Sacubitril
(PYNXFZCZUAOOQC-UTKZUKDTSA-N)
Structure
- SMILES
- CCOC(=O)[C@@H](C[C@@H](Cc1ccc(cc1)c1ccccc1)NC(=O)CCC(=O)O)C
- Type(s)
- Approved
- ATC code(s)
- C09DX04
- Molecular Formula:
- C24H29NO5
- Molecular Weight:
- 411.491
- Log P:
- 4.2259
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 2
- TPSA:
- 92.7
- CAS Number(s):
- 149709-62-6
Synonym(s)
1.
Sacubitril
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 2 | Hypotension | FAERS: 2 | US FAERS | |
| 3 | Skin lesion | FAERS: 2 | US FAERS | |
| 4 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 5 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 6 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 7 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 8 | Dysphonia | FAERS: 1 | US FAERS | |
| 9 | Dysuria | FAERS: 1 | US FAERS | |
| 10 | Erythema Induratum | FAERS: 1 | US FAERS | |
| 11 | Forced expiratory volume increased | FAERS: 1 | US FAERS | |
| 12 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 13 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 14 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 15 | Pancreatitis | FAERS: 1 | US FAERS | |
| 16 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 17 | Ventricular arrhythmia | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.