acalabrutinib
(WDENQIQQYWYTPO-IBGZPJMESA-N)
Structure
- SMILES
- CC#CC(=O)N1CCC[C@H]1c1nc(c2n1ccnc2N)c1ccc(cc1)C(=O)Nc1ccccn1
- Type(s)
- Approved; Investigational
- Molecular Formula:
- C26H23N7O2
- Molecular Weight:
- 465.507
- Log P:
- 3.9047
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 2
- TPSA:
- 118.51
- CAS Number(s):
- 1420477-60-6
Synonym(s)
1.
acalabrutinib
2.
ACP-196
External Link(s)
| MeSH | C000604908 |
| PubChem Compound | 71226662 |
| BindingDB | 50175583 |
| CHEMBL | CHEMBL3707348 |
| DrugBank | DB11703 |
| DrugCentral | 5260 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 8912 |
| KEGG | dr:D10893 |
| ZINC | 208774715 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Product use in unapproved indication | FAERS: 10 | US FAERS | |
| 2 | Headache | FAERS: 9 | US FAERS | |
| 3 | Fatigue | FAERS: 8 | US FAERS | |
| 4 | Malignant neoplasm progression | FAERS: 8 | US FAERS | |
| 5 | Drug resistance | FAERS: 7 | US FAERS | |
| 6 | Drug ineffective | FAERS: 5 | US FAERS | |
| 7 | Asthenia | FAERS: 4 | US FAERS | |
| 8 | Disease Progression | FAERS: 4 | US FAERS | |
| 9 | Leukocytosis | FAERS: 4 | US FAERS | |
| 10 | Myalgia | FAERS: 4 | US FAERS | |
| 11 | Pain | FAERS: 4 | US FAERS | |
| 12 | Malaise | FAERS: 3 | US FAERS | |
| 13 | Nausea | FAERS: 3 | US FAERS | |
| 14 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 15 | Acquired gene mutation | FAERS: 2 | US FAERS | |
| 16 | Arthralgia | FAERS: 2 | US FAERS | |
| 17 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 18 | Chest Pain | FAERS: 2 | US FAERS | |
| 19 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 20 | Lymphocytosis | FAERS: 2 | US FAERS | |
| 21 | Retching | FAERS: 2 | US FAERS | |
| 22 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 23 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 24 | Ammonia increased | FAERS: 1 | US FAERS | |
| 25 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 26 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 27 | Back Pain | FAERS: 1 | US FAERS | |
| 28 | Blood urine present | FAERS: 1 | US FAERS | |
| 29 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 30 | Chromaturia | FAERS: 1 | US FAERS | |
| 31 | Colitis | FAERS: 1 | US FAERS | |
| 32 | Drug dose omission | FAERS: 1 | US FAERS | |
| 33 | Dysuria | FAERS: 1 | US FAERS | |
| 34 | Epistaxis | FAERS: 1 | US FAERS | |
| 35 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 36 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 37 | Hair growth rate abnormal | FAERS: 1 | US FAERS | |
| 38 | Impaired work ability | FAERS: 1 | US FAERS | |
| 39 | Incoherent | FAERS: 1 | US FAERS | |
| 40 | Joint swelling | FAERS: 1 | US FAERS | |
| 41 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 42 | Mandibular mass | FAERS: 1 | US FAERS | |
| 43 | Memory impairment | FAERS: 1 | US FAERS | |
| 44 | Muscle tightness | FAERS: 1 | US FAERS | |
| 45 | Palpitations | FAERS: 1 | US FAERS | |
| 46 | Pancytopenia | FAERS: 1 | US FAERS | |
| 47 | Pneumonia | FAERS: 1 | US FAERS | |
| 48 | Richter's syndrome | FAERS: 1 | US FAERS | |
| 49 | Sinus headache | FAERS: 1 | US FAERS | |
| 50 | Skin lesion | FAERS: 1 | US FAERS | |
| 51 | Sneezing | FAERS: 1 | US FAERS | |
| 52 | Somnolence | FAERS: 1 | US FAERS | |
| 53 | Tachycardia | FAERS: 1 | US FAERS | |
| 54 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 55 | Visual Impairment | FAERS: 1 | US FAERS | |
| 56 | Vomiting | FAERS: 1 | US FAERS | |
| 57 | Weight decreased | FAERS: 1 | US FAERS | |
| 58 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120241
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.