hydrocortisone hemisuccinate
(VWQWXZAWFPZJDA-CGVGKPPMSA-N)
Structure
- SMILES
- OC(=O)CCC(=O)OCC(=O)[C@@]1(O)CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2CCC2=CC(=O)CC[C@]12C
- Type(s)
- Approved
- Molecular Formula:
- C25H34O8
- Molecular Weight:
- 462.533
- Log P:
- 2.1973
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 3
- TPSA:
- 138.2
- CAS Number(s):
- 125-04-2; 2203-97-6; 83784-20-7
Synonym(s)
1.
hydrocortisone hemisuccinate
2.
A-hyrocort
3.
Solu-Cortef
4.
Sopolcort H
5.
Sopolkort
6.
cortisol hemisuccinate
7.
cortisol succinate
8.
cortisol succinate, sodium salt
9.
cortisol-21-(hydrogen succinate)
10.
hydrocortisone 21-sodium succinate
11.
hydrocortisone hemisuccinate anhydrous
12.
hydrocortisone succinate
13.
pregn-4-ene-3,20-dione, 21-(3-carboxy-1-oxopropoxy)-11,17-dihydroxy-, (11beta)-
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pruritus | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 2 | Erythema | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Shock | FAERS: 23 | US FAERS | |
| 4 | Anaphylactic shock | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Hypersensitivity | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 6 | Skin irritation | FAERS: 8 | US FAERS | |
| 7 | Wrong technique in drug usage process | FAERS: 8 | US FAERS | |
| 8 | Flushing | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Tremor | FAERS: 7 | US FAERS | |
| 10 | Product quality issue | FAERS: 6 | US FAERS | |
| 11 | Urticaria | FAERS: 6 | US FAERS | |
| 12 | Asthma | FAERS: 5 | US FAERS | |
| 13 | Drug ineffective | FAERS: 5 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 14 | Nausea | FAERS: 5 | US FAERS | |
| 15 | Urinary Retention | FAERS: 5 | US FAERS | |
| 16 | Wheezing | FAERS: 5 | US FAERS | |
| 17 | Apparent death | FAERS: 4 | US FAERS | |
| 18 | Blood glucose increased | FAERS: 4 | US FAERS | |
| 19 | Chest discomfort | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Infusion site erythema | FAERS: 4 | US FAERS | |
| 21 | Injection site pain | FAERS: 4 | US FAERS | |
| 22 | Lymphopenia | FAERS: 4 | US FAERS | |
| 23 | Malaise | FAERS: 4 | US FAERS | |
| 24 | Pain | FAERS: 4 | US FAERS | |
| 25 | Respiratory arrest | FAERS: 4 | US FAERS | |
| 26 | Somnolence | FAERS: 4 | US FAERS | |
| 27 | Urinary tract infection | FAERS: 4 | US FAERS | |
| 28 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 29 | Bronchospasm | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Dizziness | FAERS: 3 | US FAERS | |
| 31 | Expired product administered | FAERS: 3 | US FAERS | |
| 32 | Fatigue | FAERS: 3 | US FAERS | |
| 33 | Medication Error | FAERS: 3 | US FAERS | |
| 34 | Restlessness | FAERS: 3 | US FAERS | |
| 35 | Skin reaction | FAERS: 3 | US FAERS | |
| 36 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 37 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 38 | Anxiety | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Arthralgia | FAERS: 2 | US FAERS | |
| 40 | Asthenia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Blood magnesium increased | FAERS: 2 | US FAERS | |
| 42 | Dysphonia | FAERS: 2 | US FAERS | |
| 43 | Dystonia | FAERS: 2 | US FAERS | |
| 44 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 45 | Gastritis | FAERS: 2 | US FAERS | |
| 46 | Headache | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Hypokinesia | FAERS: 2 | US FAERS | |
| 48 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 49 | Injection site abscess | FAERS: 2 | US FAERS | |
| 50 | Injection site bruising | FAERS: 2 | US FAERS | |
| 51 | Injection site infection | FAERS: 2 | US FAERS | |
| 52 | Injection site inflammation | FAERS: 2 | US FAERS | |
| 53 | Injection site pustule | FAERS: 2 | US FAERS | |
| 54 | Joint injury | FAERS: 2 | US FAERS | |
| 55 | Lethargy | FAERS: 2 | US FAERS | |
| 56 | Needle issue | FAERS: 2 | US FAERS | |
| 57 | Palpitations | FAERS: 2 | US FAERS | |
| 58 | Pneumocystis jiroveci pneumonia | FAERS: 2 | US FAERS | |
| 59 | Product dose omission | FAERS: 2 | US FAERS | |
| 60 | Renal embolism | FAERS: 2 | US FAERS | |
| 61 | Sepsis | FAERS: 2 | US FAERS | |
| 62 | Swelling | FAERS: 2 | US FAERS | |
| 63 | Tachycardia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Vomiting | FAERS: 2 | US FAERS | |
| 65 | Walking aid user | FAERS: 2 | US FAERS | |
| 66 | Weight decreased | FAERS: 2 | US FAERS | |
| 67 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 68 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 69 | Blood cortisol decreased | FAERS: 1 | US FAERS | |
| 70 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 71 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 72 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 73 | Cellulitis | FAERS: 1 | US FAERS | |
| 74 | Chest Pain | FAERS: 1 | US FAERS | |
| 75 | Cholestasis | FAERS: 1 | US FAERS | |
| 76 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 77 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 78 | Cold sweat | FAERS: 1 | US FAERS | |
| 79 | Cystitis | FAERS: 1 | US FAERS | |
| 80 | Dehydration | FAERS: 1 | US FAERS | |
| 81 | Delirium | FAERS: 1 | US FAERS | |
| 82 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 83 | Device deployment issue | FAERS: 1 | US FAERS | |
| 84 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 85 | Disability | FAERS: 1 | US FAERS | |
| 86 | Drug administration error | FAERS: 1 | US FAERS | |
| 87 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 88 | Drug dose omission | FAERS: 1 | US FAERS | |
| 89 | Extravasation | FAERS: 1 | US FAERS | |
| 90 | Feeling Cold | FAERS: 1 | US FAERS | |
| 91 | Hepatitis B | FAERS: 1 | US FAERS | |
| 92 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 93 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 94 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 95 | Infection | FAERS: 1 | US FAERS | |
| 96 | Influenza | FAERS: 1 | US FAERS | |
| 97 | Infusion Site Extravasation | FAERS: 1 | US FAERS | |
| 98 | Infusion site pain | FAERS: 1 | US FAERS | |
| 99 | Joint swelling | FAERS: 1 | US FAERS | |
| 100 | Ketoacidosis | FAERS: 1 | US FAERS | |
| 101 | Laceration | FAERS: 1 | US FAERS | |
| 102 | Ligament rupture | FAERS: 1 | US FAERS | |
| 103 | Limb injury | FAERS: 1 | US FAERS | |
| 104 | Lung Abscess | FAERS: 1 | US FAERS | |
| 105 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 106 | Myopathy | FAERS: 1 | US FAERS | |
| 107 | Nervousness | FAERS: 1 | US FAERS | |
| 108 | Pancreatitis | FAERS: 1 | US FAERS | |
| 109 | Pancytopenia | FAERS: 1 | US FAERS | |
| 110 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 111 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 112 | Pneumonia | FAERS: 1 | US FAERS | |
| 113 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 114 | Product complaint | FAERS: 1 | US FAERS | |
| 115 | Product container issue | FAERS: 1 | US FAERS | |
| 116 | Product dispensing error | FAERS: 1 | US FAERS | |
| 117 | Product preparation error | FAERS: 1 | US FAERS | |
| 118 | Product storage error | FAERS: 1 | US FAERS | |
| 119 | Product use issue | FAERS: 1 | US FAERS | |
| 120 | Renal abscess | FAERS: 1 | US FAERS | |
| 121 | Splenic abscess | FAERS: 1 | US FAERS | |
| 122 | Syncope | FAERS: 1 | US FAERS | |
| 123 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 124 | Angioedema | 5495061 | CTD | |
| 125 | Cyanosis | Canada Vigilance: 1 | Canada Vigilance | |
| 126 | Hypotension | Canada Vigilance: 2 | Canada Vigilance | |
| 127 | Injection Site Reaction | Canada Vigilance: 3 | Canada Vigilance | |
| 128 | Lymphoma | 4512319 | CTD | |
| 129 | Meniere Disease | 11700197 | CTD | |
| 130 | Oropharyngeal pain | Canada Vigilance: 1 | Canada Vigilance | |
| 131 | Photophobia | Canada Vigilance: 1 | Canada Vigilance | |
| 132 | Product container seal issue | Canada Vigilance: 1 | Canada Vigilance | |
| 133 | Product use in unapproved indication | Canada Vigilance: 1 | Canada Vigilance | |
| 134 | Sluggishness | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.