ropinirole
(XDXHAEQXIBQUEZ-UHFFFAOYSA-N)
Structure
- SMILES
- CCCN(CCC)CCc1cccc2c1CC(=O)N2.Cl
- Molecular Formula:
- C16H25ClN2O
- Molecular Weight:
- 296.836
- Log P:
- 3.7857
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 2
- TPSA:
- 32.34
- CAS Number(s):
- 91374-20-8
Synonym(s)
1.
ropinirole
2.
4-(2-(di-n-propylamino)ethyl)-2(3H)-indolone
3.
Requip
4.
SK&F 101468
5.
SK&F-101,468
6.
SKF 101468
7.
ropinirol
8.
ropinirole hydrochloride
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Nausea | FAERS: 30 | US FAERS | |
| 3 | Malaise | FAERS: 25 | US FAERS | |
| 4 | Drug administration error | FAERS: 13 | US FAERS | |
| 5 | Somnolence | FAERS: 13 | US FAERS | |
| 6 | Tremor | FAERS: 13 | US FAERS | |
| 7 | Dizziness | FAERS: 12 | US FAERS | |
| 8 | Fatigue | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Restless Legs Syndrome | FAERS: 10 | US FAERS | |
| 10 | Gambling | FAERS: 9 | US FAERS | |
| 11 | Syncope | FAERS: 9 | US FAERS | |
| 12 | Headache | FAERS: 8 | US FAERS | |
| 13 | Product substitution issue | FAERS: 8 | US FAERS | |
| 14 | Compulsive shopping | FAERS: 7 | US FAERS | |
| 15 | Medication residue | FAERS: 7 | US FAERS | |
| 16 | Product quality issue | FAERS: 7 | US FAERS | |
| 17 | Abdominal Pain | FAERS: 6 | US FAERS | |
| 18 | Anxiety | FAERS: 6 | US FAERS | |
| 19 | Dementia | FAERS: 6 | US FAERS | |
| 20 | Drug dispensing error | FAERS: 6 | US FAERS | |
| 21 | Overdose | FAERS: 6 | US FAERS | |
| 22 | Transaminases increased | FAERS: 6 | US FAERS | |
| 23 | Palpitations | FAERS: 5 | US FAERS | |
| 24 | Sudden onset of sleep | FAERS: 5 | US FAERS | |
| 25 | Vomiting | FAERS: 5 | US FAERS | |
| 26 | Constipation | FAERS: 4 | US FAERS | |
| 27 | Diplopia | FAERS: 4 | US FAERS | |
| 28 | Drug dose omission | FAERS: 4 | US FAERS | |
| 29 | Gamma-Glutamyltransferase Increased | FAERS: 4 | US FAERS | |
| 30 | Joint swelling | FAERS: 4 | US FAERS | |
| 31 | Obsessive-Compulsive Disorder | FAERS: 4 | US FAERS | |
| 32 | Pain | FAERS: 4 | US FAERS | |
| 33 | Paranoia | FAERS: 4 | US FAERS | |
| 34 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 35 | Atrial Fibrillation | FAERS: 3 | US FAERS | |
| 36 | Back Pain | FAERS: 3 | US FAERS | |
| 37 | Chest Pain | FAERS: 3 | US FAERS | |
| 38 | Drug ineffective for unapproved indication | FAERS: 3 | US FAERS | |
| 39 | Hypoaesthesia facial | FAERS: 3 | US FAERS | |
| 40 | Lethargy | FAERS: 3 | US FAERS | |
| 41 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 42 | Tachycardia | FAERS: 3 | US FAERS | |
| 43 | Unevaluable event | FAERS: 3 | US FAERS | |
| 44 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 45 | Adverse event | FAERS: 2 | US FAERS | |
| 46 | Amnesia | FAERS: 2 | US FAERS | |
| 47 | Anger | FAERS: 2 | US FAERS | |
| 48 | Arthralgia | FAERS: 2 | US FAERS | |
| 49 | Asthenia | FAERS: 2 | US FAERS | |
| 50 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 51 | Bradycardia | FAERS: 2 | US FAERS | |
| 52 | Camptocormia | FAERS: 2 | US FAERS | |
| 53 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 54 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 55 | Chills | FAERS: 2 | US FAERS | |
| 56 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 57 | Disorientation | FAERS: 2 | US FAERS | |
| 58 | Dissociation | FAERS: 2 | US FAERS | |
| 59 | Drug abuse | FAERS: 2 | US FAERS | |
| 60 | Dyspepsia | FAERS: 2 | US FAERS | |
| 61 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 62 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 63 | Immobile | FAERS: 2 | US FAERS | |
| 64 | Impaired work ability | FAERS: 2 | US FAERS | |
| 65 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 66 | Inflammation | FAERS: 2 | US FAERS | |
| 67 | Jealous delusion | FAERS: 2 | US FAERS | |
| 68 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 69 | Medication residue present | FAERS: 2 | US FAERS | |
| 70 | Muscle Rigidity | FAERS: 2 | US FAERS | |
| 71 | Neck Pain | FAERS: 2 | US FAERS | |
| 72 | Nervousness | FAERS: 2 | US FAERS | |
| 73 | Presyncope | FAERS: 2 | US FAERS | |
| 74 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 75 | Pruritus | FAERS: 2 | US FAERS | |
| 76 | Psychiatric symptom | FAERS: 2 | US FAERS | |
| 77 | Pulmonary granuloma | FAERS: 2 | US FAERS | |
| 78 | Restlessness | FAERS: 2 | US FAERS | |
| 79 | Retroperitoneal fibrosis | FAERS: 2 | US FAERS | |
| 80 | Sexual abuse | FAERS: 2 | US FAERS | |
| 81 | Sexual activity increased | FAERS: 2 | US FAERS | |
| 82 | Sopor | FAERS: 2 | US FAERS | |
| 83 | Suicide attempt | FAERS: 2 | US FAERS | |
| 84 | Swelling | FAERS: 2 | US FAERS | |
| 85 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 86 | Urticaria | FAERS: 2 | US FAERS | |
| 87 | Vertigo | FAERS: 2 | US FAERS | |
| 88 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 89 | Abasia | FAERS: 1 | US FAERS | |
| 90 | Abnormal weight gain | FAERS: 1 | US FAERS | |
| 91 | Accidental exposure | FAERS: 1 | US FAERS | |
| 92 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 93 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 94 | Acute psychosis | FAERS: 1 | US FAERS | |
| 95 | Agitation | FAERS: 1 | US FAERS | |
| 96 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 97 | Anuria | FAERS: 1 | US FAERS | |
| 98 | Aphasia | FAERS: 1 | US FAERS | |
| 99 | Aphonia | FAERS: 1 | US FAERS | |
| 100 | Appendicitis | FAERS: 1 | US FAERS | |
| 101 | Arthropathy | FAERS: 1 | US FAERS | |
| 102 | Back disorder | FAERS: 1 | US FAERS | |
| 103 | Bedridden | FAERS: 1 | US FAERS | |
| 104 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 105 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 106 | Blood cortisol increased | FAERS: 1 | US FAERS | |
| 107 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 108 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 109 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 110 | Blood pressure orthostatic decreased | FAERS: 1 | US FAERS | |
| 111 | Blood prolactin decreased | FAERS: 1 | US FAERS | |
| 112 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 113 | Bronchitis | FAERS: 1 | US FAERS | |
| 114 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 115 | Cardiac ablation | FAERS: 1 | US FAERS | |
| 116 | Cardiac ventricular disorder | FAERS: 1 | US FAERS | |
| 117 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 118 | Cataract operation | FAERS: 1 | US FAERS | |
| 119 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 120 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 121 | Chest discomfort | FAERS: 1 | US FAERS | |
| 122 | Choking | FAERS: 1 | US FAERS | |
| 123 | Clonus | FAERS: 1 | US FAERS | |
| 124 | Colitis | FAERS: 1 | US FAERS | |
| 125 | Completed Suicide | FAERS: 1 | US FAERS | |
| 126 | Deja Vu | FAERS: 1 | US FAERS | |
| 127 | Dependence | FAERS: 1 | US FAERS | |
| 128 | Disability | FAERS: 1 | US FAERS | |
| 129 | Disease Progression | FAERS: 1 | US FAERS | |
| 130 | Diverticulitis | FAERS: 1 | US FAERS | |
| 131 | Drug Dependence | FAERS: 1 | US FAERS | |
| 132 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 133 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 134 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 135 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 136 | Dysarthria | FAERS: 1 | US FAERS | |
| 137 | Dysphonia | FAERS: 1 | US FAERS | |
| 138 | Dystonia | FAERS: 1 | US FAERS | |
| 139 | Economic problem | FAERS: 1 | US FAERS | |
| 140 | Enuresis | FAERS: 1 | US FAERS | |
| 141 | Epistaxis | FAERS: 1 | US FAERS | |
| 142 | Erythema | FAERS: 1 | US FAERS | |
| 143 | Euphoric mood | FAERS: 1 | US FAERS | |
| 144 | Facial paralysis | FAERS: 1 | US FAERS | |
| 145 | Feeling Cold | FAERS: 1 | US FAERS | |
| 146 | Feelings of worthlessness | FAERS: 1 | US FAERS | |
| 147 | Formication | FAERS: 1 | US FAERS | |
| 148 | Frustration | FAERS: 1 | US FAERS | |
| 149 | Gastrostomy | FAERS: 1 | US FAERS | |
| 150 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 151 | Heterophoria | FAERS: 1 | US FAERS | |
| 152 | Hyperacusis | FAERS: 1 | US FAERS | |
| 153 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 154 | Hypotension | FAERS: 1 | US FAERS | |
| 155 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 156 | Ileus | FAERS: 1 | US FAERS | |
| 157 | Implant site infection | FAERS: 1 | US FAERS | |
| 158 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 159 | Infectious colitis | FAERS: 1 | US FAERS | |
| 160 | Influenza | FAERS: 1 | US FAERS | |
| 161 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 162 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 163 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 164 | Intestinal resection | FAERS: 1 | US FAERS | |
| 165 | Laryngitis | FAERS: 1 | US FAERS | |
| 166 | Limb discomfort | FAERS: 1 | US FAERS | |
| 167 | Limb injury | FAERS: 1 | US FAERS | |
| 168 | Lip swelling | FAERS: 1 | US FAERS | |
| 169 | Live Birth | FAERS: 1 | US FAERS | |
| 170 | Long QT Syndrome | FAERS: 1 | US FAERS | |
| 171 | Lymphoma | FAERS: 1 | US FAERS | |
| 172 | Medication Error | FAERS: 1 | US FAERS | |
| 173 | Memory impairment | FAERS: 1 | US FAERS | |
| 174 | Mental impairment | FAERS: 1 | US FAERS | |
| 175 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 176 | Middle insomnia | FAERS: 1 | US FAERS | |
| 177 | Mood swings | FAERS: 1 | US FAERS | |
| 178 | Muscle tightness | FAERS: 1 | US FAERS | |
| 179 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 180 | Myalgia | FAERS: 1 | US FAERS | |
| 181 | Mydriasis | FAERS: 1 | US FAERS | |
| 182 | Nephrectomy | FAERS: 1 | US FAERS | |
| 183 | Neutropenic sepsis | FAERS: 1 | US FAERS | |
| 184 | Night sweats | FAERS: 1 | US FAERS | |
| 185 | No adverse event | FAERS: 1 | US FAERS | |
| 186 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 187 | Ocular Hypertension | FAERS: 1 | US FAERS | |
| 188 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 189 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 190 | Panic Disorder | FAERS: 1 | US FAERS | |
| 191 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 192 | Personality Change | FAERS: 1 | US FAERS | |
| 193 | Pneumonia | FAERS: 1 | US FAERS | |
| 194 | Pneumonitis | FAERS: 1 | US FAERS | |
| 195 | Post procedural infection | FAERS: 1 | US FAERS | |
| 196 | Product availability issue | FAERS: 1 | US FAERS | |
| 197 | Product dose omission | FAERS: 1 | US FAERS | |
| 198 | Pulmonary arterial hypertension | FAERS: 1 | US FAERS | |
| 199 | Rehabilitation therapy | FAERS: 1 | US FAERS | |
| 200 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 201 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 202 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 203 | Respiratory distress | FAERS: 1 | US FAERS | |
| 204 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 205 | Schizoaffective Disorder | FAERS: 1 | US FAERS | |
| 206 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 207 | Shoplifting | FAERS: 1 | US FAERS | |
| 208 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 209 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 210 | Skin hypertrophy | FAERS: 1 | US FAERS | |
| 211 | Sleep Paralysis | FAERS: 1 | US FAERS | |
| 212 | Somnambulism | FAERS: 1 | US FAERS | |
| 213 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 214 | Staring | FAERS: 1 | US FAERS | |
| 215 | Strabismus | FAERS: 1 | US FAERS | |
| 216 | Suicide of relative | FAERS: 1 | US FAERS | |
| 217 | Suture rupture | FAERS: 1 | US FAERS | |
| 218 | Temperature regulation disorder | FAERS: 1 | US FAERS | |
| 219 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 220 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 221 | Therapy cessation | FAERS: 1 | US FAERS | |
| 222 | Torticollis | FAERS: 1 | US FAERS | |
| 223 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 224 | Tuberculosis | FAERS: 1 | US FAERS | |
| 225 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 226 | Visual Impairment | FAERS: 1 | US FAERS | |
| 227 | Weight decreased | FAERS: 1 | US FAERS | |
| 228 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 229 | Yawning | FAERS: 1 | US FAERS | |
| 230 | jaundice | FAERS: 1 | US FAERS | |
| 231 | Inappropriate schedule of product administration | Canada Vigilance: 1 | Canada Vigilance | |
| 232 | Mental status changes | Canada Vigilance: 1 | Canada Vigilance | |
| 233 | Product complaint | Canada Vigilance: 1 | Canada Vigilance | |
| 234 | Urinary tract infection | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.