rufinamide
(POGQSBRIGCQNEG-UHFFFAOYSA-N)
Structure
- SMILES
- Fc1cccc(c1Cn1nnc(c1)C(=O)N)F
- Type(s)
- Approved
- ATC code(s)
- N03AF03
- Molecular Formula:
- C10H8F2N4O
- Molecular Weight:
- 238.194
- Log P:
- 1.4038
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 1
- TPSA:
- 73.8
- CAS Number(s):
- 106308-44-5
Synonym(s)
1.
rufinamide
2.
1-(2,6-difluorobenzyl)-1H-1,2,3-triazole-4-carboxamide
3.
CGP 33101
4.
CGP-33101
5.
Inovelon
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Somnolence | FAERS: 4 | SIDER US FAERS | |
| 2 | Status Epilepticus | FAERS: 4 | SIDER US FAERS | |
| 3 | Drug ineffective | FAERS: 3 | US FAERS | |
| 4 | Nausea | FAERS: 3 | SIDER US FAERS | |
| 5 | Paranoia | FAERS: 3 | US FAERS | |
| 6 | Pneumonia | FAERS: 3 | SIDER US FAERS | |
| 7 | Tremor | FAERS: 3 | SIDER US FAERS | |
| 8 | Vomiting | FAERS: 3 | SIDER US FAERS | |
| 9 | Agitation | FAERS: 2 | SIDER US FAERS | |
| 10 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 11 | Constipation | FAERS: 2 | SIDER US FAERS | |
| 12 | Discomfort | FAERS: 2 | US FAERS | |
| 13 | Headache | FAERS: 2 | SIDER US FAERS | |
| 14 | Hypersensitivity | FAERS: 2 | SIDER US FAERS | |
| 15 | Lethargy | FAERS: 2 | US FAERS | |
| 16 | Lymphadenopathy | FAERS: 2 | SIDER US FAERS | |
| 17 | Mastication disorder | FAERS: 2 | US FAERS | |
| 18 | Pancreatitis | FAERS: 2 | US FAERS | |
| 19 | Weight decreased | FAERS: 2 | SIDER US FAERS | |
| 20 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 21 | Anger | FAERS: 1 | US FAERS | |
| 22 | Catatonia | FAERS: 1 | US FAERS | |
| 23 | Chromaturia | FAERS: 1 | US FAERS | |
| 24 | Crying | FAERS: 1 | US FAERS | |
| 25 | Drowning | FAERS: 1 | US FAERS | |
| 26 | Drug administration error | FAERS: 1 | US FAERS | |
| 27 | Drug dose omission | FAERS: 1 | US FAERS | |
| 28 | Dysphemia | FAERS: 1 | US FAERS | |
| 29 | Dysuria | FAERS: 1 | SIDER US FAERS | |
| 30 | Eczema | FAERS: 1 | US FAERS | |
| 31 | Epilepsy | FAERS: 1 | SIDER US FAERS | |
| 32 | Eye irritation | FAERS: 1 | US FAERS | |
| 33 | Flushing | FAERS: 1 | US FAERS | |
| 34 | Hypotension | FAERS: 1 | US FAERS | |
| 35 | Incontinence | FAERS: 1 | SIDER US FAERS | |
| 36 | Leukopenia | FAERS: 1 | SIDER US FAERS | |
| 37 | Mental status changes | FAERS: 1 | US FAERS | |
| 38 | Middle insomnia | FAERS: 1 | US FAERS | |
| 39 | Mydriasis | FAERS: 1 | US FAERS | |
| 40 | Myoclonus | FAERS: 1 | US FAERS | |
| 41 | No adverse event | FAERS: 1 | US FAERS | |
| 42 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 43 | Pain | FAERS: 1 | US FAERS | |
| 44 | Product quality issue | FAERS: 1 | US FAERS | |
| 45 | Sinusitis | FAERS: 1 | SIDER US FAERS | |
| 46 | Stridor | FAERS: 1 | US FAERS | |
| 47 | Unevaluable event | FAERS: 1 | US FAERS | |
| 48 | Urinary Incontinence | FAERS: 1 | SIDER US FAERS | |
| 49 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 50 | Wheezing | FAERS: 1 | US FAERS | |
| 51 | Acne | SIDER | ||
| 52 | Anorexia | SIDER | ||
| 53 | Anxiety | SIDER | ||
| 54 | Asthenia | SIDER | ||
| 55 | Ataxia | SIDER | ||
| 56 | Back Pain | SIDER | ||
| 57 | Blood and lymphatic system disorders | SIDER | ||
| 58 | Bronchitis | SIDER | ||
| 59 | Dermatitis | SIDER | ||
| 60 | Diplopia | SIDER | ||
| 61 | Dizziness | SIDER | ||
| 62 | Dyspepsia | SIDER | ||
| 63 | Ear and labyrinth disorders | SIDER | ||
| 64 | Enuresis | SIDER | ||
| 65 | Epistaxis | SIDER | ||
| 66 | Fatigue | SIDER | ||
| 67 | Infection | SIDER | ||
| 68 | Infestation | SIDER | ||
| 69 | Influenza | SIDER | ||
| 70 | Malnutrition | SIDER | ||
| 71 | Nasopharyngitis | SIDER | ||
| 72 | Nephrolithiasis | SIDER | ||
| 73 | Neutropenia | SIDER | ||
| 74 | Nocturia | SIDER | ||
| 75 | Nystagmus | SIDER | ||
| 76 | Polyuria | SIDER | ||
| 77 | Pruritus | SIDER | ||
| 78 | Rhinitis | SIDER | ||
| 79 | Seizures | 18503564 | CTD | |
| 80 | Suicide attempt | Canada Vigilance: 1 | Canada Vigilance | |
| 81 | Thrombocytopenia | SIDER | ||
| 82 | Urine output increased | SIDER | ||
| 83 | Vertigo | SIDER | ||
| 84 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.