valrubicin
(ZOCKGBMQLCSHFP-KQRAQHLDSA-N)
Structure
- SMILES
- CCCCC(=O)OCC(=O)[C@@]1(O)C[C@H](O[C@H]2C[C@H](NC(=O)C(F)(F)F)[C@@H]([C@@H](O2)C)O)c2c(C1)c(O)c1c(c2O)C(=O)c2c(C1=O)cccc2OC
- Type(s)
- Approved
- ATC code(s)
- L01DB09
- Molecular Formula:
- C34H36F3NO13
- Molecular Weight:
- 723.644
- Log P:
- 2.8531
- Hydrogen Bond Acceptor:
- 14
- Hydrogen Bond Donor:
- 5
- TPSA:
- 215.22
- CAS Number(s):
- 56124-62-0
Synonym(s)
1.
valrubicin
2.
AD 32
3.
AD-32
4.
N-trifluoroacetyladriamycin 14-valerate
5.
NSC-246131
6.
Valstar
7.
Valtaxin
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Accidental exposure to product | FAERS: 22 | US FAERS | |
| 2 | Bladder instillation procedure | FAERS: 18 | US FAERS | |
| 3 | Urge Incontinence | FAERS: 15 | US FAERS | |
| 4 | Urinary Incontinence | FAERS: 8 | SIDER US FAERS | |
| 5 | Dysuria | FAERS: 7 | SIDER US FAERS | |
| 6 | Bladder spasm | FAERS: 6 | SIDER US FAERS | |
| 7 | Drug ineffective | FAERS: 6 | US FAERS | |
| 8 | Pain | FAERS: 6 | US FAERS | |
| 9 | Burning sensation | FAERS: 5 | US FAERS | |
| 10 | Infection | FAERS: 5 | US FAERS | |
| 11 | Abdominal Pain | FAERS: 4 | SIDER US FAERS | |
| 12 | Injury associated with device | FAERS: 3 | US FAERS | |
| 13 | Instillation site pain | FAERS: 3 | US FAERS | |
| 14 | Nausea | FAERS: 3 | SIDER US FAERS | |
| 15 | Pneumonia | FAERS: 3 | SIDER US FAERS | |
| 16 | Urinary tract infection | FAERS: 3 | SIDER US FAERS | |
| 17 | Asthenia | FAERS: 2 | SIDER US FAERS | |
| 18 | Back Pain | FAERS: 2 | SIDER US FAERS | |
| 19 | Bladder cancer recurrent | FAERS: 2 | US FAERS | |
| 20 | Blood urine present | FAERS: 2 | US FAERS | |
| 21 | Disease Progression | FAERS: 2 | US FAERS | |
| 22 | Disease recurrence | FAERS: 2 | US FAERS | |
| 23 | Dizziness | FAERS: 2 | SIDER US FAERS | |
| 24 | Drug dose omission | FAERS: 2 | US FAERS | |
| 25 | Dysgeusia | FAERS: 2 | US FAERS | |
| 26 | Instillation site erythema | FAERS: 2 | US FAERS | |
| 27 | Lip swelling | FAERS: 2 | US FAERS | |
| 28 | Adverse event | FAERS: 1 | US FAERS | |
| 29 | Agitation | FAERS: 1 | US FAERS | |
| 30 | Anxiety | FAERS: 1 | US FAERS | |
| 31 | Arthralgia | FAERS: 1 | US FAERS | |
| 32 | Bladder pain | FAERS: 1 | SIDER US FAERS | |
| 33 | Blindness | FAERS: 1 | US FAERS | |
| 34 | Burning feet syndrome | FAERS: 1 | US FAERS | |
| 35 | Cellulitis | FAERS: 1 | US FAERS | |
| 36 | Chemical cystitis | FAERS: 1 | US FAERS | |
| 37 | Chromaturia | FAERS: 1 | US FAERS | |
| 38 | Constipation | FAERS: 1 | US FAERS | |
| 39 | Cystitis | FAERS: 1 | SIDER US FAERS | |
| 40 | Cyst | FAERS: 1 | US FAERS | |
| 41 | Dose calculation error | FAERS: 1 | US FAERS | |
| 42 | Drug administration error | FAERS: 1 | US FAERS | |
| 43 | Dyspepsia | FAERS: 1 | US FAERS | |
| 44 | Erythema | FAERS: 1 | US FAERS | |
| 45 | Eye irritation | FAERS: 1 | US FAERS | |
| 46 | Fatigue | FAERS: 1 | US FAERS | |
| 47 | Flushing | FAERS: 1 | US FAERS | |
| 48 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 49 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 50 | Incorrect product formulation administered | FAERS: 1 | US FAERS | |
| 51 | Instillation site warmth | FAERS: 1 | US FAERS | |
| 52 | Iritis | FAERS: 1 | US FAERS | |
| 53 | Lethargy | FAERS: 1 | US FAERS | |
| 54 | Malaise | FAERS: 1 | SIDER US FAERS | |
| 55 | Medication Error | FAERS: 1 | US FAERS | |
| 56 | No adverse event | FAERS: 1 | US FAERS | |
| 57 | Nocturia | FAERS: 1 | SIDER US FAERS | |
| 58 | Overdose | FAERS: 1 | US FAERS | |
| 59 | Penile swelling | FAERS: 1 | US FAERS | |
| 60 | Personality Change | FAERS: 1 | US FAERS | |
| 61 | Procedural complication | FAERS: 1 | US FAERS | |
| 62 | Pruritus | FAERS: 1 | SIDER US FAERS | |
| 63 | Renal pain | FAERS: 1 | US FAERS | |
| 64 | Skin irritation | FAERS: 1 | SIDER US FAERS | |
| 65 | Sneezing | FAERS: 1 | US FAERS | |
| 66 | Somnolence | FAERS: 1 | US FAERS | |
| 67 | Stomatitis | FAERS: 1 | US FAERS | |
| 68 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 69 | Unevaluable event | FAERS: 1 | US FAERS | |
| 70 | Urethral Stenosis | FAERS: 1 | US FAERS | |
| 71 | Urinary sediment present | FAERS: 1 | US FAERS | |
| 72 | Visual Impairment | FAERS: 1 | US FAERS | |
| 73 | Vomiting | FAERS: 1 | SIDER US FAERS | |
| 74 | Weight decreased | FAERS: 1 | US FAERS | |
| 75 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 76 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 77 | Ageusia | SIDER | ||
| 78 | Anorectal discomfort | SIDER | ||
| 79 | Blood urea increased | SIDER | ||
| 80 | Cardiomyopathies | 528374 | CTD | |
| 81 | Chest Pain | SIDER | ||
| 82 | Dermatitis | SIDER | ||
| 83 | Discomfort | SIDER | ||
| 84 | Feeling abnormal | SIDER | ||
| 85 | Flatulence | SIDER | ||
| 86 | Gastrointestinal Pain | SIDER | ||
| 87 | Headache | SIDER | ||
| 88 | Local reaction | SIDER | ||
| 89 | Musculoskeletal discomfort | SIDER | ||
| 90 | Myalgia | SIDER | ||
| 91 | Pelvic Pain | SIDER | ||
| 92 | Rectal tenesmus | SIDER | ||
| 93 | Urethritis noninfective | SIDER | ||
| 94 | Urethritis | SIDER | ||
| 95 | Urinary Retention | SIDER | ||
| 96 | Vasodilation procedure | SIDER | ||
| 97 | Vasodilation | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.