tasimelteon
(PTOIAAWZLUQTIO-GXFFZTMASA-N)
Structure
- SMILES
- CCC(=O)NC[C@@H]1C[C@H]1c1cccc2c1CCO2
- Type(s)
- Approved; Investigational
- ATC code(s)
- N05CH03
- Molecular Formula:
- C15H19NO2
- Molecular Weight:
- 245.317
- Log P:
- 2.6421
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 38.33
- CAS Number(s):
- 609799-22-6
Synonym(s)
1.
tasimelteon
2.
BMS 214778
3.
BMS-214778
4.
BMS214778
5.
N-((2-(2,3-dihydro-4-benzofuranyl)cyclopropyl)methyl)propanamide
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 669 | US FAERS | |
| 2 | Headache | FAERS: 150 | SIDER US FAERS | |
| 3 | Middle insomnia | FAERS: 130 | US FAERS | |
| 4 | Somnolence | FAERS: 129 | US FAERS | |
| 5 | Drug dose omission | FAERS: 75 | US FAERS | |
| 6 | Incorrect drug administration duration | FAERS: 75 | US FAERS | |
| 7 | Incorrect product administration duration | FAERS: 71 | US FAERS | |
| 8 | Fatigue | FAERS: 63 | US FAERS | |
| 9 | Product dose omission | FAERS: 58 | US FAERS | |
| 10 | Feeling abnormal | FAERS: 44 | US FAERS | |
| 11 | Dizziness | FAERS: 42 | US FAERS | |
| 12 | Initial insomnia | FAERS: 41 | US FAERS | |
| 13 | Nausea | FAERS: 37 | US FAERS | |
| 14 | Abdominal discomfort | FAERS: 31 | US FAERS | |
| 15 | Therapeutic product effect decreased | FAERS: 30 | US FAERS | |
| 16 | Urinary tract infection | FAERS: 30 | SIDER US FAERS | |
| 17 | Anxiety | FAERS: 29 | US FAERS | |
| 18 | Inappropriate schedule of drug administration | FAERS: 29 | US FAERS | |
| 19 | Malaise | FAERS: 27 | US FAERS | |
| 20 | Hypersomnia | FAERS: 26 | US FAERS | |
| 21 | Poor quality sleep | FAERS: 26 | US FAERS | |
| 22 | Vomiting | FAERS: 26 | US FAERS | |
| 23 | Inappropriate schedule of product administration | FAERS: 25 | US FAERS | |
| 24 | Influenza | FAERS: 20 | US FAERS | |
| 25 | Memory impairment | FAERS: 19 | US FAERS | |
| 26 | Drug effect incomplete | FAERS: 18 | US FAERS | |
| 27 | Nasopharyngitis | FAERS: 18 | US FAERS | |
| 28 | Pruritus | FAERS: 17 | US FAERS | |
| 29 | Pneumonia | FAERS: 16 | US FAERS | |
| 30 | Therapeutic product effect incomplete | FAERS: 15 | US FAERS | |
| 31 | Adverse event | FAERS: 14 | US FAERS | |
| 32 | Chest Pain | FAERS: 12 | US FAERS | |
| 33 | Back Pain | FAERS: 11 | US FAERS | |
| 34 | Hypersensitivity | FAERS: 11 | US FAERS | |
| 35 | Incorrect dose administered | FAERS: 11 | US FAERS | |
| 36 | Pain | FAERS: 11 | US FAERS | |
| 37 | Somnambulism | FAERS: 11 | US FAERS | |
| 38 | Asthenia | FAERS: 10 | US FAERS | |
| 39 | Dyspepsia | FAERS: 10 | US FAERS | |
| 40 | Hypotension | FAERS: 10 | US FAERS | |
| 41 | Restlessness | FAERS: 10 | US FAERS | |
| 42 | Therapy cessation | FAERS: 10 | US FAERS | |
| 43 | Drug effect delayed | FAERS: 9 | US FAERS | |
| 44 | Peripheral swelling | FAERS: 9 | US FAERS | |
| 45 | Therapeutic product effect delayed | FAERS: 9 | US FAERS | |
| 46 | Amnesia | FAERS: 8 | US FAERS | |
| 47 | Cerebrovascular accident | FAERS: 8 | US FAERS | |
| 48 | Constipation | FAERS: 8 | US FAERS | |
| 49 | Drug effect variable | FAERS: 8 | US FAERS | |
| 50 | Myalgia | FAERS: 8 | US FAERS | |
| 51 | Nervousness | FAERS: 8 | US FAERS | |
| 52 | Oropharyngeal pain | FAERS: 8 | US FAERS | |
| 53 | Therapeutic response unexpected | FAERS: 8 | US FAERS | |
| 54 | Alopecia | FAERS: 7 | US FAERS | |
| 55 | Bronchitis | FAERS: 7 | US FAERS | |
| 56 | Dysuria | FAERS: 7 | US FAERS | |
| 57 | Palpitations | FAERS: 7 | US FAERS | |
| 58 | Sinusitis | FAERS: 7 | US FAERS | |
| 59 | Throat irritation | FAERS: 7 | US FAERS | |
| 60 | Blood glucose increased | FAERS: 6 | US FAERS | |
| 61 | Diverticulitis | FAERS: 6 | US FAERS | |
| 62 | Weight decreased | FAERS: 6 | US FAERS | |
| 63 | Apathy | FAERS: 5 | US FAERS | |
| 64 | Depressed mood | FAERS: 5 | US FAERS | |
| 65 | Disorientation | FAERS: 5 | US FAERS | |
| 66 | Intentional product misuse | FAERS: 5 | US FAERS | |
| 67 | Intentional product use issue | FAERS: 5 | US FAERS | |
| 68 | Limb injury | FAERS: 5 | US FAERS | |
| 69 | No adverse event | FAERS: 5 | US FAERS | |
| 70 | Product use issue | FAERS: 5 | US FAERS | |
| 71 | Sleep Talking | FAERS: 5 | US FAERS | |
| 72 | Therapeutic product effect variable | FAERS: 5 | US FAERS | |
| 73 | Thrombosis | FAERS: 5 | US FAERS | |
| 74 | Tremor | FAERS: 5 | US FAERS | |
| 75 | Unevaluable event | FAERS: 5 | US FAERS | |
| 76 | Urticaria | FAERS: 5 | US FAERS | |
| 77 | Abdominal Pain | FAERS: 4 | US FAERS | |
| 78 | Agitation | FAERS: 4 | US FAERS | |
| 79 | Arthralgia | FAERS: 4 | US FAERS | |
| 80 | Blood glucose decreased | FAERS: 4 | US FAERS | |
| 81 | Diabetes mellitus inadequate control | FAERS: 4 | US FAERS | |
| 82 | Dysphonia | FAERS: 4 | US FAERS | |
| 83 | Epigastric discomfort | FAERS: 4 | US FAERS | |
| 84 | Eye pain | FAERS: 4 | US FAERS | |
| 85 | Feeling jittery | FAERS: 4 | US FAERS | |
| 86 | Flank Pain | FAERS: 4 | US FAERS | |
| 87 | Nocturia | FAERS: 4 | US FAERS | |
| 88 | Product use in unapproved indication | FAERS: 4 | US FAERS | |
| 89 | Restless Legs Syndrome | FAERS: 4 | US FAERS | |
| 90 | Sluggishness | FAERS: 4 | US FAERS | |
| 91 | Urinary Incontinence | FAERS: 4 | US FAERS | |
| 92 | Alanine Aminotransferase Increased | FAERS: 3 | SIDER US FAERS | |
| 93 | Anger | FAERS: 3 | US FAERS | |
| 94 | Asthma | FAERS: 3 | US FAERS | |
| 95 | Cellulitis | FAERS: 3 | US FAERS | |
| 96 | Delayed sleep phase | FAERS: 3 | US FAERS | |
| 97 | Discomfort | FAERS: 3 | US FAERS | |
| 98 | Drug ineffective for unapproved indication | FAERS: 3 | US FAERS | |
| 99 | Emotional distress | FAERS: 3 | US FAERS | |
| 100 | Eye irritation | FAERS: 3 | US FAERS | |
| 101 | Fluid overload | FAERS: 3 | US FAERS | |
| 102 | Frustration tolerance decreased | FAERS: 3 | US FAERS | |
| 103 | Head discomfort | FAERS: 3 | US FAERS | |
| 104 | Intentional dose omission | FAERS: 3 | US FAERS | |
| 105 | Irregular sleep phase | FAERS: 3 | US FAERS | |
| 106 | Joint swelling | FAERS: 3 | US FAERS | |
| 107 | Musculoskeletal stiffness | FAERS: 3 | US FAERS | |
| 108 | Night sweats | FAERS: 3 | US FAERS | |
| 109 | Overdose | FAERS: 3 | US FAERS | |
| 110 | Paranoia | FAERS: 3 | US FAERS | |
| 111 | Product physical issue | FAERS: 3 | US FAERS | |
| 112 | Product used for unknown indication | FAERS: 3 | US FAERS | |
| 113 | Productive Cough | FAERS: 3 | US FAERS | |
| 114 | Tooth Extraction | FAERS: 3 | US FAERS | |
| 115 | Urinary Retention | FAERS: 3 | US FAERS | |
| 116 | Vertigo | FAERS: 3 | US FAERS | |
| 117 | Abnormal sleep-related event | FAERS: 2 | US FAERS | |
| 118 | Accidental overdose | FAERS: 2 | US FAERS | |
| 119 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 120 | Aphasia | FAERS: 2 | US FAERS | |
| 121 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 122 | Blood iron increased | FAERS: 2 | US FAERS | |
| 123 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 124 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 125 | Charles Bonnet Syndrome | FAERS: 2 | US FAERS | |
| 126 | Chills | FAERS: 2 | US FAERS | |
| 127 | Chronic Fatigue Syndrome | FAERS: 2 | US FAERS | |
| 128 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 129 | Cystitis | FAERS: 2 | US FAERS | |
| 130 | Dark circles under eyes | FAERS: 2 | US FAERS | |
| 131 | Delirium | FAERS: 2 | US FAERS | |
| 132 | Depression suicidal | FAERS: 2 | US FAERS | |
| 133 | Drug administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 134 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 135 | Enuresis | FAERS: 2 | US FAERS | |
| 136 | Euphoric mood | FAERS: 2 | US FAERS | |
| 137 | Eye excision | FAERS: 2 | US FAERS | |
| 138 | Fibromyalgia | FAERS: 2 | US FAERS | |
| 139 | Gout | FAERS: 2 | US FAERS | |
| 140 | Hospice Care | FAERS: 2 | US FAERS | |
| 141 | Hunger | FAERS: 2 | US FAERS | |
| 142 | Incontinence | FAERS: 2 | US FAERS | |
| 143 | Intrusive thoughts | FAERS: 2 | US FAERS | |
| 144 | Joint stiffness | FAERS: 2 | US FAERS | |
| 145 | Lethargy | FAERS: 2 | US FAERS | |
| 146 | Limb operation | FAERS: 2 | US FAERS | |
| 147 | Loss of dreaming | FAERS: 2 | US FAERS | |
| 148 | Loss of personal independence in daily activities | FAERS: 2 | US FAERS | |
| 149 | Lower Urinary Tract Symptoms | FAERS: 2 | US FAERS | |
| 150 | Lymphoma | FAERS: 2 | US FAERS | |
| 151 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 152 | Medication Error | FAERS: 2 | US FAERS | |
| 153 | Mood swings | FAERS: 2 | US FAERS | |
| 154 | Muscle Spasticity | FAERS: 2 | US FAERS | |
| 155 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 156 | Oropharyngeal discomfort | FAERS: 2 | US FAERS | |
| 157 | Paradoxical drug reaction | FAERS: 2 | US FAERS | |
| 158 | Paranasal sinus hypersecretion | FAERS: 2 | US FAERS | |
| 159 | Prescription drug used without a prescription | FAERS: 2 | US FAERS | |
| 160 | Product administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 161 | Product administration error | FAERS: 2 | US FAERS | |
| 162 | Product prescribing error | FAERS: 2 | US FAERS | |
| 163 | Product use complaint | FAERS: 2 | US FAERS | |
| 164 | Proteinuria | FAERS: 2 | US FAERS | |
| 165 | Rash erythematous | FAERS: 2 | US FAERS | |
| 166 | Rebound effect | FAERS: 2 | US FAERS | |
| 167 | Renal pain | FAERS: 2 | US FAERS | |
| 168 | Retinal vascular occlusion | FAERS: 2 | US FAERS | |
| 169 | Rhinitis | FAERS: 2 | US FAERS | |
| 170 | Sciatica | FAERS: 2 | US FAERS | |
| 171 | Screaming | FAERS: 2 | US FAERS | |
| 172 | Skin lesion | FAERS: 2 | US FAERS | |
| 173 | Sleep Paralysis | FAERS: 2 | US FAERS | |
| 174 | Stress | FAERS: 2 | US FAERS | |
| 175 | Swelling | FAERS: 2 | US FAERS | |
| 176 | Thirst | FAERS: 2 | US FAERS | |
| 177 | Tinnitus | FAERS: 2 | US FAERS | |
| 178 | Toothache | FAERS: 2 | US FAERS | |
| 179 | Trismus | FAERS: 2 | US FAERS | |
| 180 | Ulcer | FAERS: 2 | US FAERS | |
| 181 | Upper respiratory tract congestion | FAERS: 2 | US FAERS | |
| 182 | Urine flow decreased | FAERS: 2 | US FAERS | |
| 183 | Vessel perforation | FAERS: 2 | US FAERS | |
| 184 | Visual Impairment | FAERS: 2 | US FAERS | |
| 185 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 186 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 187 | Abasia | FAERS: 1 | US FAERS | |
| 188 | Ageusia | FAERS: 1 | US FAERS | |
| 189 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 190 | Angioedema | FAERS: 1 | US FAERS | |
| 191 | Aortic wall hypertrophy | FAERS: 1 | US FAERS | |
| 192 | Arthritis | FAERS: 1 | US FAERS | |
| 193 | Bereavement | FAERS: 1 | US FAERS | |
| 194 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 195 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 196 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 197 | Breast tenderness | FAERS: 1 | US FAERS | |
| 198 | Burning sensation | FAERS: 1 | US FAERS | |
| 199 | Catheter site infection | FAERS: 1 | US FAERS | |
| 200 | Choking | FAERS: 1 | US FAERS | |
| 201 | Colitis | FAERS: 1 | US FAERS | |
| 202 | Completed Suicide | FAERS: 1 | US FAERS | |
| 203 | Crying | FAERS: 1 | US FAERS | |
| 204 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 205 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 206 | Drug administration error | FAERS: 1 | US FAERS | |
| 207 | Drug-disease interaction | FAERS: 1 | US FAERS | |
| 208 | Dry skin | FAERS: 1 | US FAERS | |
| 209 | Dysarthria | FAERS: 1 | US FAERS | |
| 210 | Dysgeusia | FAERS: 1 | US FAERS | |
| 211 | Ear congestion | FAERS: 1 | US FAERS | |
| 212 | Emotional disorder | FAERS: 1 | US FAERS | |
| 213 | Eructation | FAERS: 1 | US FAERS | |
| 214 | Eyelid skin dryness | FAERS: 1 | US FAERS | |
| 215 | Female sexual arousal disorder | FAERS: 1 | US FAERS | |
| 216 | Flatulence | FAERS: 1 | US FAERS | |
| 217 | Formication | FAERS: 1 | US FAERS | |
| 218 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 219 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 220 | Hypervigilance | FAERS: 1 | US FAERS | |
| 221 | Idiopathic urticaria | FAERS: 1 | US FAERS | |
| 222 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 223 | Incoherent | FAERS: 1 | US FAERS | |
| 224 | Infection | FAERS: 1 | US FAERS | |
| 225 | Inhibitory drug interaction | FAERS: 1 | US FAERS | |
| 226 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 227 | Medical device discomfort | FAERS: 1 | US FAERS | |
| 228 | Menopause | FAERS: 1 | US FAERS | |
| 229 | Mental impairment | FAERS: 1 | US FAERS | |
| 230 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 231 | Motion Sickness | FAERS: 1 | US FAERS | |
| 232 | Mouth swelling | FAERS: 1 | US FAERS | |
| 233 | Multiple sclerosis relapse | FAERS: 1 | US FAERS | |
| 234 | Muscle tightness | FAERS: 1 | US FAERS | |
| 235 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 236 | Narcolepsy | FAERS: 1 | US FAERS | |
| 237 | Neck Pain | FAERS: 1 | US FAERS | |
| 238 | Physical product label issue | FAERS: 1 | US FAERS | |
| 239 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 240 | Product administration interrupted | FAERS: 1 | US FAERS | |
| 241 | Product counterfeit | FAERS: 1 | US FAERS | |
| 242 | Product packaging issue | FAERS: 1 | US FAERS | |
| 243 | Product quality issue | FAERS: 1 | US FAERS | |
| 244 | Regurgitation | FAERS: 1 | US FAERS | |
| 245 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 246 | Rhinovirus infection | FAERS: 1 | US FAERS | |
| 247 | Skin hypertrophy | FAERS: 1 | US FAERS | |
| 248 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 249 | Sneezing | FAERS: 1 | US FAERS | |
| 250 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 251 | Therapeutic product effect increased | FAERS: 1 | US FAERS | |
| 252 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 253 | Tooth Infection | FAERS: 1 | US FAERS | |
| 254 | Trichotillomania | FAERS: 1 | US FAERS | |
| 255 | Urethral spasm | FAERS: 1 | US FAERS | |
| 256 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 257 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 258 | Wrong product administered | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.