Apomorphine
(SKYZYDSNJIOXRL-BTQNPOSSSA-N)
Structure
- SMILES
- CN1CCc2c3[C@H]1Cc1ccc(c(c1c3ccc2)O)O.Cl
- Molecular Formula:
- C17H18ClNO2
- Molecular Weight:
- 303.783
- Log P:
- 3.5898
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 3
- TPSA:
- 43.7
- CAS Number(s):
- 314-19-2; 41372-20-7
Synonym(s)
1.
Apomorphine
2.
Apokinon
3.
Apomorphin-Teclapharm
4.
Apomorphine Chloride
5.
Apomorphine Hydrochloride
6.
Apomorphine Hydrochloride Anhydrous
7.
Apomorphine Hydrochloride, Anhydrous
8.
Apomorphine Hydrochloride, Hemihydrate
9.
Britaject
10.
Apomorphin Teclapharm
External Link(s)
| MeSH | D001058 |
| PubChem Compound | 9410 |
| BindingDB | 50367948 |
| CHEMBL | CHEMBL1616 |
| Therapeutic Target Database | D0B6QP |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nodule | FAERS: 10 | US FAERS | |
| 2 | Somnolence | FAERS: 10 | US FAERS | |
| 3 | Drug ineffective | FAERS: 8 | US FAERS | |
| 4 | Cerebrovascular accident | FAERS: 6 | US FAERS | |
| 5 | Injection site nodule | FAERS: 6 | US FAERS | |
| 6 | Malaise | FAERS: 6 | US FAERS | |
| 7 | Tremor | FAERS: 6 | US FAERS | |
| 8 | General physical health deterioration | FAERS: 5 | US FAERS | |
| 9 | Hypotension | FAERS: 5 | US FAERS | |
| 10 | Panniculitis | FAERS: 5 | US FAERS | |
| 11 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 12 | Infection | FAERS: 4 | US FAERS | |
| 13 | Injection site infection | FAERS: 4 | US FAERS | |
| 14 | Nausea | FAERS: 4 | US FAERS | |
| 15 | Neuroleptic Malignant Syndrome | FAERS: 4 | US FAERS | |
| 16 | Skin necrosis | FAERS: 4 | US FAERS | |
| 17 | Weight decreased | FAERS: 4 | US FAERS | |
| 18 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 19 | Dementia | FAERS: 3 | US FAERS | |
| 20 | Drug administration error | FAERS: 3 | US FAERS | |
| 21 | Eosinophilia | FAERS: 3 | US FAERS | |
| 22 | Inflammation | FAERS: 3 | US FAERS | |
| 23 | Injection site abscess | FAERS: 3 | US FAERS | |
| 24 | Injection site bruising | FAERS: 3 | US FAERS | |
| 25 | Injection site necrosis | FAERS: 3 | US FAERS | |
| 26 | Intestinal Obstruction | FAERS: 3 | US FAERS | |
| 27 | Muscle Rigidity | FAERS: 3 | US FAERS | |
| 28 | Unresponsive to stimuli | FAERS: 3 | US FAERS | |
| 29 | Vomiting | FAERS: 3 | US FAERS | |
| 30 | Asthenia | FAERS: 2 | US FAERS | |
| 31 | Blood iron decreased | FAERS: 2 | US FAERS | |
| 32 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 33 | Cystitis | FAERS: 2 | US FAERS | |
| 34 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 35 | Dermatitis | FAERS: 2 | US FAERS | |
| 36 | Dizziness | FAERS: 2 | US FAERS | |
| 37 | Drug Dependence | FAERS: 2 | US FAERS | |
| 38 | Fatigue | FAERS: 2 | US FAERS | |
| 39 | Flushing | FAERS: 2 | US FAERS | |
| 40 | Headache | FAERS: 2 | US FAERS | |
| 41 | Hyperkinesia | FAERS: 2 | US FAERS | |
| 42 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 43 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 44 | Injection site extravasation | FAERS: 2 | US FAERS | |
| 45 | Injection site mass | FAERS: 2 | US FAERS | |
| 46 | Malabsorption from injection site | FAERS: 2 | US FAERS | |
| 47 | Medication Error | FAERS: 2 | US FAERS | |
| 48 | Overdose | FAERS: 2 | US FAERS | |
| 49 | Pallor | FAERS: 2 | US FAERS | |
| 50 | Post procedural complication | FAERS: 2 | US FAERS | |
| 51 | Product name confusion | FAERS: 2 | US FAERS | |
| 52 | Product quality issue | FAERS: 2 | US FAERS | |
| 53 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 54 | Syncope | FAERS: 2 | US FAERS | |
| 55 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 56 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 57 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 58 | Agitation | FAERS: 1 | US FAERS | |
| 59 | Alopecia | FAERS: 1 | US FAERS | |
| 60 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 61 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 62 | Anxiety | FAERS: 1 | US FAERS | |
| 63 | Apathy | FAERS: 1 | US FAERS | |
| 64 | Application site wound | FAERS: 1 | US FAERS | |
| 65 | Asthma | FAERS: 1 | US FAERS | |
| 66 | Ataxia | FAERS: 1 | US FAERS | |
| 67 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 68 | Back Pain | FAERS: 1 | US FAERS | |
| 69 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 70 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 71 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 72 | Bone erosion | FAERS: 1 | US FAERS | |
| 73 | Bradycardia | FAERS: 1 | US FAERS | |
| 74 | Bradykinesia | FAERS: 1 | US FAERS | |
| 75 | Bronchitis | FAERS: 1 | US FAERS | |
| 76 | Camptocormia | FAERS: 1 | US FAERS | |
| 77 | Catarrh | FAERS: 1 | US FAERS | |
| 78 | Cellulitis | FAERS: 1 | US FAERS | |
| 79 | Chest Pain | FAERS: 1 | US FAERS | |
| 80 | Cholecystitis | FAERS: 1 | US FAERS | |
| 81 | Chromaturia | FAERS: 1 | US FAERS | |
| 82 | Circumstance or information capable of leading to device use error | FAERS: 1 | US FAERS | |
| 83 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 84 | Diplopia | FAERS: 1 | US FAERS | |
| 85 | Drooling | FAERS: 1 | US FAERS | |
| 86 | Drug abuse | FAERS: 1 | US FAERS | |
| 87 | Dysgeusia | FAERS: 1 | US FAERS | |
| 88 | Dyspepsia | FAERS: 1 | US FAERS | |
| 89 | Dysphemia | FAERS: 1 | US FAERS | |
| 90 | Dystonia | FAERS: 1 | US FAERS | |
| 91 | Dysuria | FAERS: 1 | US FAERS | |
| 92 | Epilepsy | FAERS: 1 | US FAERS | |
| 93 | Erysipelas | FAERS: 1 | US FAERS | |
| 94 | Erythema | FAERS: 1 | US FAERS | |
| 95 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 96 | Fracture | FAERS: 1 | US FAERS | |
| 97 | Freezing phenomenon | FAERS: 1 | US FAERS | |
| 98 | Gait inability | FAERS: 1 | US FAERS | |
| 99 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 100 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 101 | Gaze palsy | FAERS: 1 | US FAERS | |
| 102 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 103 | Hilar lymphadenopathy | FAERS: 1 | US FAERS | |
| 104 | Hyperventilation | FAERS: 1 | US FAERS | |
| 105 | Ileus | FAERS: 1 | US FAERS | |
| 106 | Incoherent | FAERS: 1 | US FAERS | |
| 107 | Incontinence | FAERS: 1 | US FAERS | |
| 108 | Incorrect dose administered by device | FAERS: 1 | US FAERS | |
| 109 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 110 | Infusion site infection | FAERS: 1 | US FAERS | |
| 111 | Infusion site necrosis | FAERS: 1 | US FAERS | |
| 112 | Initial insomnia | FAERS: 1 | US FAERS | |
| 113 | Injection site erythema | FAERS: 1 | US FAERS | |
| 114 | Injection site vesicles | FAERS: 1 | US FAERS | |
| 115 | Injection site warmth | FAERS: 1 | US FAERS | |
| 116 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 117 | Lethargy | FAERS: 1 | US FAERS | |
| 118 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 119 | Memory impairment | FAERS: 1 | US FAERS | |
| 120 | Multimorbidity | FAERS: 1 | US FAERS | |
| 121 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 122 | Narcolepsy | FAERS: 1 | US FAERS | |
| 123 | Necrosis | FAERS: 1 | US FAERS | |
| 124 | Nocturia | FAERS: 1 | US FAERS | |
| 125 | Ocular icterus | FAERS: 1 | US FAERS | |
| 126 | Pain | FAERS: 1 | US FAERS | |
| 127 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 128 | Pelvic floor dyssynergia | FAERS: 1 | US FAERS | |
| 129 | Pharyngitis | FAERS: 1 | US FAERS | |
| 130 | Pneumonia | FAERS: 1 | US FAERS | |
| 131 | Reduced facial expression | FAERS: 1 | US FAERS | |
| 132 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 133 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 134 | Rhinitis | FAERS: 1 | US FAERS | |
| 135 | Sepsis | FAERS: 1 | US FAERS | |
| 136 | Septic Shock | FAERS: 1 | US FAERS | |
| 137 | Skin Induration | FAERS: 1 | US FAERS | |
| 138 | Skin nodule | FAERS: 1 | US FAERS | |
| 139 | Subileus | FAERS: 1 | US FAERS | |
| 140 | Therapy change | FAERS: 1 | US FAERS | |
| 141 | Thrombosis | FAERS: 1 | US FAERS | |
| 142 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 143 | Transaminases increased | FAERS: 1 | US FAERS | |
| 144 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 145 | Wheezing | FAERS: 1 | US FAERS | |
| 146 | Wound necrosis | FAERS: 1 | US FAERS | |
| 147 | Yawning | FAERS: 1 | US FAERS | |
| 148 | jaundice | FAERS: 1 | US FAERS | |
| 149 | skin abrasion | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.