Doxycycline hydrochloride
(PTNZGHXUZDHMIQ-CVHRZJFOSA-N)
Structure
- SMILES
- CN([C@@H]1C(=O)C(=C([C@@]2([C@H]1[C@@H](O)[C@@H]1[C@@H](C)c3cccc(c3C(=C1C2=O)O)O)O)O)C(=O)N)C.Cl
- Molecular Formula:
- C22H25ClN2O8
- Molecular Weight:
- 480.895
- Log P:
- 0.9981
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 7
- TPSA:
- 181.62
- CAS Number(s):
- 10592-13-9; 24390-14-5; 100929-47-3
Synonym(s)
1.
Doxycycline hydrochloride
2.
Vibra-tabs
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 8 | US FAERS | |
| 2 | Hypersensitivity | FAERS: 6 | US FAERS | |
| 3 | Vomiting | FAERS: 6 | US FAERS | |
| 4 | Dyspepsia | FAERS: 5 | US FAERS | |
| 5 | Burning sensation | FAERS: 4 | US FAERS | |
| 6 | Headache | FAERS: 4 | US FAERS | |
| 7 | Metabolic acidosis | FAERS: 4 | US FAERS | |
| 8 | Oropharyngeal pain | FAERS: 4 | US FAERS | |
| 9 | Hypotension | FAERS: 3 | US FAERS | |
| 10 | Pain | FAERS: 3 | US FAERS | |
| 11 | Throat irritation | FAERS: 3 | US FAERS | |
| 12 | Back Pain | FAERS: 2 | US FAERS | |
| 13 | Candidiasis | FAERS: 2 | US FAERS | |
| 14 | Dizziness | FAERS: 2 | US FAERS | |
| 15 | Drug ineffective | FAERS: 2 | US FAERS | |
| 16 | Dysuria | FAERS: 2 | US FAERS | |
| 17 | Erythema | FAERS: 2 | US FAERS | |
| 18 | Fatigue | FAERS: 2 | US FAERS | |
| 19 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 20 | Foreign body in respiratory tract | FAERS: 2 | US FAERS | |
| 21 | Gingival blister | FAERS: 2 | US FAERS | |
| 22 | Head discomfort | FAERS: 2 | US FAERS | |
| 23 | Malaise | FAERS: 2 | US FAERS | |
| 24 | Oral mucosal exfoliation | FAERS: 2 | US FAERS | |
| 25 | Plasmodium falciparum infection | FAERS: 2 | US FAERS | |
| 26 | Pneumonitis | FAERS: 2 | US FAERS | |
| 27 | Product substitution issue | FAERS: 2 | US FAERS | |
| 28 | Rash erythematous | FAERS: 2 | US FAERS | |
| 29 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 30 | Syncope | FAERS: 2 | US FAERS | |
| 31 | Thirst | FAERS: 2 | US FAERS | |
| 32 | Transaminases increased | FAERS: 2 | US FAERS | |
| 33 | Tremor | FAERS: 2 | US FAERS | |
| 34 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 35 | Vulvovaginal mycotic infection | FAERS: 2 | US FAERS | |
| 36 | Weight decreased | FAERS: 2 | US FAERS | |
| 37 | Anxiety | FAERS: 1 | US FAERS | |
| 38 | Arthralgia | FAERS: 1 | US FAERS | |
| 39 | Asthenia | FAERS: 1 | US FAERS | |
| 40 | Bradycardia | FAERS: 1 | US FAERS | |
| 41 | Chest Pain | FAERS: 1 | US FAERS | |
| 42 | Cleft Palate | FAERS: 1 | US FAERS | |
| 43 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 44 | Completed Suicide | FAERS: 1 | US FAERS | |
| 45 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 46 | Disorientation | FAERS: 1 | US FAERS | |
| 47 | Eructation | FAERS: 1 | US FAERS | |
| 48 | Facial Paresis | FAERS: 1 | US FAERS | |
| 49 | Feeling Cold | FAERS: 1 | US FAERS | |
| 50 | Flatulence | FAERS: 1 | US FAERS | |
| 51 | Myalgia | FAERS: 1 | US FAERS | |
| 52 | Pallor | FAERS: 1 | US FAERS | |
| 53 | Palpitations | FAERS: 1 | US FAERS | |
| 54 | Peritonitis | FAERS: 1 | US FAERS | |
| 55 | Photophobia | FAERS: 1 | US FAERS | |
| 56 | Product quality issue | FAERS: 1 | US FAERS | |
| 57 | Renal pain | FAERS: 1 | US FAERS | |
| 58 | Retching | FAERS: 1 | US FAERS | |
| 59 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 60 | Tachycardia | FAERS: 1 | US FAERS | |
| 61 | Urticaria | FAERS: 1 | US FAERS | |
| 62 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 63 | Visual disturbance | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.