Triiodothyronine
(SBXXSUDPJJJJLC-YDALLXLXSA-M)
Structure
- SMILES
- [O-]C(=O)[C@H](Cc1cc(I)c(c(c1)I)Oc1ccc(c(c1)I)O)N.[Na+]
- Molecular Formula:
- C15H11I3NNaO4
- Molecular Weight:
- 672.955
- Log P:
- 3.3183
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 2
- TPSA:
- 95.61
- CAS Number(s):
- 55-06-1
Synonym(s)
1.
Triiodothyronine
2.
Liothyronine
3.
T3 Thyroid Hormone
4.
3,3',5-Triiodothyronine
5.
Cytomel
6.
Liothyronine Sodium
7.
Thyroid Hormone, T3
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 116 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 2 | Malaise | FAERS: 47 | US FAERS | |
| 3 | Fatigue | FAERS: 45 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 4 | Alopecia | FAERS: 41 | US FAERS | |
| 5 | Headache | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Feeling abnormal | FAERS: 32 | US FAERS | |
| 7 | Product substitution issue | FAERS: 24 | US FAERS | |
| 8 | Palpitations | FAERS: 22 | US FAERS | |
| 9 | Product quality issue | FAERS: 17 | US FAERS | |
| 10 | Abdominal discomfort | FAERS: 16 | US FAERS | |
| 11 | Hypersensitivity | FAERS: 14 | US FAERS | |
| 12 | Anxiety | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Asthenia | FAERS: 13 | US FAERS | |
| 14 | Hypothyroidism | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Pain | FAERS: 12 | US FAERS | |
| 16 | Arthralgia | FAERS: 11 | US FAERS | |
| 17 | Dizziness | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Intentional product misuse | FAERS: 10 | US FAERS | |
| 19 | Constipation | FAERS: 9 | US FAERS | |
| 20 | Reaction to drug excipients | FAERS: 9 | US FAERS | |
| 21 | Reaction to excipient | FAERS: 9 | US FAERS | |
| 22 | Tremor | FAERS: 9 | US FAERS | |
| 23 | Nausea | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Pruritus | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Hypersomnia | FAERS: 6 | US FAERS | |
| 26 | Weight decreased | FAERS: 6 | US FAERS | |
| 27 | Antibody test abnormal | FAERS: 5 | US FAERS | |
| 28 | Atrial Fibrillation | FAERS: 5 | US FAERS | |
| 29 | Autoimmune thyroiditis | FAERS: 5 | US FAERS | |
| 30 | Blood thyroid stimulating hormone increased | FAERS: 5 | US FAERS | |
| 31 | Drug effect incomplete | FAERS: 5 | US FAERS | |
| 32 | Flatulence | FAERS: 5 | US FAERS | |
| 33 | Intentional product use issue | FAERS: 5 | US FAERS | |
| 34 | Myalgia | FAERS: 5 | US FAERS | |
| 35 | Overdose | FAERS: 5 | US FAERS | |
| 36 | Sluggishness | FAERS: 5 | US FAERS | |
| 37 | Urticaria | FAERS: 5 | US FAERS | |
| 38 | Blood thyroid stimulating hormone decreased | FAERS: 4 | US FAERS | |
| 39 | Dyspepsia | FAERS: 4 | US FAERS | |
| 40 | Feeling Cold | FAERS: 4 | US FAERS | |
| 41 | Gluten sensitivity | FAERS: 4 | US FAERS | |
| 42 | Hyperthyroidism | FAERS: 4 | US FAERS | |
| 43 | Joint swelling | FAERS: 4 | US FAERS | |
| 44 | Lethargy | FAERS: 4 | US FAERS | |
| 45 | Myocardial Infarction | FAERS: 4 | US FAERS | |
| 46 | Nervousness | FAERS: 4 | US FAERS | |
| 47 | Peripheral swelling | FAERS: 4 | US FAERS | |
| 48 | Product dispensing error | FAERS: 4 | US FAERS | |
| 49 | Product use issue | FAERS: 4 | US FAERS | |
| 50 | Suspected counterfeit product | FAERS: 4 | US FAERS | |
| 51 | Therapeutic response unexpected | FAERS: 4 | US FAERS | |
| 52 | Abdominal Pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Allergic reaction to excipient | FAERS: 3 | US FAERS | |
| 54 | Amnesia | FAERS: 3 | US FAERS | |
| 55 | Blood thyroid stimulating hormone abnormal | FAERS: 3 | US FAERS | |
| 56 | Chest discomfort | FAERS: 3 | US FAERS | |
| 57 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 58 | Dry skin | FAERS: 3 | US FAERS | |
| 59 | Dysgeusia | FAERS: 3 | US FAERS | |
| 60 | Expired product administered | FAERS: 3 | US FAERS | |
| 61 | Feeling jittery | FAERS: 3 | US FAERS | |
| 62 | Food Allergy | FAERS: 3 | US FAERS | |
| 63 | Influenza | FAERS: 3 | US FAERS | |
| 64 | Malabsorption | FAERS: 3 | US FAERS | |
| 65 | Medication Error | FAERS: 3 | US FAERS | |
| 66 | Somnolence | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Swelling | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 68 | Tri-iodothyronine abnormal | FAERS: 3 | US FAERS | |
| 69 | Vomiting | FAERS: 3 | US FAERS | |
| 70 | Wheezing | FAERS: 3 | US FAERS | |
| 71 | Ageusia | FAERS: 2 | US FAERS | |
| 72 | Anosmia | FAERS: 2 | US FAERS | |
| 73 | Aphasia | FAERS: 2 | US FAERS | |
| 74 | Back Pain | FAERS: 2 | US FAERS | |
| 75 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 76 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 77 | Bradycardia | FAERS: 2 | US FAERS | |
| 78 | Breast tenderness | FAERS: 2 | US FAERS | |
| 79 | Chest Pain | FAERS: 2 | US FAERS | |
| 80 | Chills | FAERS: 2 | US FAERS | |
| 81 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 82 | Depressed mood | FAERS: 2 | US FAERS | |
| 83 | Drug administration error | FAERS: 2 | US FAERS | |
| 84 | Drug effect delayed | FAERS: 2 | US FAERS | |
| 85 | Emotional disorder | FAERS: 2 | US FAERS | |
| 86 | Hunger | FAERS: 2 | US FAERS | |
| 87 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 88 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 89 | Inflammation | FAERS: 2 | US FAERS | |
| 90 | Limb discomfort | FAERS: 2 | US FAERS | |
| 91 | Lip swelling | FAERS: 2 | US FAERS | |
| 92 | Mental impairment | FAERS: 2 | US FAERS | |
| 93 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 94 | Personality Change | FAERS: 2 | US FAERS | |
| 95 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 96 | Pre-existing condition improved | FAERS: 2 | US FAERS | |
| 97 | Product dose omission | FAERS: 2 | US FAERS | |
| 98 | Product formulation issue | FAERS: 2 | US FAERS | |
| 99 | Product size issue | FAERS: 2 | US FAERS | |
| 100 | Rash erythematous | FAERS: 2 | US FAERS | |
| 101 | Thyrotoxic periodic paralysis | FAERS: 2 | US FAERS | |
| 102 | Unevaluable event | FAERS: 2 | US FAERS | |
| 103 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 104 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 105 | Accidental overdose | FAERS: 1 | US FAERS | |
| 106 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 107 | Anger | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 108 | Anti-thyroid antibody positive | FAERS: 1 | US FAERS | |
| 109 | Asthma | FAERS: 1 | US FAERS | |
| 110 | Back disorder | FAERS: 1 | US FAERS | |
| 111 | Blood calcitonin increased | FAERS: 1 | US FAERS | |
| 112 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 113 | Blood cortisol decreased | FAERS: 1 | US FAERS | |
| 114 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 115 | Blood insulin abnormal | FAERS: 1 | US FAERS | |
| 116 | Blood parathyroid hormone increased | FAERS: 1 | US FAERS | |
| 117 | Bone pain | FAERS: 1 | US FAERS | |
| 118 | Burning sensation | FAERS: 1 | US FAERS | |
| 119 | Cataract | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 120 | Crying | FAERS: 1 | US FAERS | |
| 121 | Dehydration | FAERS: 1 | US FAERS | |
| 122 | Dermatitis | FAERS: 1 | US FAERS | |
| 123 | Discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 124 | Drug dose omission | FAERS: 1 | US FAERS | |
| 125 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 126 | Dysgraphia | FAERS: 1 | US FAERS | |
| 127 | Ear congestion | FAERS: 1 | US FAERS | |
| 128 | Economic problem | FAERS: 1 | US FAERS | |
| 129 | Eczema | FAERS: 1 | US FAERS | |
| 130 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 131 | Erythema | FAERS: 1 | US FAERS | |
| 132 | Extra dose administered | FAERS: 1 | US FAERS | |
| 133 | Eye allergy | FAERS: 1 | US FAERS | |
| 134 | Eye inflammation | FAERS: 1 | US FAERS | |
| 135 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 136 | Flushing | FAERS: 1 | US FAERS | |
| 137 | Food craving | FAERS: 1 | US FAERS | |
| 138 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 139 | Glaucoma | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 140 | Head discomfort | FAERS: 1 | US FAERS | |
| 141 | Impaired work ability | FAERS: 1 | US FAERS | |
| 142 | Incorrect product dosage form administered | FAERS: 1 | US FAERS | |
| 143 | Insulin Resistance | FAERS: 1 | US FAERS | |
| 144 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 145 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 146 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 147 | Lymphocytic infiltration | FAERS: 1 | US FAERS | |
| 148 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 149 | Mental status changes | FAERS: 1 | US FAERS | |
| 150 | Mood swings | FAERS: 1 | US FAERS | |
| 151 | Multiple allergies | FAERS: 1 | US FAERS | |
| 152 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 153 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 154 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 155 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 156 | Narcolepsy | FAERS: 1 | US FAERS | |
| 157 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 158 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 159 | Neck Pain | FAERS: 1 | US FAERS | |
| 160 | Neuralgia | FAERS: 1 | US FAERS | |
| 161 | No adverse event | FAERS: 1 | US FAERS | |
| 162 | Oral pain | FAERS: 1 | US FAERS | |
| 163 | Oral pruritus | FAERS: 1 | US FAERS | |
| 164 | Osteoporosis | FAERS: 1 | US FAERS | |
| 165 | Pallor | FAERS: 1 | US FAERS | |
| 166 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 167 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 168 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 169 | Product physical issue | FAERS: 1 | US FAERS | |
| 170 | Product prescribing error | FAERS: 1 | US FAERS | |
| 171 | Product storage error | FAERS: 1 | US FAERS | |
| 172 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 173 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 174 | Productive Cough | FAERS: 1 | US FAERS | |
| 175 | Psoriasis | FAERS: 1 | US FAERS | |
| 176 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 177 | Purulence | FAERS: 1 | US FAERS | |
| 178 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 179 | Reverse tri-iodothyronine increased | FAERS: 1 | US FAERS | |
| 180 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 181 | Stomatitis | FAERS: 1 | US FAERS | |
| 182 | Syncope | FAERS: 1 | US FAERS | |
| 183 | Tachycardia | FAERS: 1 | US FAERS | |
| 184 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 185 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 186 | Tension | FAERS: 1 | US FAERS | |
| 187 | Tinnitus | FAERS: 1 | US FAERS | |
| 188 | Tri-iodothyronine free decreased | FAERS: 1 | US FAERS | |
| 189 | Tri-iodothyronine free increased | FAERS: 1 | US FAERS | |
| 190 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 191 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 192 | Urine output increased | FAERS: 1 | US FAERS | |
| 193 | Visual Impairment | FAERS: 1 | US FAERS | |
| 194 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 195 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 196 | nervous system disorder | FAERS: 1 | US FAERS | |
| 197 | Choking sensation | Canada Vigilance: 1 | Canada Vigilance | |
| 198 | Gastrointestinal Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 199 | Hypertrichosis | Canada Vigilance: 1 | Canada Vigilance | |
| 200 | Product complaint | Canada Vigilance: 3 | Canada Vigilance | |
| 201 | Therapeutic product effect delayed | Canada Vigilance: 2 | Canada Vigilance | |
| 202 | Therapeutic product effect incomplete | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.