Carnitine
(PHIQHXFUZVPYII-ZCFIWIBFSA-N)
Structure
- SMILES
- O[C@@H](C[N+](C)(C)C)CC(=O)[O-]
- Type(s)
- Approved; Investigational
- ATC code(s)
- A16AA01
- Molecular Formula:
- C7H15NO3
- Molecular Weight:
- 161.199
- Log P:
- -1.8065
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 60.36
- CAS Number(s):
- 541-15-1; 44985-71-9
Synonym(s)
1.
Carnitine
2.
Bicarnesine
3.
L-Carnitine
4.
Levocarnitine
5.
Vitamin BT
6.
L Carnitine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 2 | Nausea | FAERS: 3 | US FAERS | |
| 3 | Product substitution issue | FAERS: 3 | US FAERS | |
| 4 | Rhabdomyolysis | FAERS: 3 | US FAERS | |
| 5 | Blood pressure immeasurable | FAERS: 2 | US FAERS | |
| 6 | Drug ineffective | FAERS: 2 | US FAERS | |
| 7 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 8 | Hypophagia | FAERS: 2 | US FAERS | |
| 9 | Malabsorption | FAERS: 2 | US FAERS | |
| 10 | Malaise | FAERS: 2 | US FAERS | |
| 11 | Medication Error | FAERS: 2 | US FAERS | |
| 12 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 13 | Product quality issue | FAERS: 2 | US FAERS | |
| 14 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 15 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 16 | Adverse event | FAERS: 1 | US FAERS | |
| 17 | Agitation | FAERS: 1 | US FAERS | |
| 18 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 19 | Ammonia abnormal | FAERS: 1 | US FAERS | |
| 20 | Amnesia | FAERS: 1 | US FAERS | |
| 21 | Amylase increased | FAERS: 1 | US FAERS | |
| 22 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 23 | Arthralgia | FAERS: 1 | US FAERS | |
| 24 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 25 | Blood creatine phosphokinase abnormal | FAERS: 1 | US FAERS | |
| 26 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 27 | Carotid pulse abnormal | FAERS: 1 | US FAERS | |
| 28 | Chills | FAERS: 1 | US FAERS | |
| 29 | Cholestasis | FAERS: 1 | US FAERS | |
| 30 | Drug resistance | FAERS: 1 | US FAERS | |
| 31 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 32 | Emotional distress | FAERS: 1 | US FAERS | |
| 33 | Fatigue | FAERS: 1 | US FAERS | |
| 34 | Flushing | FAERS: 1 | US FAERS | |
| 35 | Frustration | FAERS: 1 | US FAERS | |
| 36 | Headache | FAERS: 1 | US FAERS | |
| 37 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 38 | Inflammation | FAERS: 1 | US FAERS | |
| 39 | Infusion Site Extravasation | FAERS: 1 | US FAERS | |
| 40 | Injection site granuloma | FAERS: 1 | US FAERS | |
| 41 | Laceration | FAERS: 1 | US FAERS | |
| 42 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 43 | Mental status changes | FAERS: 1 | US FAERS | |
| 44 | Metastasis | FAERS: 1 | US FAERS | |
| 45 | Multiple System Atrophy | FAERS: 1 | US FAERS | |
| 46 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 47 | Myoclonic Epilepsy | FAERS: 1 | US FAERS | |
| 48 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 49 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 50 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 51 | Pancreatitis | FAERS: 1 | US FAERS | |
| 52 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 53 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 54 | Retching | FAERS: 1 | US FAERS | |
| 55 | Schizophrenia | FAERS: 1 | US FAERS | |
| 56 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 57 | Somnolence | FAERS: 1 | US FAERS | |
| 58 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 59 | Sudden death | FAERS: 1 | US FAERS | |
| 60 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 61 | Urine leukocyte esterase positive | FAERS: 1 | US FAERS | |
| 62 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 63 | Vomiting | FAERS: 1 | US FAERS | |
| 64 | Weight decreased | FAERS: 1 | US FAERS | |
| 65 | furuncle | FAERS: 1 | US FAERS | |
| 66 | jaundice | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.