hydrochlorothiazide, losartan drug combination
(XRKMYXDEMOEFBN-UHFFFAOYSA-N)
Structure
- SMILES
- Clc1cc2NCNS(=O)(=O)c2cc1S(=O)(=O)N.CCCCc1nc(c(n1Cc1ccc(cc1)c1ccccc1c1[n-]nnn1)CO)Cl.[K+]
- Molecular Formula:
- C29H30Cl2KN9O5S2
- Molecular Weight:
- 758.740
- Log P:
- 6.8733
- Hydrogen Bond Acceptor:
- 13
- Hydrogen Bond Donor:
- 4
- TPSA:
- 224.73
- CAS Number(s):
- 156154-37-9
Synonym(s)
1.
hydrochlorothiazide, losartan drug combination
2.
Hyzaar
3.
Preminent
4.
hydrochlorothiazide - losartan
5.
hydrochlorothiazide - losartan potassium
6.
hydrochlorothiazide, losartan potassium drug combination
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Product substitution issue | FAERS: 26 | US FAERS | |
| 2 | Drug ineffective | FAERS: 24 | US FAERS | |
| 3 | Headache | FAERS: 14 | US FAERS | |
| 4 | Feeling abnormal | FAERS: 9 | US FAERS | |
| 5 | Dizziness | FAERS: 8 | US FAERS | |
| 6 | Malaise | FAERS: 7 | US FAERS | |
| 7 | Product quality issue | FAERS: 7 | US FAERS | |
| 8 | Dysgeusia | FAERS: 5 | US FAERS | |
| 9 | Joint swelling | FAERS: 5 | US FAERS | |
| 10 | Adverse event | FAERS: 4 | US FAERS | |
| 11 | Asthenia | FAERS: 4 | US FAERS | |
| 12 | Blood pressure fluctuation | FAERS: 4 | US FAERS | |
| 13 | Fatigue | FAERS: 4 | US FAERS | |
| 14 | Lip swelling | FAERS: 4 | US FAERS | |
| 15 | Nausea | FAERS: 4 | US FAERS | |
| 16 | Pain | FAERS: 4 | US FAERS | |
| 17 | Pruritus | FAERS: 4 | US FAERS | |
| 18 | Psoriasis | FAERS: 4 | US FAERS | |
| 19 | Syncope | FAERS: 4 | US FAERS | |
| 20 | Urticaria | FAERS: 4 | US FAERS | |
| 21 | Angioedema | FAERS: 3 | US FAERS | |
| 22 | Apparent death | FAERS: 3 | US FAERS | |
| 23 | Arthralgia | FAERS: 3 | US FAERS | |
| 24 | Blood potassium decreased | FAERS: 3 | US FAERS | |
| 25 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 26 | Chest Pain | FAERS: 3 | US FAERS | |
| 27 | Erythema | FAERS: 3 | US FAERS | |
| 28 | Hypotension | FAERS: 3 | US FAERS | |
| 29 | Nervousness | FAERS: 3 | US FAERS | |
| 30 | Palpitations | FAERS: 3 | US FAERS | |
| 31 | Swelling | FAERS: 3 | US FAERS | |
| 32 | Tinnitus | FAERS: 3 | US FAERS | |
| 33 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 34 | Back Pain | FAERS: 2 | US FAERS | |
| 35 | Blood pressure inadequately controlled | FAERS: 2 | US FAERS | |
| 36 | Dehydration | FAERS: 2 | US FAERS | |
| 37 | Diplopia | FAERS: 2 | US FAERS | |
| 38 | Eye pain | FAERS: 2 | US FAERS | |
| 39 | Flushing | FAERS: 2 | US FAERS | |
| 40 | Fracture | FAERS: 2 | US FAERS | |
| 41 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 42 | Medication residue | FAERS: 2 | US FAERS | |
| 43 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 44 | Musculoskeletal discomfort | FAERS: 2 | US FAERS | |
| 45 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 46 | Myalgia | FAERS: 2 | US FAERS | |
| 47 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 48 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 49 | Product physical issue | FAERS: 2 | US FAERS | |
| 50 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 51 | Restlessness | FAERS: 2 | US FAERS | |
| 52 | Squamous cell carcinoma of skin | FAERS: 2 | US FAERS | |
| 53 | Tachycardia | FAERS: 2 | US FAERS | |
| 54 | Unevaluable event | FAERS: 2 | US FAERS | |
| 55 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 56 | Actinic keratosis | FAERS: 1 | US FAERS | |
| 57 | Alopecia | FAERS: 1 | US FAERS | |
| 58 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 59 | Amnesia | FAERS: 1 | US FAERS | |
| 60 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 61 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 62 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 63 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 64 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 65 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 66 | Bone pain | FAERS: 1 | US FAERS | |
| 67 | Cataract | FAERS: 1 | US FAERS | |
| 68 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 69 | Chest discomfort | FAERS: 1 | US FAERS | |
| 70 | Constipation | FAERS: 1 | US FAERS | |
| 71 | Cryotherapy | FAERS: 1 | US FAERS | |
| 72 | Dementia | FAERS: 1 | US FAERS | |
| 73 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 74 | Diplegia | FAERS: 1 | US FAERS | |
| 75 | Double stranded DNA antibody positive | FAERS: 1 | US FAERS | |
| 76 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 77 | Drug dose omission | FAERS: 1 | US FAERS | |
| 78 | Drug level above therapeutic | FAERS: 1 | US FAERS | |
| 79 | Dyspepsia | FAERS: 1 | US FAERS | |
| 80 | Enterocolitis | FAERS: 1 | US FAERS | |
| 81 | Flat affect | FAERS: 1 | US FAERS | |
| 82 | Flatulence | FAERS: 1 | US FAERS | |
| 83 | Gait inability | FAERS: 1 | US FAERS | |
| 84 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 85 | Heat illness | FAERS: 1 | US FAERS | |
| 86 | Hemiplegia | FAERS: 1 | US FAERS | |
| 87 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 88 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 89 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 90 | Joint warmth | FAERS: 1 | US FAERS | |
| 91 | Laceration | FAERS: 1 | US FAERS | |
| 92 | Lymphoma | FAERS: 1 | US FAERS | |
| 93 | Medication Error | FAERS: 1 | US FAERS | |
| 94 | Meningioma | FAERS: 1 | US FAERS | |
| 95 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 96 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 97 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 98 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 99 | Overdose | FAERS: 1 | US FAERS | |
| 100 | Pain of skin | FAERS: 1 | US FAERS | |
| 101 | Pancytopenia | FAERS: 1 | US FAERS | |
| 102 | Papillary serous endometrial carcinoma | FAERS: 1 | US FAERS | |
| 103 | Pemphigus | FAERS: 1 | US FAERS | |
| 104 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 105 | Polyarthritis | FAERS: 1 | US FAERS | |
| 106 | Product container seal issue | FAERS: 1 | US FAERS | |
| 107 | Product dose omission | FAERS: 1 | US FAERS | |
| 108 | Product label issue | FAERS: 1 | US FAERS | |
| 109 | Product residue present | FAERS: 1 | US FAERS | |
| 110 | Product tampering | FAERS: 1 | US FAERS | |
| 111 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 112 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 113 | Recalled product administered | FAERS: 1 | US FAERS | |
| 114 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 115 | Respiratory distress | FAERS: 1 | US FAERS | |
| 116 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 117 | Sinusitis | FAERS: 1 | US FAERS | |
| 118 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 119 | Suicide attempt | FAERS: 1 | US FAERS | |
| 120 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 121 | Throat irritation | FAERS: 1 | US FAERS | |
| 122 | Tremor | FAERS: 1 | US FAERS | |
| 123 | Vein wall hypertrophy | FAERS: 1 | US FAERS | |
| 124 | Visual Impairment | FAERS: 1 | US FAERS | |
| 125 | Vomiting | FAERS: 1 | US FAERS | |
| 126 | Weight decreased | FAERS: 1 | US FAERS | |
| 127 | Wheezing | FAERS: 1 | US FAERS | |
| 128 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 129 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 130 | Wrong technique in product usage process | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.