Edarbyclor
(WUAIEYMUYGBWLV-UHFFFAOYSA-M)
Structure
- SMILES
- O=C1NC(c2c1cccc2)(O)c1ccc(c(c1)S(=O)(=O)N)Cl.CCOc1nc2c(n1Cc1ccc(cc1)c1ccccc1c1noc(=O)[n-]1)c(ccc2)C(=O)OCc1oc(=O)oc1C.[K+]
- Molecular Formula:
- C44H34ClKN6O12S
- Molecular Weight:
- 945.390
- Log P:
- 7.3684
- Hydrogen Bond Acceptor:
- 17
- Hydrogen Bond Donor:
- 3
- TPSA:
- 270.56
- CAS Number(s):
- N/A
Synonym(s)
1.
Edarbyclor
External Link(s)
| PubChem Compound | 25210270 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Dizziness | FAERS: 58 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 2 | Blood sodium decreased | FAERS: 27 | US FAERS | |
| 3 | Fatigue | FAERS: 20 | US FAERS | |
| 4 | Hypotension | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Drug ineffective | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Nausea | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 7 | Product quality issue | FAERS: 14 | US FAERS | |
| 8 | Blood creatinine increased | FAERS: 12 | US FAERS | |
| 9 | Asthenia | FAERS: 11 | US FAERS | |
| 10 | Feeling abnormal | FAERS: 11 | US FAERS | |
| 11 | Hypersensitivity | FAERS: 11 | US FAERS | |
| 12 | Malaise | FAERS: 10 | US FAERS | |
| 13 | Chest Pain | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Poor quality drug administered | FAERS: 9 | US FAERS | |
| 15 | Dehydration | FAERS: 8 | US FAERS | |
| 16 | Headache | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 17 | Syncope | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Chest discomfort | FAERS: 6 | US FAERS | |
| 19 | Myalgia | FAERS: 6 | US FAERS | |
| 20 | Pain | FAERS: 6 | US FAERS | |
| 21 | Abdominal Pain | FAERS: 5 | US FAERS | |
| 22 | Arthralgia | FAERS: 5 | US FAERS | |
| 23 | Blood potassium decreased | FAERS: 5 | US FAERS | |
| 24 | Erectile dysfunction | FAERS: 5 | US FAERS | |
| 25 | Vomiting | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Weight decreased | FAERS: 5 | US FAERS | |
| 27 | Wrong technique in product usage process | FAERS: 5 | US FAERS | |
| 28 | Acute kidney injury | FAERS: 4 | US FAERS | |
| 29 | Adverse event | FAERS: 4 | US FAERS | |
| 30 | Dysphonia | FAERS: 4 | US FAERS | |
| 31 | Flushing | FAERS: 4 | US FAERS | |
| 32 | Peripheral swelling | FAERS: 4 | US FAERS | |
| 33 | Product contamination | FAERS: 4 | US FAERS | |
| 34 | Product storage error | FAERS: 4 | US FAERS | |
| 35 | Swelling | FAERS: 4 | US FAERS | |
| 36 | Angioedema | FAERS: 3 | US FAERS | |
| 37 | Aphasia | FAERS: 3 | US FAERS | |
| 38 | Blood potassium increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Blood pressure fluctuation | FAERS: 3 | US FAERS | |
| 40 | Dysuria | FAERS: 3 | US FAERS | |
| 41 | Gout | FAERS: 3 | US FAERS | |
| 42 | Head discomfort | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 43 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 44 | Incorrect product storage | FAERS: 3 | US FAERS | |
| 45 | Lethargy | FAERS: 3 | US FAERS | |
| 46 | Oliguria | FAERS: 3 | US FAERS | |
| 47 | Sluggishness | FAERS: 3 | US FAERS | |
| 48 | Somnolence | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Urticaria | FAERS: 3 | US FAERS | |
| 50 | Arthropathy | FAERS: 2 | US FAERS | |
| 51 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 52 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 53 | Blood urea increased | FAERS: 2 | US FAERS | |
| 54 | Blue Toe Syndrome | FAERS: 2 | US FAERS | |
| 55 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 56 | Emotional distress | FAERS: 2 | US FAERS | |
| 57 | Erythema | FAERS: 2 | US FAERS | |
| 58 | Incontinence | FAERS: 2 | US FAERS | |
| 59 | Joint swelling | FAERS: 2 | US FAERS | |
| 60 | Lip swelling | FAERS: 2 | US FAERS | |
| 61 | Palpitations | FAERS: 2 | US FAERS | |
| 62 | Product closure removal difficult | FAERS: 2 | US FAERS | |
| 63 | Product container issue | FAERS: 2 | US FAERS | |
| 64 | Product dispensing error | FAERS: 2 | US FAERS | |
| 65 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 66 | Tachycardia | FAERS: 2 | US FAERS | |
| 67 | Thirst | FAERS: 2 | US FAERS | |
| 68 | Throat irritation | FAERS: 2 | US FAERS | |
| 69 | Tinnitus | FAERS: 2 | US FAERS | |
| 70 | Unevaluable event | FAERS: 2 | US FAERS | |
| 71 | Vertigo | FAERS: 2 | US FAERS | |
| 72 | Abdominal discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 73 | Apparent death | FAERS: 1 | US FAERS | |
| 74 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 75 | Bedridden | FAERS: 1 | US FAERS | |
| 76 | Blood chloride decreased | FAERS: 1 | US FAERS | |
| 77 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 78 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 79 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 80 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 81 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 82 | Blood urea abnormal | FAERS: 1 | US FAERS | |
| 83 | Burning sensation | FAERS: 1 | US FAERS | |
| 84 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 85 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 86 | Constipation | FAERS: 1 | US FAERS | |
| 87 | Crying | FAERS: 1 | US FAERS | |
| 88 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 89 | Depressed mood | FAERS: 1 | US FAERS | |
| 90 | Diplopia | FAERS: 1 | US FAERS | |
| 91 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 92 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 93 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 94 | Erection increased | FAERS: 1 | US FAERS | |
| 95 | Hypertensive crisis | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 96 | Impaired work ability | FAERS: 1 | US FAERS | |
| 97 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 98 | Medication residue present | FAERS: 1 | US FAERS | |
| 99 | Memory impairment | FAERS: 1 | US FAERS | |
| 100 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 101 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 102 | Night sweats | FAERS: 1 | US FAERS | |
| 103 | No adverse event | FAERS: 1 | US FAERS | |
| 104 | Pancreatitis | FAERS: 1 | US FAERS | |
| 105 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 106 | Pneumonia | FAERS: 1 | US FAERS | |
| 107 | Polyuria | FAERS: 1 | US FAERS | |
| 108 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 109 | Product commingling | FAERS: 1 | US FAERS | |
| 110 | Product dose omission | FAERS: 1 | US FAERS | |
| 111 | Product intolerance | FAERS: 1 | US FAERS | |
| 112 | Product packaging issue | FAERS: 1 | US FAERS | |
| 113 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 114 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 115 | Protein total increased | FAERS: 1 | US FAERS | |
| 116 | Pruritus | FAERS: 1 | US FAERS | |
| 117 | Rash erythematous | FAERS: 1 | US FAERS | |
| 118 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 119 | Secondary hypertension | FAERS: 1 | US FAERS | |
| 120 | Stasis dermatitis | FAERS: 1 | US FAERS | |
| 121 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 122 | Tremor | FAERS: 1 | US FAERS | |
| 123 | Ulcer | FAERS: 1 | US FAERS | |
| 124 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 125 | Urinary Retention | FAERS: 1 | US FAERS | |
| 126 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 127 | Wheelchair user | FAERS: 1 | US FAERS | |
| 128 | Coronary Artery Disease | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.