAERS | |
| 144 | Bronchitis | FAERS: 1 | US FAERS | |
| 145 | Bruxism | FAERS: 1 | US FAERS | |
| 146 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 147 | Choking sensation | FAERS: 1 | US FAERS | |
| 148 | Chromaturia | FAERS: 1 | US FAERS | |
| 149 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 150 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 151 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 152 | Crying | FAERS: 1 | US FAERS | |
| 153 | Delirium | FAERS: 1 | US FAERS | |
| 154 | Dependence | FAERS: 1 | US FAERS | |
| 155 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 156 | Disorientation | FAERS: 1 | US FAERS | |
| 157 | Dissociation | FAERS: 1 | US FAERS | |
| 158 | Drug dose omission | FAERS: 1 | US FAERS | |
| 159 | Drug effect variable | FAERS: 1 | US FAERS | |
| 160 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 161 | Drug level increased | FAERS: 1 | US FAERS | |
| 162 | Dysmorphism | FAERS: 1 | US FAERS | |
| 163 | Dystonia | FAERS: 1 | US FAERS | |
| 164 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 165 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 166 | Eye irritation | FAERS: 1 | US FAERS | |
| 167 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 168 | Facial Paresis | FAERS: 1 | US FAERS | |
| 169 | Failure of child resistant mechanism for pharmaceutical product | FAERS: 1 | US FAERS | |
| 170 | Flight of ideas | FAERS: 1 | US FAERS | |
| 171 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 172 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 173 | Heat Stroke | FAERS: 1 | US FAERS | |
| 174 | Hemiparesis | FAERS: 1 | US FAERS | |
| 175 | Hepatitis C | FAERS: 1 | US FAERS | |
| 176 | Hypersomnia | FAERS: 1 | US FAERS | |
| 177 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 178 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 179 | Impaired reasoning | FAERS: 1 | US FAERS | |
| 180 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 181 | Initial insomnia | FAERS: 1 | US FAERS | |
| 182 | Intentional misuse | FAERS: 1 | US FAERS | |
| 183 | Intestinal Atresia | FAERS: 1 | US FAERS | |
| 184 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 185 | Intestinal gangrene | FAERS: 1 | US FAERS | |
| 186 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 187 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 188 | Mass excision | FAERS: 1 | US FAERS | |
| 189 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 190 | Mucormycosis | FAERS: 1 | US FAERS | |
| 191 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 192 | Myalgia | FAERS: 1 | US FAERS | |
| 193 | Myoclonus | FAERS: 1 | US FAERS | |
| 194 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 195 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 196 | Neck Pain | FAERS: 1 | US FAERS | |
| 197 | Necrosis | FAERS: 1 | US FAERS | |
| 198 | Negativism | FAERS: 1 | US FAERS | |
| 199 | Neonatal tachycardia | FAERS: 1 | US FAERS | |
| 200 | Nerve injury | FAERS: 1 | US FAERS | |
| 201 | Night sweats | FAERS: 1 | US FAERS | |
| 202 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 203 | Ocular vascular disorder | FAERS: 1 | US FAERS | |
| 204 | Opiates positive | FAERS: 1 | US FAERS | |
| 205 | Optic nerve infarction | FAERS: 1 | US FAERS | |
| 206 | Oral pain | FAERS: 1 | US FAERS | |
| 207 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 208 | Panic Disorder | FAERS: 1 | US FAERS | |
| 209 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 210 | Paranoia | FAERS: 1 | US FAERS | |
| 211 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 212 | Photophobia | FAERS: 1 | US FAERS | |
| 213 | Pleurisy | FAERS: 1 | US FAERS | |
| 214 | Pneumonia | FAERS: 1 | US FAERS | |
| 215 | Polyuria | FAERS: 1 | US FAERS | |
| 216 | Pressure of speech | FAERS: 1 | US FAERS | |
| 217 | Presyncope | FAERS: 1 | US FAERS | |
| 218 | Product barcode issue | FAERS: 1 | US FAERS | |
| 219 | Product package associated injury | FAERS: 1 | US FAERS | |
| 220 | Product residue present | FAERS: 1 | US FAERS | |
| 221 | Product size issue | FAERS: 1 | US FAERS | |
| 222 | Product storage error | FAERS: 1 | US FAERS | |
| 223 | Product substitution issue | FAERS: 1 | US FAERS | |
| 224 | Productive Cough | FAERS: 1 | US FAERS | |
| 225 | Proteinuria | FAERS: 1 | US FAERS | |
| 226 | Quadriplegia | FAERS: 1 | US FAERS | |
| 227 | Renal pain | FAERS: 1 | US FAERS | |
| 228 | Renin increased | FAERS: 1 | US FAERS | |
| 229 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 230 | Retching | FAERS: 1 | US FAERS | |
| 231 | Retinal infarction | FAERS: 1 | US FAERS | |
| 232 | Sinus operation | FAERS: 1 | US FAERS | |
| 233 | Sinus rhythm | FAERS: 1 | US FAERS | |
| 234 | Sinusitis | FAERS: 1 | US FAERS | |
| 235 | Sudden death | FAERS: 1 | US FAERS | |
| 236 | Suicide attempt | FAERS: 1 | US FAERS | |
| 237 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 238 | Swelling | FAERS: 1 | US FAERS | |
| 239 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 240 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 241 | Thrombosis | FAERS: 1 | US FAERS | |
| 242 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 243 | Trigeminal Nerve Disorder | FAERS: 1 | US FAERS | |
| 244 | Ulcer | FAERS: 1 | US FAERS | |
| 245 | Unevaluable event | FAERS: 1 | US FAERS | |
| 246 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 247 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 248 | Urinary tract discomfort | FAERS: 1 | US FAERS | |
| 249 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 250 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 251 | Vaginal lesion | FAERS: 1 | US FAERS | |
| 252 | Vascular rupture | FAERS: 1 | US FAERS | |
| 253 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 254 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 255 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 256 | hypertensive nephropathy | FAERS: 1 | US FAERS | |
| 257 | prostatitis | FAERS: 1 | US FAERS | |
| 258 | Angioedema | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.