flibanserin
(PPRRDFIXUUSXRA-UHFFFAOYSA-N)
Structure
- SMILES
- O=c1[nH]c2c(n1CCN1CCN(CC1)c1cccc(c1)C(F)(F)F)cccc2
- Type(s)
- Approved; Investigational
- ATC code(s)
- G02CX02
- Molecular Formula:
- C20H21F3N4O
- Molecular Weight:
- 390.402
- Log P:
- 3.1735
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 1
- TPSA:
- 44.27
- CAS Number(s):
- 167933-07-5
Synonym(s)
1.
flibanserin
2.
1-(2-(4-(3-trifluoromethylphenyl)piperazin-1-yl)ethyl)benzimidazol(1H)-2-one
3.
Addyi
4.
BIMT 17
5.
BIMT-17
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Therapeutic response unexpected | FAERS: 13 | US FAERS | |
| 2 | Dizziness | FAERS: 12 | US FAERS | |
| 3 | Drug ineffective | FAERS: 12 | US FAERS | |
| 4 | Product use issue | FAERS: 7 | US FAERS | |
| 5 | Somnolence | FAERS: 7 | US FAERS | |
| 6 | Fatigue | FAERS: 5 | US FAERS | |
| 7 | Drug dose omission | FAERS: 4 | US FAERS | |
| 8 | Hypotension | FAERS: 4 | US FAERS | |
| 9 | Nausea | FAERS: 4 | US FAERS | |
| 10 | Weight decreased | FAERS: 4 | US FAERS | |
| 11 | Accidental exposure to product by child | FAERS: 3 | US FAERS | |
| 12 | Asthenia | FAERS: 3 | US FAERS | |
| 13 | Accidental overdose | FAERS: 2 | US FAERS | |
| 14 | Burning sensation | FAERS: 2 | US FAERS | |
| 15 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 16 | Depressed mood | FAERS: 2 | US FAERS | |
| 17 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 18 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 19 | Headache | FAERS: 2 | US FAERS | |
| 20 | Malaise | FAERS: 2 | US FAERS | |
| 21 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 22 | Anger | FAERS: 1 | US FAERS | |
| 23 | Anxiety | FAERS: 1 | US FAERS | |
| 24 | Ataxia | FAERS: 1 | US FAERS | |
| 25 | Colitis | FAERS: 1 | US FAERS | |
| 26 | Constipation | FAERS: 1 | US FAERS | |
| 27 | Diverticulum | FAERS: 1 | US FAERS | |
| 28 | Drug administration error | FAERS: 1 | US FAERS | |
| 29 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 30 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 31 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 32 | Expired product administered | FAERS: 1 | US FAERS | |
| 33 | Feeling Cold | FAERS: 1 | US FAERS | |
| 34 | Female Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 35 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 36 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 37 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 38 | Lethargy | FAERS: 1 | US FAERS | |
| 39 | Medication Error | FAERS: 1 | US FAERS | |
| 40 | Mental impairment | FAERS: 1 | US FAERS | |
| 41 | Mood swings | FAERS: 1 | US FAERS | |
| 42 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 43 | Myalgia | FAERS: 1 | US FAERS | |
| 44 | Myoclonus | FAERS: 1 | US FAERS | |
| 45 | Negative thoughts | FAERS: 1 | US FAERS | |
| 46 | Nervousness | FAERS: 1 | US FAERS | |
| 47 | No adverse event | FAERS: 1 | US FAERS | |
| 48 | Pain | FAERS: 1 | US FAERS | |
| 49 | Sluggishness | FAERS: 1 | US FAERS | |
| 50 | Swelling | FAERS: 1 | US FAERS | |
| 51 | Syncope | FAERS: 1 | US FAERS | |
| 52 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 53 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 54 | Tremor | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.