Levofloxacin Hemihydrate
(SUIQUYDRLGGZOL-RCWTXCDDSA-N)
Structure
- SMILES
- CN1CCN(CC1)c1c(F)cc2c3c1OC[C@@H](n3cc(c2=O)C(=O)O)C.CN1CCN(CC1)c1c(F)cc2c3c1OC[C@@H](n3cc(c2=O)C(=O)O)C.O
- Molecular Formula:
- C36H42F2N6O9
- Molecular Weight:
- 740.750
- Log P:
- 3.0295
- Hydrogen Bond Acceptor:
- 15
- Hydrogen Bond Donor:
- 3
- TPSA:
- 159.25
- CAS Number(s):
- 138199-71-0
Synonym(s)
1.
Levofloxacin Hemihydrate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Asthenia | FAERS: 3 | US FAERS | |
| 2 | Malaise | FAERS: 3 | US FAERS | |
| 3 | Chest Pain | FAERS: 2 | US FAERS | |
| 4 | Erythema | FAERS: 2 | US FAERS | |
| 5 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 6 | Myoclonus | FAERS: 2 | US FAERS | |
| 7 | Palpitations | FAERS: 2 | US FAERS | |
| 8 | Pruritus | FAERS: 2 | US FAERS | |
| 9 | Tachycardia | FAERS: 2 | US FAERS | |
| 10 | Tremor | FAERS: 2 | US FAERS | |
| 11 | Vertigo | FAERS: 2 | US FAERS | |
| 12 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 13 | Acute psychosis | FAERS: 1 | US FAERS | |
| 14 | Arthralgia | FAERS: 1 | US FAERS | |
| 15 | Arthropathy | FAERS: 1 | US FAERS | |
| 16 | Back Pain | FAERS: 1 | US FAERS | |
| 17 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 18 | Choking sensation | FAERS: 1 | US FAERS | |
| 19 | Disease recurrence | FAERS: 1 | US FAERS | |
| 20 | Drug administration error | FAERS: 1 | US FAERS | |
| 21 | Drug ineffective | FAERS: 1 | US FAERS | |
| 22 | Dysphonia | FAERS: 1 | US FAERS | |
| 23 | Flushing | FAERS: 1 | US FAERS | |
| 24 | Headache | FAERS: 1 | US FAERS | |
| 25 | Hypotension | FAERS: 1 | US FAERS | |
| 26 | Joint swelling | FAERS: 1 | US FAERS | |
| 27 | Macroglossia | FAERS: 1 | US FAERS | |
| 28 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 29 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 30 | Myalgia | FAERS: 1 | US FAERS | |
| 31 | Nodule | FAERS: 1 | US FAERS | |
| 32 | Pallor | FAERS: 1 | US FAERS | |
| 33 | Pneumonitis | FAERS: 1 | US FAERS | |
| 34 | Respiratory distress | FAERS: 1 | US FAERS | |
| 35 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 36 | Stridor | FAERS: 1 | US FAERS | |
| 37 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 38 | Urticaria | FAERS: 1 | US FAERS | |
| 39 | Vanishing bile duct syndrome | FAERS: 1 | US FAERS | |
| 40 | nervous system disorder | FAERS: 1 | US FAERS | |
| 41 | Psychotic symptom | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.