cangrelor
(PAEBIVWUMLRPSK-IDTAVKCVSA-N)
Structure
- SMILES
- CSCCNc1nc(SCCC(F)(F)F)nc2c1ncn2[C@@H]1O[C@@H]([C@H]([C@H]1O)O)COP(=O)(OP(=O)(C(P(=O)(O)O)(Cl)Cl)O)O
- Type(s)
- Approved
- ATC code(s)
- B01AC25
- Molecular Formula:
- C17H25Cl2F3N5O12P3S2
- Molecular Weight:
- 776.359
- Log P:
- 2.9235
- Hydrogen Bond Acceptor:
- 19
- Hydrogen Bond Donor:
- 7
- TPSA:
- 335.94
- CAS Number(s):
- 163706-06-7
Synonym(s)
1.
cangrelor
2.
AR C69931MX
3.
AR-C69931MX
4.
Kengreal
5.
N(6)-(2-methylthioethyl)-2-(3,3,3-trifluoropropylthio)-5'-adenylic acid monoanhydride with dichloromethylenebis(phosphonic acid)
6.
cangrelor tetrasodium
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | No adverse event | FAERS: 6 | US FAERS | |
| 2 | Vascular stent thrombosis | FAERS: 5 | US FAERS | |
| 3 | Hypotension | FAERS: 4 | US FAERS | |
| 4 | Product preparation error | FAERS: 4 | US FAERS | |
| 5 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 6 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 7 | Bradycardia | FAERS: 2 | US FAERS | |
| 8 | Product quality issue | FAERS: 2 | US FAERS | |
| 9 | Anxiety | FAERS: 1 | US FAERS | |
| 10 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 11 | Cerebral hypoperfusion | FAERS: 1 | US FAERS | |
| 12 | Chest Pain | FAERS: 1 | US FAERS | |
| 13 | Drug ineffective | FAERS: 1 | US FAERS | |
| 14 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 15 | Infusion Site Extravasation | FAERS: 1 | US FAERS | |
| 16 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 17 | Overdose | FAERS: 1 | US FAERS | |
| 18 | Rash erythematous | FAERS: 1 | US FAERS | |
| 19 | Respiratory distress | FAERS: 1 | US FAERS | |
| 20 | Sepsis | FAERS: 1 | US FAERS | |
| 21 | Shock | FAERS: 1 | US FAERS | |
| 22 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 23 | Urticaria | FAERS: 1 | US FAERS | |
| 24 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 25 | Brain Infarction | 18974869 | CTD | |
| 26 | Thrombosis | 12606772 17334511 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.