Amlodipine mixture with Benazepril
(SRTZYSFUFGOMFR-FKLPMGAJSA-N)
Structure
- SMILES
- CCOC(=O)[C@@H](N[C@H]1CCc2c(N(C1=O)CC(=O)O)cccc2)CCc1ccccc1.NCCOCC1=C(C(=O)OCC)C(C(=C(N1)C)C(=O)OC)c1ccccc1Cl
- Molecular Formula:
- C44H53ClN4O10
- Molecular Weight:
- 833.365
- Log P:
- 6.3244
- Hydrogen Bond Acceptor:
- 14
- Hydrogen Bond Donor:
- 4
- TPSA:
- 195.82
- CAS Number(s):
- 357437-90-2
Synonym(s)
1.
Amlodipine mixture with Benazepril
External Link(s)
| PubChem Compound | 5746247 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Angioedema | FAERS: 12 | US FAERS | |
| 2 | Completed Suicide | FAERS: 4 | US FAERS | |
| 3 | Product substitution issue | FAERS: 3 | US FAERS | |
| 4 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 5 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 6 | Choking | FAERS: 1 | US FAERS | |
| 7 | Dizziness | FAERS: 1 | US FAERS | |
| 8 | Dyspepsia | FAERS: 1 | US FAERS | |
| 9 | Eczema | FAERS: 1 | US FAERS | |
| 10 | Flushing | FAERS: 1 | US FAERS | |
| 11 | Gingival Hyperplasia | FAERS: 1 | US FAERS | |
| 12 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 13 | Hypotension | FAERS: 1 | US FAERS | |
| 14 | Malaise | FAERS: 1 | US FAERS | |
| 15 | Mouth swelling | FAERS: 1 | US FAERS | |
| 16 | Overdose | FAERS: 1 | US FAERS | |
| 17 | Product quality issue | FAERS: 1 | US FAERS | |
| 18 | Throat irritation | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120262
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.