Afatinib
(ULXXDDBFHOBEHA-CWDCEQMOSA-N)
Structure
- SMILES
- CN(C/C=C/C(=O)Nc1cc2c(ncnc2cc1O[C@@H]1COCC1)Nc1ccc(c(c1)Cl)F)C
- Type(s)
- Approved
- ATC code(s)
- L01XE13
- Molecular Formula:
- C24H25ClFN5O3
- Molecular Weight:
- 485.938
- Log P:
- 4.5359
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 2
- TPSA:
- 88.61
- CAS Number(s):
- 439081-18-2; 850140-72-6
Synonym(s)
1.
Afatinib
2.
(2E)-N-(4-(3-Chloro-4-fluoroanilino)-7-(((3S)-oxolan-3-yl)oxy)quinoxazolin-6-yl)-4-(dimethylamino)but-2-enamide
3.
Afatinib Dimaleate
4.
Afatinib Maleate
5.
BIBW 2992
6.
BIBW-2992
7.
BIBW-2992-MA2
8.
BIBW-2992MA2
9.
BIBW2992
10.
BIBW2992 MA2
11.
Gilotrif
12.
BIBW 2992 MA2
13.
BIBW 2992MA2
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Malignant neoplasm progression | FAERS: 65 | US FAERS | |
| 2 | Vomiting | FAERS: 21 | SIDER US FAERS | |
| 3 | Nausea | FAERS: 16 | SIDER US FAERS | |
| 4 | Asthenia | FAERS: 14 | SIDER US FAERS | |
| 5 | Stomatitis | FAERS: 14 | SIDER US FAERS | |
| 6 | Dehydration | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 7 | Weight decreased | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 8 | Pneumonia | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 9 | Respiratory Failure | FAERS: 8 | US FAERS | |
| 10 | General physical health deterioration | FAERS: 7 | US FAERS | |
| 11 | Dizziness | FAERS: 6 | SIDER US FAERS | |
| 12 | Headache | FAERS: 6 | SIDER US FAERS | |
| 13 | Pruritus | FAERS: 6 | SIDER US FAERS | |
| 14 | Abdominal Pain | FAERS: 5 | US FAERS | |
| 15 | Acne | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Empyema | FAERS: 5 | US FAERS | |
| 17 | Blood creatinine increased | FAERS: 4 | US FAERS | |
| 18 | Disease Progression | FAERS: 4 | SIDER US FAERS | |
| 19 | Dyspepsia | FAERS: 4 | SIDER US FAERS | |
| 20 | Fatigue | FAERS: 4 | SIDER US FAERS | |
| 21 | Lower respiratory tract infection | FAERS: 4 | US FAERS | |
| 22 | Pneumonitis | FAERS: 4 | US FAERS | |
| 23 | Sepsis | FAERS: 4 | SIDER US FAERS | |
| 24 | Aphasia | FAERS: 3 | US FAERS | |
| 25 | Asthma | FAERS: 3 | US FAERS | |
| 26 | Atelectasis | FAERS: 3 | US FAERS | |
| 27 | Cellulitis | FAERS: 3 | US FAERS | |
| 28 | Cerebral Infarction | FAERS: 3 | US FAERS | |
| 29 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 30 | Deep Vein Thrombosis | FAERS: 3 | US FAERS | |
| 31 | Epistaxis | FAERS: 3 | SIDER US FAERS | |
| 32 | Gastroenteritis | FAERS: 3 | US FAERS | |
| 33 | Intestinal Obstruction | FAERS: 3 | US FAERS | |
| 34 | Malnutrition | FAERS: 3 | SIDER US FAERS | |
| 35 | Oliguria | FAERS: 3 | US FAERS | |
| 36 | Septic Shock | FAERS: 3 | US FAERS | |
| 37 | Syncope | FAERS: 3 | US FAERS | |
| 38 | Urinary tract infection | FAERS: 3 | SIDER US FAERS | |
| 39 | Wheezing | FAERS: 3 | US FAERS | |
| 40 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 41 | Alopecia | FAERS: 2 | SIDER US FAERS | |
| 42 | Cheilitis | FAERS: 2 | SIDER US FAERS | |
| 43 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 44 | Constipation | FAERS: 2 | SIDER US FAERS | |
| 45 | Delirium | FAERS: 2 | US FAERS | |
| 46 | Dermatitis acneiform | FAERS: 2 | SIDER US FAERS | |
| 47 | Device related infection | FAERS: 2 | US FAERS | |
| 48 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 49 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 50 | Gastritis | FAERS: 2 | US FAERS | |
| 51 | Ileus | FAERS: 2 | US FAERS | |
| 52 | Infection | FAERS: 2 | SIDER US FAERS | |
| 53 | Memory impairment | FAERS: 2 | US FAERS | |
| 54 | Nasal inflammation | FAERS: 2 | SIDER US FAERS | |
| 55 | Non-cardiac chest pain | FAERS: 2 | US FAERS | |
| 56 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 57 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 58 | Adenoid cystic carcinoma of salivary gland | FAERS: 1 | US FAERS | |
| 59 | Alanine Aminotransferase Increased | FAERS: 1 | SIDER US FAERS | |
| 60 | Anuria | FAERS: 1 | US FAERS | |
| 61 | Arthralgia | FAERS: 1 | US FAERS | |
| 62 | Aspartate Aminotransferase Increased | FAERS: 1 | SIDER US FAERS | |
| 63 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 64 | Back Pain | FAERS: 1 | SIDER US FAERS | |
| 65 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 66 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 67 | Blood alkaline phosphatase abnormal | FAERS: 1 | US FAERS | |
| 68 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 69 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 70 | Bone pain | FAERS: 1 | US FAERS | |
| 71 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 72 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 73 | Catheter site infection | FAERS: 1 | US FAERS | |
| 74 | Catheter site related reaction | FAERS: 1 | US FAERS | |
| 75 | Cerebral ventricle dilatation | FAERS: 1 | US FAERS | |
| 76 | Chest discomfort | FAERS: 1 | US FAERS | |
| 77 | Chromaturia | FAERS: 1 | US FAERS | |
| 78 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 79 | Chylothorax | FAERS: 1 | US FAERS | |
| 80 | Colitis | FAERS: 1 | US FAERS | |
| 81 | Completed Suicide | FAERS: 1 | US FAERS | |
| 82 | Conjunctivitis | FAERS: 1 | SIDER US FAERS | |
| 83 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 84 | Culture positive | FAERS: 1 | US FAERS | |
| 85 | Disorientation | FAERS: 1 | US FAERS | |
| 86 | Drug ineffective | FAERS: 1 | US FAERS | |
| 87 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 88 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 89 | Eye pain | FAERS: 1 | US FAERS | |
| 90 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 91 | Flank Pain | FAERS: 1 | US FAERS | |
| 92 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 93 | Gene Mutation | FAERS: 1 | US FAERS | |
| 94 | Hydrothorax | FAERS: 1 | US FAERS | |
| 95 | Hypophagia | FAERS: 1 | US FAERS | |
| 96 | Hypoxia | FAERS: 1 | US FAERS | |
| 97 | Influenza | FAERS: 1 | US FAERS | |
| 98 | Klebsiella sepsis | FAERS: 1 | US FAERS | |
| 99 | Malaise | FAERS: 1 | US FAERS | |
| 100 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 101 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 102 | Myalgia | FAERS: 1 | US FAERS | |
| 103 | Neutropenia | FAERS: 1 | US FAERS | |
| 104 | Nocturia | FAERS: 1 | US FAERS | |
| 105 | Pain | FAERS: 1 | US FAERS | |
| 106 | Pancreatitis | FAERS: 1 | US FAERS | |
| 107 | Paraneoplastic Encephalomyelitis | FAERS: 1 | US FAERS | |
| 108 | Pathological fracture | FAERS: 1 | US FAERS | |
| 109 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 110 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 111 | Pneumothorax | FAERS: 1 | US FAERS | |
| 112 | Productive Cough | FAERS: 1 | US FAERS | |
| 113 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 114 | Pyogenic granuloma | FAERS: 1 | US FAERS | |
| 115 | Scleroderma | FAERS: 1 | US FAERS | |
| 116 | Sensory level abnormal | FAERS: 1 | US FAERS | |
| 117 | Shock | FAERS: 1 | US FAERS | |
| 118 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 119 | Skin reaction | FAERS: 1 | US FAERS | |
| 120 | Skin toxicity | FAERS: 1 | US FAERS | |
| 121 | Somnolence | FAERS: 1 | US FAERS | |
| 122 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 123 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 124 | Tracheobronchitis | FAERS: 1 | US FAERS | |
| 125 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 126 | Urticaria | FAERS: 1 | US FAERS | |
| 127 | Vasculitis | FAERS: 1 | US FAERS | |
| 128 | Vertigo | FAERS: 1 | US FAERS | |
| 129 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 130 | Wound Infection | FAERS: 1 | US FAERS | |
| 131 | Xerosis | FAERS: 1 | US FAERS | |
| 132 | Aphthous Stomatitis | SIDER | ||
| 133 | Bladder pain | SIDER | ||
| 134 | Blood potassium decreased | SIDER | ||
| 135 | Conjunctival irritation | SIDER | ||
| 136 | Cystitis | SIDER | ||
| 137 | Dermatitis | SIDER | ||
| 138 | Diastolic dysfunction | SIDER | ||
| 139 | Dry skin | SIDER | ||
| 140 | Dysgeusia | SIDER | ||
| 141 | Infestation | SIDER | ||
| 142 | Keratitis | SIDER | ||
| 143 | Lung Neoplasms | 21322567 21732753 | CTD | |
| 144 | Mucosal erosion | SIDER | ||
| 145 | Nail Infection | SIDER | ||
| 146 | Nail bed infection | SIDER | ||
| 147 | Nasopharyngitis | SIDER | ||
| 148 | Oropharyngeal pain | Canada Vigilance: 1 | Canada Vigilance | |
| 149 | Pulmonary toxicity | SIDER | ||
| 150 | Rash erythematous | Canada Vigilance: 1 | Canada Vigilance | |
| 151 | Ventricular Dysfunction | SIDER | ||
| 152 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.