hydrocortisone acetate
(ALEXXDVDDISNDU-JZYPGELDSA-N)
Structure
- SMILES
- CC(=O)OCC(=O)[C@@]1(O)CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2CCC2=CC(=O)CC[C@]12C
- Type(s)
- Approved; Vet_approved
- Molecular Formula:
- C23H32O6
- Molecular Weight:
- 404.497
- Log P:
- 2.3524
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 2
- TPSA:
- 100.9
- CAS Number(s):
- 50-03-3; 18325; 42016-02-4
Synonym(s)
1.
hydrocortisone acetate
2.
Colifoam
3.
Cortifoam
4.
Epifoam
5.
cortisol 21-acetate
6.
hydrocortisone 21-acetate
7.
hydrocortisone acetate, (11alpha)-isomer
8.
hydrocortisone acetate, (11beta)-isomer
9.
hydrocortisone acetate, (11beta,17alpha)-isomer
10.
hydrocortisone acetate, monoammonium salt, (11beta)-isomer
11.
hydrocortisone acetate, sodium salt
External Link(s)
| MeSH | C021650 |
| PubChem Compound | 5744 |
| ChEBI | 17609 |
| CHEMBL | CHEMBL1091 |
| DrugBank | DB14539 |
| DrugCentral | 4213 |
| KEGG | dr:D00165 cpd:C02821 |
| ZINC | 3875333 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 2 | Malaise | FAERS: 5 | US FAERS | |
| 3 | Pain | FAERS: 4 | US FAERS | |
| 4 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 5 | Anxiety | FAERS: 2 | US FAERS | |
| 6 | Application site pain | FAERS: 2 | US FAERS | |
| 7 | Cataract | FAERS: 2 | US FAERS | |
| 8 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 9 | Endophthalmitis | FAERS: 2 | US FAERS | |
| 10 | Hypertrophic Cardiomyopathy | FAERS: 2 | US FAERS | |
| 11 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 12 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 13 | Pruritus | FAERS: 2 | US FAERS | |
| 14 | Skin reaction | FAERS: 2 | US FAERS | |
| 15 | Vomiting | FAERS: 2 | US FAERS | |
| 16 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 17 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 18 | Akinesia | FAERS: 1 | US FAERS | |
| 19 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 20 | Aortic Aneurysm | FAERS: 1 | 2346371 | CTD US FAERS |
| 21 | Application site irritation | FAERS: 1 | US FAERS | |
| 22 | Arthralgia | FAERS: 1 | US FAERS | |
| 23 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 24 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 25 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 26 | Chest Pain | FAERS: 1 | US FAERS | |
| 27 | Chronic Fatigue Syndrome | FAERS: 1 | US FAERS | |
| 28 | Constipation | FAERS: 1 | US FAERS | |
| 29 | Dermatitis | FAERS: 1 | US FAERS | |
| 30 | Device malfunction | FAERS: 1 | US FAERS | |
| 31 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 32 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 33 | Dizziness | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Drug Dependence | FAERS: 1 | US FAERS | |
| 35 | Drug dose omission | FAERS: 1 | US FAERS | |
| 36 | Economic problem | FAERS: 1 | US FAERS | |
| 37 | Erythema | FAERS: 1 | US FAERS | |
| 38 | Fatigue | FAERS: 1 | US FAERS | |
| 39 | Food Poisoning | FAERS: 1 | US FAERS | |
| 40 | Hypotension | FAERS: 1 | US FAERS | |
| 41 | Infertility | FAERS: 1 | US FAERS | |
| 42 | Inflammation | FAERS: 1 | US FAERS | |
| 43 | Insulin Resistance | FAERS: 1 | US FAERS | |
| 44 | Lethargy | FAERS: 1 | US FAERS | |
| 45 | Lip swelling | FAERS: 1 | US FAERS | |
| 46 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 47 | Medication Error | FAERS: 1 | US FAERS | |
| 48 | Myalgia | FAERS: 1 | US FAERS | |
| 49 | Pneumonia | FAERS: 1 | US FAERS | |
| 50 | Posterior capsule opacification | FAERS: 1 | US FAERS | |
| 51 | Product quality issue | FAERS: 1 | US FAERS | |
| 52 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 53 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 54 | Product use issue | FAERS: 1 | US FAERS | |
| 55 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 56 | Rash erythematous | FAERS: 1 | US FAERS | |
| 57 | Rectal discharge | FAERS: 1 | US FAERS | |
| 58 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 59 | Reversible cerebral vasoconstriction syndrome | FAERS: 1 | US FAERS | |
| 60 | Skin lesion | FAERS: 1 | US FAERS | |
| 61 | Somnolence | FAERS: 1 | US FAERS | |
| 62 | Sperm concentration decreased | FAERS: 1 | US FAERS | |
| 63 | Syncope | FAERS: 1 | US FAERS | |
| 64 | Ventricular Fibrillation | FAERS: 1 | 4457230 | CTD US FAERS |
| 65 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 66 | treatment failure | FAERS: 1 | US FAERS | |
| 67 | Bowel movement irregularity | Canada Vigilance: 1 | Canada Vigilance | |
| 68 | Drug Eruptions | 133840 | CTD | |
| 69 | Headache | Canada Vigilance: 1 | Canada Vigilance | |
| 70 | Muscular Atrophy | 3693188 | CTD | |
| 71 | Ocular Hypertension | 20212205 | CTD | |
| 72 | Polycystic Kidney Diseases | 1882347 2313979 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.