Labetalol
(WQVZLXWQESQGIF-UHFFFAOYSA-N)
Structure
- SMILES
- CC(CCc1ccccc1)NCC(c1ccc(c(c1)C(=O)N)O)O.Cl
- Molecular Formula:
- C19H25ClN2O3
- Molecular Weight:
- 364.866
- Log P:
- 4.0286
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 5
- TPSA:
- 95.58
- CAS Number(s):
- 32780-64-6; 72487-34-4
Synonym(s)
1.
Labetalol
2.
AH-5158
3.
Albetol
4.
Apo-Labetalol
5.
Dilevalol
6.
Labetalol Hydrochloride
7.
Labetalol, (R,R)-Isomer
8.
Labetolol
9.
Normodyne
10.
Presolol
11.
R,R-Labetalol
12.
SCH-19927
13.
Trandate
14.
AH 5158
15.
AH5158
16.
Apo Labetalol
17.
ApoLabetalol
18.
Hydrochloride, Labetalol
19.
R,R Labetalol
20.
SCH 19927
21.
SCH19927
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 13 | US FAERS | |
| 2 | Hypotension | FAERS: 8 | US FAERS | |
| 3 | Bradycardia | FAERS: 7 | US FAERS | |
| 4 | Medication Error | FAERS: 6 | US FAERS | |
| 5 | Asthenia | FAERS: 5 | US FAERS | |
| 6 | Nausea | FAERS: 5 | US FAERS | |
| 7 | Abdominal Pain | FAERS: 4 | US FAERS | |
| 8 | Bronchospasm | FAERS: 4 | US FAERS | |
| 9 | Malaise | FAERS: 4 | US FAERS | |
| 10 | Maternal exposure during pregnancy | FAERS: 4 | US FAERS | |
| 11 | Product substitution issue | FAERS: 4 | US FAERS | |
| 12 | Vomiting | FAERS: 4 | US FAERS | |
| 13 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 14 | Dizziness | FAERS: 3 | US FAERS | |
| 15 | Drug exposure during pregnancy | FAERS: 3 | US FAERS | |
| 16 | Feeling abnormal | FAERS: 3 | US FAERS | |
| 17 | Weight decreased | FAERS: 3 | US FAERS | |
| 18 | Abasia | FAERS: 2 | US FAERS | |
| 19 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 20 | Chest Pain | FAERS: 2 | US FAERS | |
| 21 | Chills | FAERS: 2 | US FAERS | |
| 22 | Headache | FAERS: 2 | US FAERS | |
| 23 | Hypoxia | FAERS: 2 | US FAERS | |
| 24 | Overdose | FAERS: 2 | US FAERS | |
| 25 | Pain | FAERS: 2 | US FAERS | |
| 26 | Palpitations | FAERS: 2 | US FAERS | |
| 27 | Pleuritic pain | FAERS: 2 | US FAERS | |
| 28 | Poisoning | FAERS: 2 | US FAERS | |
| 29 | Product quality issue | FAERS: 2 | US FAERS | |
| 30 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 31 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 32 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 33 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 34 | Anaphylactoid syndrome of pregnancy | FAERS: 1 | US FAERS | |
| 35 | Anger | FAERS: 1 | US FAERS | |
| 36 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 37 | Angioedema | FAERS: 1 | US FAERS | |
| 38 | Aphasia | FAERS: 1 | US FAERS | |
| 39 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 40 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 41 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 42 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 43 | Blood ethanol increased | FAERS: 1 | US FAERS | |
| 44 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 45 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 46 | Brain Death | FAERS: 1 | US FAERS | |
| 47 | Bronchitis | FAERS: 1 | US FAERS | |
| 48 | Burning sensation | FAERS: 1 | US FAERS | |
| 49 | Cataract | FAERS: 1 | US FAERS | |
| 50 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 51 | Cyanosis | FAERS: 1 | US FAERS | |
| 52 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 53 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 54 | Drug toxicity | FAERS: 1 | US FAERS | |
| 55 | Ecchymosis | FAERS: 1 | US FAERS | |
| 56 | Electromechanical dissociation | FAERS: 1 | US FAERS | |
| 57 | Extravasation | FAERS: 1 | US FAERS | |
| 58 | Fluid overload | FAERS: 1 | US FAERS | |
| 59 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 60 | Hepatitis | FAERS: 1 | US FAERS | |
| 61 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 62 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 63 | Hypophagia | FAERS: 1 | US FAERS | |
| 64 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 65 | Infection | FAERS: 1 | US FAERS | |
| 66 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 67 | Lethargy | FAERS: 1 | US FAERS | |
| 68 | Live Birth | FAERS: 1 | US FAERS | |
| 69 | Memory impairment | FAERS: 1 | US FAERS | |
| 70 | Mood swings | FAERS: 1 | US FAERS | |
| 71 | Muscle necrosis | FAERS: 1 | US FAERS | |
| 72 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 73 | Neck Pain | FAERS: 1 | US FAERS | |
| 74 | Nipple pain | FAERS: 1 | US FAERS | |
| 75 | No adverse event | FAERS: 1 | US FAERS | |
| 76 | Pallor | FAERS: 1 | US FAERS | |
| 77 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 78 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 79 | Post procedural complication | FAERS: 1 | US FAERS | |
| 80 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 81 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 82 | Product physical issue | FAERS: 1 | US FAERS | |
| 83 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 84 | Pruritus | FAERS: 1 | US FAERS | |
| 85 | Rash erythematous | FAERS: 1 | US FAERS | |
| 86 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 87 | Respiratory distress | FAERS: 1 | US FAERS | |
| 88 | Restlessness | FAERS: 1 | US FAERS | |
| 89 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 90 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 91 | Sinusitis | FAERS: 1 | US FAERS | |
| 92 | Somnolence | FAERS: 1 | US FAERS | |
| 93 | Swelling | FAERS: 1 | US FAERS | |
| 94 | Urinary Retention | FAERS: 1 | US FAERS | |
| 95 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 96 | Visceral congestion | FAERS: 1 | US FAERS | |
| 97 | Yawning | FAERS: 1 | US FAERS | |
| 98 | treatment failure | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.