Phenylephrine
(OCYSGIYOVXAGKQ-FVGYRXGTSA-N)
Structure
- SMILES
- CNC[C@@H](c1cccc(c1)O)O.Cl
- Molecular Formula:
- C9H14ClNO2
- Molecular Weight:
- 203.666
- Log P:
- 1.8379
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 4
- TPSA:
- 52.49
- CAS Number(s):
- 61-76-7
Synonym(s)
1.
Phenylephrine
2.
(R)-3-Hydroxy-alpha-((methylamino)methyl)benzenemethanol
3.
Metaoxedrin
4.
Metasympatol
5.
Mezaton
6.
Neo-Synephrine
7.
Neosynephrine
8.
Phenylephrine Hydrochloride
9.
Phenylephrine Tannate
10.
Neo Synephrine
11.
Tannate, Phenylephrine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug Dependence | FAERS: 48 | US FAERS | |
| 2 | Incorrect drug administration duration | FAERS: 30 | US FAERS | |
| 3 | Overdose | FAERS: 14 | US FAERS | |
| 4 | Headache | FAERS: 8 | US FAERS | |
| 5 | Incorrect dose administered | FAERS: 8 | US FAERS | |
| 6 | Medication Error | FAERS: 8 | US FAERS | |
| 7 | Mydriasis | FAERS: 8 | US FAERS | |
| 8 | Bradycardia | FAERS: 7 | US FAERS | |
| 9 | Rebound effect | FAERS: 6 | US FAERS | |
| 10 | Cardiac Arrest | FAERS: 5 | US FAERS | |
| 11 | Drug ineffective | FAERS: 5 | US FAERS | |
| 12 | Inappropriate schedule of drug administration | FAERS: 5 | US FAERS | |
| 13 | Chest Pain | FAERS: 4 | US FAERS | |
| 14 | Circumstance or information capable of leading to medication error | FAERS: 4 | US FAERS | |
| 15 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 16 | Therapeutic response unexpected | FAERS: 4 | US FAERS | |
| 17 | Urticaria | FAERS: 4 | US FAERS | |
| 18 | Wrong technique in drug usage process | FAERS: 4 | US FAERS | |
| 19 | Accidental exposure | FAERS: 3 | US FAERS | |
| 20 | Asthma | FAERS: 3 | US FAERS | |
| 21 | Bronchitis | FAERS: 3 | US FAERS | |
| 22 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 23 | Dependence | FAERS: 3 | US FAERS | |
| 24 | Dizziness | FAERS: 3 | US FAERS | |
| 25 | Epistaxis | FAERS: 3 | US FAERS | |
| 26 | Vasospasm | FAERS: 3 | US FAERS | |
| 27 | Wrong drug administered | FAERS: 3 | US FAERS | |
| 28 | Acute myocardial infarction | FAERS: 2 | US FAERS | |
| 29 | Anxiety | FAERS: 2 | US FAERS | |
| 30 | Aphasia | FAERS: 2 | US FAERS | |
| 31 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 32 | Choking sensation | FAERS: 2 | US FAERS | |
| 33 | Drug administration error | FAERS: 2 | US FAERS | |
| 34 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 35 | Hypotension | FAERS: 2 | US FAERS | |
| 36 | Lip swelling | FAERS: 2 | US FAERS | |
| 37 | Mouth Breathing | FAERS: 2 | US FAERS | |
| 38 | Nasal Polyps | FAERS: 2 | US FAERS | |
| 39 | Palpitations | FAERS: 2 | US FAERS | |
| 40 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 41 | Post procedural complication | FAERS: 2 | US FAERS | |
| 42 | Tachycardia | FAERS: 2 | US FAERS | |
| 43 | Uterine Polyp | FAERS: 2 | US FAERS | |
| 44 | Accidental exposure to product packaging | FAERS: 1 | US FAERS | |
| 45 | Accidental overdose | FAERS: 1 | US FAERS | |
| 46 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 47 | Apparent death | FAERS: 1 | US FAERS | |
| 48 | Asphyxia | FAERS: 1 | US FAERS | |
| 49 | Asterixis | FAERS: 1 | US FAERS | |
| 50 | Asthenia | FAERS: 1 | US FAERS | |
| 51 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 52 | Auricular swelling | FAERS: 1 | US FAERS | |
| 53 | Blighted ovum | FAERS: 1 | US FAERS | |
| 54 | Cartilage injury | FAERS: 1 | US FAERS | |
| 55 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 56 | Cerebral vasoconstriction | FAERS: 1 | US FAERS | |
| 57 | Cyanosis | FAERS: 1 | US FAERS | |
| 58 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 59 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 60 | Disorientation | FAERS: 1 | US FAERS | |
| 61 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 62 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 63 | Dysarthria | FAERS: 1 | US FAERS | |
| 64 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 65 | Eye irritation | FAERS: 1 | US FAERS | |
| 66 | Fatigue | FAERS: 1 | US FAERS | |
| 67 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 68 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 69 | Hemiparesis | FAERS: 1 | US FAERS | |
| 70 | Hypertensive emergency | FAERS: 1 | US FAERS | |
| 71 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 72 | Impaired work ability | FAERS: 1 | US FAERS | |
| 73 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 74 | Interventional procedure | FAERS: 1 | US FAERS | |
| 75 | Lethargy | FAERS: 1 | US FAERS | |
| 76 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 77 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 78 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 79 | Nausea | FAERS: 1 | US FAERS | |
| 80 | Neck Pain | FAERS: 1 | US FAERS | |
| 81 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 82 | Nervousness | FAERS: 1 | US FAERS | |
| 83 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 84 | Post lumbar puncture syndrome | FAERS: 1 | US FAERS | |
| 85 | Presyncope | FAERS: 1 | US FAERS | |
| 86 | Product container issue | FAERS: 1 | US FAERS | |
| 87 | Product label confusion | FAERS: 1 | US FAERS | |
| 88 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 89 | Product quality issue | FAERS: 1 | US FAERS | |
| 90 | Pruritus | FAERS: 1 | US FAERS | |
| 91 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 92 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 93 | Somnolence | FAERS: 1 | US FAERS | |
| 94 | Stress | FAERS: 1 | US FAERS | |
| 95 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 96 | Tremor | FAERS: 1 | US FAERS | |
| 97 | Troponin increased | FAERS: 1 | US FAERS | |
| 98 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 99 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 100 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 101 | Visual Impairment | FAERS: 1 | US FAERS | |
| 102 | Vomiting | FAERS: 1 | US FAERS | |
| 103 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 104 | Conjunctivitis | Canada Vigilance: 1 | Canada Vigilance | |
| 105 | Skin reaction | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.