azelastine
(YEJAJYAHJQIWNU-UHFFFAOYSA-N)
Structure
- SMILES
- CN1CCCC(CC1)n1nc(Cc2ccc(cc2)Cl)c2c(c1=O)cccc2.Cl
- Molecular Formula:
- C22H25Cl2N3O
- Molecular Weight:
- 418.359
- Log P:
- 5.0374
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 1
- TPSA:
- 38.13
- CAS Number(s):
- 37932-96-0; 79307-93-0
Synonym(s)
1.
azelastine
2.
4-((4-chlorophenyl)methyl)-2- (hexahydro-1-methyl-1H-azepin-4-yl)-1(2H)- phthalazinone HCl
3.
4-(p-chlorobenzyl)-2-(N-methylperhydroazepinyl-(4))-1-(2H)-phthalazinone
4.
A 5610
5.
A-5610
6.
Afluon
7.
Allergodil
8.
Astelin
9.
Azeptin
10.
Corifina
11.
Loxin
12.
Optilast
13.
Optivar
14.
Rhinolast
15.
Vividrin akut Azelastin
16.
azelastine hydrochloride
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 247 | US FAERS | |
| 2 | Dysgeusia | FAERS: 104 | US FAERS | |
| 3 | Nasal discomfort | FAERS: 41 | US FAERS | |
| 4 | Wrong technique in product usage process | FAERS: 36 | US FAERS | |
| 5 | Dizziness | FAERS: 28 | US FAERS | |
| 6 | Headache | FAERS: 28 | US FAERS | |
| 7 | Somnolence | FAERS: 28 | US FAERS | |
| 8 | Sneezing | FAERS: 25 | US FAERS | |
| 9 | Eye irritation | FAERS: 21 | US FAERS | |
| 10 | Nausea | FAERS: 20 | US FAERS | |
| 11 | Product quality issue | FAERS: 17 | US FAERS | |
| 12 | Epistaxis | FAERS: 16 | US FAERS | |
| 13 | Accidental exposure to product | FAERS: 14 | US FAERS | |
| 14 | Throat irritation | FAERS: 13 | US FAERS | |
| 15 | Anosmia | FAERS: 12 | US FAERS | |
| 16 | Oropharyngeal pain | FAERS: 12 | US FAERS | |
| 17 | Fatigue | FAERS: 11 | US FAERS | |
| 18 | Hypersensitivity | FAERS: 11 | US FAERS | |
| 19 | Product taste abnormal | FAERS: 11 | US FAERS | |
| 20 | Vomiting | FAERS: 10 | US FAERS | |
| 21 | Palpitations | FAERS: 9 | US FAERS | |
| 22 | Product substitution issue | FAERS: 9 | US FAERS | |
| 23 | Pruritus | FAERS: 9 | US FAERS | |
| 24 | Rhinalgia | FAERS: 9 | US FAERS | |
| 25 | Feeling abnormal | FAERS: 8 | US FAERS | |
| 26 | Incorrect dose administered | FAERS: 8 | US FAERS | |
| 27 | Malaise | FAERS: 8 | US FAERS | |
| 28 | Ageusia | FAERS: 7 | US FAERS | |
| 29 | Expired product administered | FAERS: 7 | US FAERS | |
| 30 | Eye pain | FAERS: 7 | US FAERS | |
| 31 | Pain | FAERS: 7 | US FAERS | |
| 32 | Wheezing | FAERS: 7 | US FAERS | |
| 33 | Anxiety | FAERS: 6 | US FAERS | |
| 34 | Sinusitis | FAERS: 6 | US FAERS | |
| 35 | Chest discomfort | FAERS: 5 | US FAERS | |
| 36 | Ear discomfort | FAERS: 5 | US FAERS | |
| 37 | Erythema | FAERS: 5 | US FAERS | |
| 38 | No adverse event | FAERS: 5 | US FAERS | |
| 39 | Product use issue | FAERS: 5 | US FAERS | |
| 40 | Retching | FAERS: 5 | US FAERS | |
| 41 | Chest Pain | FAERS: 4 | US FAERS | |
| 42 | Disorientation | FAERS: 4 | US FAERS | |
| 43 | Drug ineffective for unapproved indication | FAERS: 4 | US FAERS | |
| 44 | Flushing | FAERS: 4 | US FAERS | |
| 45 | Abdominal Pain | FAERS: 3 | US FAERS | |
| 46 | Asthenia | FAERS: 3 | US FAERS | |
| 47 | Burning sensation | FAERS: 3 | US FAERS | |
| 48 | Dysphonia | FAERS: 3 | US FAERS | |
| 49 | Head discomfort | FAERS: 3 | US FAERS | |
| 50 | Mydriasis | FAERS: 3 | US FAERS | |
| 51 | Neck Pain | FAERS: 3 | US FAERS | |
| 52 | Paranasal sinus hypersecretion | FAERS: 3 | US FAERS | |
| 53 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 54 | Pharmaceutical product complaint | FAERS: 3 | US FAERS | |
| 55 | Syncope | FAERS: 3 | US FAERS | |
| 56 | Tachycardia | FAERS: 3 | US FAERS | |
| 57 | Upper-airway cough syndrome | FAERS: 3 | US FAERS | |
| 58 | Urticaria | FAERS: 3 | US FAERS | |
| 59 | Visual Impairment | FAERS: 3 | US FAERS | |
| 60 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 61 | Abdominal symptom | FAERS: 2 | US FAERS | |
| 62 | Agitation | FAERS: 2 | US FAERS | |
| 63 | Arthralgia | FAERS: 2 | US FAERS | |
| 64 | Asthma | FAERS: 2 | US FAERS | |
| 65 | Ataxia | FAERS: 2 | US FAERS | |
| 66 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 67 | Choking sensation | FAERS: 2 | US FAERS | |
| 68 | Contraindicated product administered | FAERS: 2 | US FAERS | |
| 69 | Discomfort | FAERS: 2 | US FAERS | |
| 70 | Drug administration error | FAERS: 2 | US FAERS | |
| 71 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 72 | Ear congestion | FAERS: 2 | US FAERS | |
| 73 | Eye Infection | FAERS: 2 | US FAERS | |
| 74 | Facial Pain | FAERS: 2 | US FAERS | |
| 75 | Hypersomnia | FAERS: 2 | US FAERS | |
| 76 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 77 | Joint swelling | FAERS: 2 | US FAERS | |
| 78 | Laceration | FAERS: 2 | US FAERS | |
| 79 | Laryngitis | FAERS: 2 | US FAERS | |
| 80 | Lethargy | FAERS: 2 | US FAERS | |
| 81 | Lip swelling | FAERS: 2 | US FAERS | |
| 82 | Medication Error | FAERS: 2 | US FAERS | |
| 83 | Memory impairment | FAERS: 2 | US FAERS | |
| 84 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 85 | Myalgia | FAERS: 2 | US FAERS | |
| 86 | Nervousness | FAERS: 2 | US FAERS | |
| 87 | Product contamination | FAERS: 2 | US FAERS | |
| 88 | Product label issue | FAERS: 2 | US FAERS | |
| 89 | Swelling | FAERS: 2 | US FAERS | |
| 90 | Tinnitus | FAERS: 2 | US FAERS | |
| 91 | Vertigo | FAERS: 2 | US FAERS | |
| 92 | Visual disturbance | FAERS: 2 | US FAERS | |
| 93 | Abasia | FAERS: 1 | US FAERS | |
| 94 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 95 | Accidental overdose | FAERS: 1 | US FAERS | |
| 96 | Allergic sinusitis | FAERS: 1 | US FAERS | |
| 97 | Alopecia | FAERS: 1 | US FAERS | |
| 98 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 99 | Anger | FAERS: 1 | US FAERS | |
| 100 | Animal bite | FAERS: 1 | US FAERS | |
| 101 | Anticholinergic Syndrome | FAERS: 1 | US FAERS | |
| 102 | Application site pain | FAERS: 1 | US FAERS | |
| 103 | Application site pruritus | FAERS: 1 | US FAERS | |
| 104 | Application site scab | FAERS: 1 | US FAERS | |
| 105 | Bedridden | FAERS: 1 | US FAERS | |
| 106 | Blepharospasm | FAERS: 1 | US FAERS | |
| 107 | Blindness | FAERS: 1 | US FAERS | |
| 108 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 109 | Bronchitis | FAERS: 1 | US FAERS | |
| 110 | Bronchospasm | FAERS: 1 | US FAERS | |
| 111 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 112 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 113 | Chemical injury | FAERS: 1 | US FAERS | |
| 114 | Choking | FAERS: 1 | US FAERS | |
| 115 | Complication associated with device | FAERS: 1 | US FAERS | |
| 116 | Constipation | FAERS: 1 | US FAERS | |
| 117 | Crying | FAERS: 1 | US FAERS | |
| 118 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 119 | Dehydration | FAERS: 1 | US FAERS | |
| 120 | Delirium | FAERS: 1 | US FAERS | |
| 121 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 122 | Dermatitis | FAERS: 1 | US FAERS | |
| 123 | Disease recurrence | FAERS: 1 | US FAERS | |
| 124 | Documented hypersensitivity to administered drug | FAERS: 1 | US FAERS | |
| 125 | Drug abuser | FAERS: 1 | US FAERS | |
| 126 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 127 | Drug dose omission | FAERS: 1 | US FAERS | |
| 128 | Dry skin | FAERS: 1 | US FAERS | |
| 129 | Emotional disorder | FAERS: 1 | US FAERS | |
| 130 | Expired drug administered | FAERS: 1 | US FAERS | |
| 131 | Eye allergy | FAERS: 1 | US FAERS | |
| 132 | Eye inflammation | FAERS: 1 | US FAERS | |
| 133 | Feeling jittery | FAERS: 1 | US FAERS | |
| 134 | Flatulence | FAERS: 1 | US FAERS | |
| 135 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 136 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 137 | Hunger | FAERS: 1 | US FAERS | |
| 138 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 139 | Hypogeusia | FAERS: 1 | US FAERS | |
| 140 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 141 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 142 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 143 | Inflammation | FAERS: 1 | US FAERS | |
| 144 | Influenza | FAERS: 1 | US FAERS | |
| 145 | Instillation site infection | FAERS: 1 | US FAERS | |
| 146 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 147 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 148 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 149 | Leukoplakia | FAERS: 1 | US FAERS | |
| 150 | Lichen Planus | FAERS: 1 | US FAERS | |
| 151 | Medication tampering | FAERS: 1 | US FAERS | |
| 152 | Mental impairment | FAERS: 1 | US FAERS | |
| 153 | Middle insomnia | FAERS: 1 | US FAERS | |
| 154 | Moaning | FAERS: 1 | US FAERS | |
| 155 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 156 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 157 | Nystagmus | FAERS: 1 | US FAERS | |
| 158 | Oral pain | FAERS: 1 | US FAERS | |
| 159 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 160 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 161 | Panic Disorder | FAERS: 1 | US FAERS | |
| 162 | Perioral Dermatitis | FAERS: 1 | US FAERS | |
| 163 | Periorbital contusion | FAERS: 1 | US FAERS | |
| 164 | Pneumonia | FAERS: 1 | US FAERS | |
| 165 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 166 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 167 | Presyncope | FAERS: 1 | US FAERS | |
| 168 | Product package associated injury | FAERS: 1 | US FAERS | |
| 169 | Product packaging issue | FAERS: 1 | US FAERS | |
| 170 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 171 | Product physical issue | FAERS: 1 | US FAERS | |
| 172 | Productive Cough | FAERS: 1 | US FAERS | |
| 173 | Reaction to preservatives | FAERS: 1 | US FAERS | |
| 174 | Renal pain | FAERS: 1 | US FAERS | |
| 175 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 176 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 177 | Scab | FAERS: 1 | US FAERS | |
| 178 | Sinus headache | FAERS: 1 | US FAERS | |
| 179 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 180 | Skin irritation | FAERS: 1 | US FAERS | |
| 181 | Snoring | FAERS: 1 | US FAERS | |
| 182 | Stomatitis | FAERS: 1 | US FAERS | |
| 183 | Therapeutic product ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 184 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 185 | Tongue blistering | FAERS: 1 | US FAERS | |
| 186 | Unevaluable event | FAERS: 1 | US FAERS | |
| 187 | Upper airway obstruction | FAERS: 1 | US FAERS | |
| 188 | Urinary Retention | FAERS: 1 | US FAERS | |
| 189 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 190 | Uterine spasm | FAERS: 1 | US FAERS | |
| 191 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 192 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 193 | Walking aid user | FAERS: 1 | US FAERS | |
| 194 | Weight decreased | FAERS: 1 | US FAERS | |
| 195 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 196 | treatment failure | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.