Naphcon A
(SSOXZAQUVINQSA-BTJKTKAUSA-N)
Structure
- SMILES
- CN(CCC(c1ccccn1)c1ccccc1)C.OC(=O)/C=C\C(=O)O
- Molecular Formula:
- C20H24N2O4
- Molecular Weight:
- 356.416
- Log P:
- 2.8770
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 2
- TPSA:
- 90.73
- CAS Number(s):
- 132-20-7
Synonym(s)
1.
Naphcon A
2.
Naphcon-A
External Link(s)
| MeSH | C116502 |
| PubChem Compound | 5282139 25150753 |
| ChEBI | 31990 |
| CHEMBL | CHEMBL1653 |
| KEGG | cpd:C12574 dr:D01174 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 69 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 2 | Eye irritation | FAERS: 22 | US FAERS | |
| 3 | Mydriasis | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 4 | Eye pain | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Expired product administered | FAERS: 5 | US FAERS | |
| 6 | Product quality issue | FAERS: 5 | US FAERS | |
| 7 | Asthenopia | FAERS: 4 | US FAERS | |
| 8 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 9 | Dizziness | FAERS: 3 | US FAERS | |
| 10 | Foreign body sensation in eyes | FAERS: 3 | US FAERS | |
| 11 | Influenza | FAERS: 3 | US FAERS | |
| 12 | Labyrinthitis | FAERS: 3 | US FAERS | |
| 13 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 14 | Arthralgia | FAERS: 2 | US FAERS | |
| 15 | Dyspepsia | FAERS: 2 | US FAERS | |
| 16 | Eyelid irritation | FAERS: 2 | US FAERS | |
| 17 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 18 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 19 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 20 | Chemical burn of skin | FAERS: 1 | US FAERS | |
| 21 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 22 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 23 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 24 | Discomfort | FAERS: 1 | US FAERS | |
| 25 | Eye inflammation | FAERS: 1 | US FAERS | |
| 26 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 27 | Headache | FAERS: 1 | US FAERS | |
| 28 | Heat Stroke | FAERS: 1 | US FAERS | |
| 29 | Hordeolum | FAERS: 1 | US FAERS | |
| 30 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 31 | Lethargy | FAERS: 1 | US FAERS | |
| 32 | Liquid product physical issue | FAERS: 1 | US FAERS | |
| 33 | Medication Error | FAERS: 1 | US FAERS | |
| 34 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 35 | Pallor | FAERS: 1 | US FAERS | |
| 36 | Photophobia | FAERS: 1 | US FAERS | |
| 37 | Product container issue | FAERS: 1 | US FAERS | |
| 38 | Product packaging issue | FAERS: 1 | US FAERS | |
| 39 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 40 | Somnolence | FAERS: 1 | US FAERS | |
| 41 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 42 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 43 | Tremor | FAERS: 1 | US FAERS | |
| 44 | Vertigo | FAERS: 1 | US FAERS | |
| 45 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 46 | Corneal Scar | Canada Vigilance: 1 | Canada Vigilance | |
| 47 | Nervousness | Canada Vigilance: 1 | Canada Vigilance | |
| 48 | Pain | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.