GlucaGen
(RKGLLHCSSVJTAN-YYICOITRSA-N)
Structure
- SMILES
- NCCCC[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)[C@H](O)C)CC(=O)N)CCSC)CC(C)C)Cc1c[nH]c2c1cccc2)CCC(=O)N)C(C)C)Cc1ccccc1)CC(=O)O)CCC(=O)N)C)CCCNC(=N)N)CCCNC(=N)N)CO)CC(=O)O)CC(C)C)Cc1ccc(cc1)O)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H]([C@H](O)C)NC(=O)[C@@H](NC(=O)[C@H]([C@H](O)C)NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](Cc1[nH]cnc1)N)CO)CCC(=O)N)Cc1ccccc1)CO)CC(=O)O)Cc1ccc(cc1)O)CO.Cl
- Molecular Formula:
- C153H226ClN43O49S
- Molecular Weight:
- 3519.210
- Log P:
- 0.3911
- Hydrogen Bond Acceptor:
- 91
- Hydrogen Bond Donor:
- 56
- TPSA:
- 1564.04
- CAS Number(s):
- 19179-82-9; 28270-04-4
Synonym(s)
1.
GlucaGen
2.
CID 71777450
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 7 | US FAERS | |
| 2 | Headache | FAERS: 4 | US FAERS | |
| 3 | Vomiting | FAERS: 3 | US FAERS | |
| 4 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 5 | Cold sweat | FAERS: 2 | US FAERS | |
| 6 | Device leakage | FAERS: 2 | US FAERS | |
| 7 | Malaise | FAERS: 2 | US FAERS | |
| 8 | Syncope | FAERS: 2 | US FAERS | |
| 9 | Anxiety | FAERS: 1 | US FAERS | |
| 10 | Fatigue | FAERS: 1 | US FAERS | |
| 11 | Flushing | FAERS: 1 | US FAERS | |
| 12 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 13 | Hypotension | FAERS: 1 | US FAERS | |
| 14 | Medication Error | FAERS: 1 | US FAERS | |
| 15 | Necrolytic Migratory Erythema | FAERS: 1 | US FAERS | |
| 16 | No adverse event | FAERS: 1 | US FAERS | |
| 17 | Palpitations | FAERS: 1 | US FAERS | |
| 18 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 19 | Product use issue | FAERS: 1 | US FAERS | |
| 20 | Somnolence | FAERS: 1 | US FAERS | |
| 21 | Sudden death | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.