Morphine sulfate
(USAHOPJHPJHUNS-IFCNUISUSA-N)
Structure
- SMILES
- OS(=O)(=O)O.O[C@H]1C=C[C@@H]2[C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)C)ccc1O.O[C@H]1C=C[C@@H]2[C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)C)ccc1O
- Molecular Formula:
- C34H40N2O10S
- Molecular Weight:
- 668.754
- Log P:
- 2.7000
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 6
- TPSA:
- 188.84
- CAS Number(s):
- 64-31-3
Synonym(s)
1.
Morphine sulfate
2.
Morphine sulphate (2:1)
External Link(s)
| PubChem Compound | 5462349 16051935 |
| ChEBI | 7003 |
| CHEMBL | CHEMBL2096625 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Medication residue present | FAERS: 50 | US FAERS | |
| 2 | Drug ineffective | FAERS: 32 | US FAERS | |
| 3 | Nausea | FAERS: 29 | US FAERS | |
| 4 | Product residue present | FAERS: 26 | US FAERS | |
| 5 | Headache | FAERS: 18 | US FAERS | |
| 6 | Vomiting | FAERS: 14 | US FAERS | |
| 7 | Abdominal discomfort | FAERS: 12 | US FAERS | |
| 8 | Malaise | FAERS: 9 | US FAERS | |
| 9 | Pain | FAERS: 8 | US FAERS | |
| 10 | Dizziness | FAERS: 7 | US FAERS | |
| 11 | Somnolence | FAERS: 6 | US FAERS | |
| 12 | Abdominal Pain | FAERS: 5 | US FAERS | |
| 13 | Feeling abnormal | FAERS: 5 | US FAERS | |
| 14 | Overdose | FAERS: 5 | US FAERS | |
| 15 | Chest Pain | FAERS: 4 | US FAERS | |
| 16 | Constipation | FAERS: 4 | US FAERS | |
| 17 | Drug dose omission | FAERS: 4 | US FAERS | |
| 18 | Pruritus | FAERS: 4 | US FAERS | |
| 19 | Unevaluable event | FAERS: 4 | US FAERS | |
| 20 | Hypersensitivity | FAERS: 3 | US FAERS | |
| 21 | No adverse event | FAERS: 3 | US FAERS | |
| 22 | Respiratory arrest | FAERS: 3 | US FAERS | |
| 23 | Anxiety | FAERS: 2 | US FAERS | |
| 24 | Asthenia | FAERS: 2 | US FAERS | |
| 25 | Back Pain | FAERS: 2 | US FAERS | |
| 26 | Cellulitis | FAERS: 2 | US FAERS | |
| 27 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 28 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 29 | Dysgeusia | FAERS: 2 | US FAERS | |
| 30 | Fatigue | FAERS: 2 | US FAERS | |
| 31 | Flushing | FAERS: 2 | US FAERS | |
| 32 | Intracranial Hypotension | FAERS: 2 | US FAERS | |
| 33 | Product distribution issue | FAERS: 2 | US FAERS | |
| 34 | Tremor | FAERS: 2 | US FAERS | |
| 35 | Urticaria | FAERS: 2 | US FAERS | |
| 36 | Accidental overdose | FAERS: 1 | US FAERS | |
| 37 | Adverse event | FAERS: 1 | US FAERS | |
| 38 | Anuria | FAERS: 1 | US FAERS | |
| 39 | Arachnoiditis | FAERS: 1 | US FAERS | |
| 40 | Arthralgia | FAERS: 1 | US FAERS | |
| 41 | Burning sensation | FAERS: 1 | US FAERS | |
| 42 | Catheter related complication | FAERS: 1 | US FAERS | |
| 43 | Catheter related infection | FAERS: 1 | US FAERS | |
| 44 | Chills | FAERS: 1 | US FAERS | |
| 45 | Cold sweat | FAERS: 1 | US FAERS | |
| 46 | Device Failure | FAERS: 1 | US FAERS | |
| 47 | Device malfunction | FAERS: 1 | US FAERS | |
| 48 | Drug Dependence | FAERS: 1 | US FAERS | |
| 49 | Drug administration error | FAERS: 1 | US FAERS | |
| 50 | Drug effect faster than expected | FAERS: 1 | US FAERS | |
| 51 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 52 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 53 | Erythema | FAERS: 1 | US FAERS | |
| 54 | Euphoric mood | FAERS: 1 | US FAERS | |
| 55 | Flatulence | FAERS: 1 | US FAERS | |
| 56 | Hypotension | FAERS: 1 | US FAERS | |
| 57 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 58 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 59 | Injection site scar | FAERS: 1 | US FAERS | |
| 60 | Intraspinal abscess | FAERS: 1 | US FAERS | |
| 61 | Intravenous catheter management | FAERS: 1 | US FAERS | |
| 62 | Lethargy | FAERS: 1 | US FAERS | |
| 63 | Medical device complication | FAERS: 1 | US FAERS | |
| 64 | Myalgia | FAERS: 1 | US FAERS | |
| 65 | Neurological decompensation | FAERS: 1 | US FAERS | |
| 66 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 67 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 68 | Oral pruritus | FAERS: 1 | US FAERS | |
| 69 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 70 | Product dispensing error | FAERS: 1 | US FAERS | |
| 71 | Product dose omission | FAERS: 1 | US FAERS | |
| 72 | Product tampering | FAERS: 1 | US FAERS | |
| 73 | Product use complaint | FAERS: 1 | US FAERS | |
| 74 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 75 | Secretion discharge | FAERS: 1 | US FAERS | |
| 76 | Sedation complication | FAERS: 1 | US FAERS | |
| 77 | Swelling | FAERS: 1 | US FAERS | |
| 78 | Tinnitus | FAERS: 1 | US FAERS | |
| 79 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 80 | Urinary Retention | FAERS: 1 | US FAERS | |
| 81 | Visual Impairment | FAERS: 1 | US FAERS | |
| 82 | Wrong technique in product usage process | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.