Tetracycline
(YCIHPQHVWDULOY-FMZCEJRJSA-N)
Structure
- SMILES
- CN([C@@H]1C(=O)C(=C([C@@]2([C@H]1C[C@H]1C(=C(O)c3c([C@@]1(C)O)cccc3O)C2=O)O)O)C(=O)N)C.Cl
- Molecular Formula:
- C22H25ClN2O8
- Molecular Weight:
- 480.895
- Log P:
- 1.1313
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 7
- TPSA:
- 181.62
- CAS Number(s):
- 64-75-5
Synonym(s)
1.
Tetracycline
2.
4-Epitetracycline
3.
Achromycin
4.
Achromycin V
5.
Hostacyclin
6.
Sustamycin
7.
Tetrabid
8.
Tetracycline Hydrochloride
9.
Tetracycline Monohydrochloride
10.
Topicycline
11.
4 Epitetracycline
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Urticaria | FAERS: 31 | US FAERS | |
| 2 | Nausea | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Hypersensitivity | FAERS: 18 | US FAERS | |
| 4 | Vomiting | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Tooth Loss | FAERS: 14 | US FAERS | |
| 6 | Maternal exposure during pregnancy | FAERS: 13 | US FAERS | |
| 7 | Pain | FAERS: 10 | US FAERS | |
| 8 | Abdominal discomfort | FAERS: 9 | US FAERS | |
| 9 | Pruritus | FAERS: 7 | US FAERS | |
| 10 | Swelling | FAERS: 7 | US FAERS | |
| 11 | Dental caries | FAERS: 6 | US FAERS | |
| 12 | Headache | FAERS: 6 | US FAERS | |
| 13 | Toothache | FAERS: 6 | US FAERS | |
| 14 | Abdominal Pain | FAERS: 5 | US FAERS | |
| 15 | Deafness | FAERS: 5 | US FAERS | |
| 16 | Drug administered to patient of inappropriate age | FAERS: 5 | US FAERS | |
| 17 | Feeling abnormal | FAERS: 5 | US FAERS | |
| 18 | Dizziness | FAERS: 4 | US FAERS | |
| 19 | Emotional distress | FAERS: 4 | US FAERS | |
| 20 | Enamel anomaly | FAERS: 4 | US FAERS | |
| 21 | Teeth brittle | FAERS: 4 | US FAERS | |
| 22 | Maternal exposure timing unspecified | FAERS: 3 | US FAERS | |
| 23 | Mood swings | FAERS: 3 | US FAERS | |
| 24 | Overdose | FAERS: 3 | US FAERS | |
| 25 | Personality Change | FAERS: 3 | US FAERS | |
| 26 | Stevens-Johnson Syndrome | FAERS: 3 | US FAERS | |
| 27 | Tooth Erosion | FAERS: 3 | US FAERS | |
| 28 | Amaurosis Fugax | FAERS: 2 | US FAERS | |
| 29 | Bipolar I disorder | FAERS: 2 | US FAERS | |
| 30 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 31 | Bruxism | FAERS: 2 | US FAERS | |
| 32 | Drug ineffective | FAERS: 2 | US FAERS | |
| 33 | Fatigue | FAERS: 2 | US FAERS | |
| 34 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 35 | No adverse event | FAERS: 2 | US FAERS | |
| 36 | Pancreatitis | FAERS: 2 | US FAERS | |
| 37 | Product label issue | FAERS: 2 | US FAERS | |
| 38 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 39 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 40 | Tooth Infection | FAERS: 2 | US FAERS | |
| 41 | Visual Impairment | FAERS: 2 | US FAERS | |
| 42 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 43 | Angioedema | FAERS: 1 | US FAERS | |
| 44 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 45 | Arthritis | FAERS: 1 | US FAERS | |
| 46 | Asthenia | FAERS: 1 | US FAERS | |
| 47 | Back disorder | FAERS: 1 | US FAERS | |
| 48 | Blindness | FAERS: 1 | US FAERS | |
| 49 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 50 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 51 | Culture positive | FAERS: 1 | US FAERS | |
| 52 | Dehydration | FAERS: 1 | US FAERS | |
| 53 | Discomfort | FAERS: 1 | US FAERS | |
| 54 | Diverticulitis | FAERS: 1 | US FAERS | |
| 55 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 56 | Drug label confusion | FAERS: 1 | US FAERS | |
| 57 | Drug resistance | FAERS: 1 | US FAERS | |
| 58 | Epilepsy | FAERS: 1 | US FAERS | |
| 59 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 60 | Erythema | FAERS: 1 | US FAERS | |
| 61 | Euphoric mood | FAERS: 1 | US FAERS | |
| 62 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 63 | Glossitis | FAERS: 1 | US FAERS | |
| 64 | Hunger | FAERS: 1 | US FAERS | |
| 65 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 66 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 67 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 68 | Leukocytosis | FAERS: 1 | US FAERS | |
| 69 | Loose tooth | FAERS: 1 | US FAERS | |
| 70 | Malaise | FAERS: 1 | US FAERS | |
| 71 | Mastication disorder | FAERS: 1 | US FAERS | |
| 72 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 73 | Middle insomnia | FAERS: 1 | US FAERS | |
| 74 | Mouth swelling | FAERS: 1 | US FAERS | |
| 75 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 76 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 77 | Myocarditis | FAERS: 1 | US FAERS | |
| 78 | Neck Pain | FAERS: 1 | US FAERS | |
| 79 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 80 | Neuronal neuropathy | FAERS: 1 | US FAERS | |
| 81 | Night sweats | FAERS: 1 | US FAERS | |
| 82 | Nystagmus | FAERS: 1 | US FAERS | |
| 83 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 84 | Oral pain | FAERS: 1 | US FAERS | |
| 85 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 86 | Physical product label issue | FAERS: 1 | US FAERS | |
| 87 | Product use issue | FAERS: 1 | US FAERS | |
| 88 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 89 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 90 | Skin lesion | FAERS: 1 | US FAERS | |
| 91 | Skin reaction | FAERS: 1 | US FAERS | |
| 92 | Stillbirth | FAERS: 1 | US FAERS | |
| 93 | Thirst decreased | FAERS: 1 | US FAERS | |
| 94 | Thirst | FAERS: 1 | US FAERS | |
| 95 | Tinnitus | FAERS: 1 | US FAERS | |
| 96 | Tremor | FAERS: 1 | US FAERS | |
| 97 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 98 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 99 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 100 | Wheezing | FAERS: 1 | US FAERS | |
| 101 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.