Ceftibuten
(UNJFKXSSGBWRBZ-BJCIPQKHSA-N)
Structure
- SMILES
- OC(=O)C/C=C(\C(=O)N[C@@H]1C(=O)N2[C@@H]1SCC=C2C(=O)O)/c1csc(n1)N
- Type(s)
- Approved; Investigational
- ATC code(s)
- J01DD14
- Molecular Formula:
- C15H14N4O6S2
- Molecular Weight:
- 410.425
- Log P:
- 0.8618
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 4
- TPSA:
- 216.46
- CAS Number(s):
- 97519-39-6
Synonym(s)
1.
Ceftibuten
External Link(s)
| PubChem Compound | 5282242 |
| BindingDB | 50292237 50370586 |
| ChEBI | 3510 |
| CHEMBL | CHEMBL1605 |
| DrugBank | DB01415 |
| DrugCentral | 562 |
| KEGG | cpd:C08117 dr:D00922 |
| ZINC | 3871967 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 42 | US FAERS | |
| 2 | Urticaria | FAERS: 12 | SIDER US FAERS | |
| 3 | Nausea | FAERS: 11 | SIDER US FAERS | |
| 4 | Pruritus | FAERS: 8 | SIDER US FAERS | |
| 5 | Headache | FAERS: 6 | SIDER US FAERS | |
| 6 | Hypersensitivity | FAERS: 6 | SIDER US FAERS | |
| 7 | Incorrect storage of drug | FAERS: 6 | US FAERS | |
| 8 | Vomiting | FAERS: 6 | SIDER US FAERS | |
| 9 | Asthenia | FAERS: 5 | SIDER US FAERS | |
| 10 | Erythema | FAERS: 4 | US FAERS | |
| 11 | Wrong technique in drug usage process | FAERS: 4 | US FAERS | |
| 12 | Arthralgia | FAERS: 3 | US FAERS | |
| 13 | Chest Pain | FAERS: 3 | US FAERS | |
| 14 | Gastroenteritis | FAERS: 3 | US FAERS | |
| 15 | No adverse event | FAERS: 3 | US FAERS | |
| 16 | Pathogen resistance | FAERS: 3 | US FAERS | |
| 17 | Somnolence | FAERS: 3 | SIDER US FAERS | |
| 18 | Abdominal Pain | FAERS: 2 | SIDER US FAERS | |
| 19 | Ageusia | FAERS: 2 | US FAERS | |
| 20 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 21 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 22 | Chills | FAERS: 2 | SIDER US FAERS | |
| 23 | Chromaturia | FAERS: 2 | US FAERS | |
| 24 | Cold sweat | FAERS: 2 | US FAERS | |
| 25 | Dizziness | FAERS: 2 | SIDER US FAERS | |
| 26 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 27 | Dysbacteriosis | FAERS: 2 | US FAERS | |
| 28 | Expired drug administered | FAERS: 2 | US FAERS | |
| 29 | Exposure during breast feeding | FAERS: 2 | US FAERS | |
| 30 | Gastrointestinal Pain | FAERS: 2 | SIDER US FAERS | |
| 31 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 32 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 33 | Neuralgia | FAERS: 2 | US FAERS | |
| 34 | Overdose | FAERS: 2 | US FAERS | |
| 35 | Thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 36 | Vertigo | FAERS: 2 | US FAERS | |
| 37 | Accidental overdose | FAERS: 1 | US FAERS | |
| 38 | Alopecia | FAERS: 1 | US FAERS | |
| 39 | Anosmia | FAERS: 1 | US FAERS | |
| 40 | Asthma | FAERS: 1 | US FAERS | |
| 41 | Asymptomatic bacteriuria | FAERS: 1 | US FAERS | |
| 42 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 43 | Brain Abscess | FAERS: 1 | US FAERS | |
| 44 | Breast Feeding | FAERS: 1 | US FAERS | |
| 45 | Clostridium test positive | FAERS: 1 | US FAERS | |
| 46 | Deafness | FAERS: 1 | US FAERS | |
| 47 | Dehydration | FAERS: 1 | SIDER US FAERS | |
| 48 | Diplegia | FAERS: 1 | US FAERS | |
| 49 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 50 | Drug administration error | FAERS: 1 | US FAERS | |
| 51 | Drug dose omission | FAERS: 1 | US FAERS | |
| 52 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 53 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 54 | Dyspepsia | FAERS: 1 | SIDER US FAERS | |
| 55 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 56 | Encephalitis | FAERS: 1 | US FAERS | |
| 57 | Epilepsy | FAERS: 1 | US FAERS | |
| 58 | Erythema Multiforme | FAERS: 1 | SIDER US FAERS | |
| 59 | Eye pain | FAERS: 1 | US FAERS | |
| 60 | Facial Paresis | FAERS: 1 | US FAERS | |
| 61 | Fatigue | FAERS: 1 | SIDER US FAERS | |
| 62 | Flatulence | FAERS: 1 | SIDER US FAERS | |
| 63 | Foreign travel | FAERS: 1 | US FAERS | |
| 64 | Hepatitis | FAERS: 1 | US FAERS | |
| 65 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 66 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 67 | Hypotension | FAERS: 1 | US FAERS | |
| 68 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 69 | Infection | FAERS: 1 | US FAERS | |
| 70 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 71 | Lumbar puncture abnormal | FAERS: 1 | US FAERS | |
| 72 | Mastoiditis | FAERS: 1 | US FAERS | |
| 73 | Mouth swelling | FAERS: 1 | US FAERS | |
| 74 | Neck Pain | FAERS: 1 | US FAERS | |
| 75 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 76 | Pain | FAERS: 1 | US FAERS | |
| 77 | Periodontitis | FAERS: 1 | US FAERS | |
| 78 | Pneumonia | FAERS: 1 | US FAERS | |
| 79 | Poisoning | FAERS: 1 | US FAERS | |
| 80 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 81 | Pregnancy | FAERS: 1 | US FAERS | |
| 82 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 83 | Product use issue | FAERS: 1 | US FAERS | |
| 84 | Pseudomonas test positive | FAERS: 1 | US FAERS | |
| 85 | Rash erythematous | FAERS: 1 | US FAERS | |
| 86 | Secretion discharge | FAERS: 1 | US FAERS | |
| 87 | Sinusitis | FAERS: 1 | US FAERS | |
| 88 | Skin test positive | FAERS: 1 | US FAERS | |
| 89 | Stevens-Johnson Syndrome | FAERS: 1 | SIDER US FAERS | |
| 90 | Swelling | FAERS: 1 | US FAERS | |
| 91 | Tachycardia | FAERS: 1 | US FAERS | |
| 92 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 93 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 94 | Toxic Epidermal Necrolysis | FAERS: 1 | SIDER US FAERS | |
| 95 | Tremor | FAERS: 1 | US FAERS | |
| 96 | Unevaluable event | FAERS: 1 | US FAERS | |
| 97 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 98 | Weight decreased | FAERS: 1 | US FAERS | |
| 99 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 100 | pseudomembranous colitis | FAERS: 1 | SIDER US FAERS | |
| 101 | Agitation | SIDER | ||
| 102 | Agranulocytosis | SIDER | ||
| 103 | Anaphylactic shock | SIDER | ||
| 104 | Anorexia | SIDER | ||
| 105 | Aphasia | SIDER | ||
| 106 | Cholestasis | SIDER | ||
| 107 | Constipation | SIDER | ||
| 108 | Dermatitis | SIDER | ||
| 109 | Disability | SIDER | ||
| 110 | Dysgeusia | SIDER | ||
| 111 | Dysuria | SIDER | ||
| 112 | Eructation | SIDER | ||
| 113 | Hyperkinesia | SIDER | ||
| 114 | Neutropenia | SIDER | ||
| 115 | Pancytopenia | SIDER | ||
| 116 | Pyelonephritis | 18074149 | CTD | |
| 117 | Serum Sickness | SIDER | ||
| 118 | Stridor | SIDER | ||
| 119 | jaundice | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.