emtricitabine tenofovir alafenamide
(NEPFAYPIICYVCG-CFISUTRVSA-N)
Structure
- SMILES
- Nc1nc(=O)n(cc1F)[C@@H]1CS[C@@H](O1)CO.C[C@H](Cn1cnc2c1ncnc2N)OC[P@@](=O)(N[C@H](C(=O)OC(C)C)C)Oc1ccccc1
- Molecular Formula:
- C29H39FN9O8PS
- Molecular Weight:
- 723.713
- Log P:
- 4.0712
- Hydrogen Bond Acceptor:
- 18
- Hydrogen Bond Donor:
- 4
- TPSA:
- 268.96
- CAS Number(s):
- 731772-56-8
Synonym(s)
1.
emtricitabine tenofovir alafenamide
2.
Descovy
3.
emtricitabine tenofovir alafenamide drug combination
External Link(s)
| MeSH | C000613801 |
| PubChem Compound | 90469070 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug dose omission | FAERS: 14 | US FAERS | |
| 2 | Nausea | FAERS: 13 | US FAERS | |
| 3 | Fatigue | FAERS: 12 | US FAERS | |
| 4 | Headache | FAERS: 11 | US FAERS | |
| 5 | Wrong technique in product usage process | FAERS: 9 | US FAERS | |
| 6 | Vomiting | FAERS: 7 | US FAERS | |
| 7 | Product dose omission | FAERS: 6 | US FAERS | |
| 8 | Feeling abnormal | FAERS: 5 | US FAERS | |
| 9 | Therapy cessation | FAERS: 5 | US FAERS | |
| 10 | Chest Pain | FAERS: 4 | US FAERS | |
| 11 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 12 | Gastrostomy | FAERS: 4 | US FAERS | |
| 13 | Insurance issue | FAERS: 4 | US FAERS | |
| 14 | Pneumonia | FAERS: 4 | US FAERS | |
| 15 | Product storage error | FAERS: 4 | US FAERS | |
| 16 | Product use issue | FAERS: 4 | US FAERS | |
| 17 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 18 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 19 | Alopecia | FAERS: 3 | US FAERS | |
| 20 | Intentional dose omission | FAERS: 3 | US FAERS | |
| 21 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 22 | Malaise | FAERS: 3 | US FAERS | |
| 23 | Mechanical ventilation | FAERS: 3 | US FAERS | |
| 24 | Myalgia | FAERS: 3 | US FAERS | |
| 25 | Unevaluable event | FAERS: 3 | US FAERS | |
| 26 | Anxiety | FAERS: 2 | US FAERS | |
| 27 | Arthralgia | FAERS: 2 | US FAERS | |
| 28 | Asthenia | FAERS: 2 | US FAERS | |
| 29 | Blood HIV RNA increased | FAERS: 2 | US FAERS | |
| 30 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 31 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 32 | Bone pain | FAERS: 2 | US FAERS | |
| 33 | Critical Illness | FAERS: 2 | US FAERS | |
| 34 | Depressed mood | FAERS: 2 | US FAERS | |
| 35 | Drug resistance | FAERS: 2 | US FAERS | |
| 36 | Eczema | FAERS: 2 | US FAERS | |
| 37 | Fracture | FAERS: 2 | US FAERS | |
| 38 | Inability to afford medication | FAERS: 2 | US FAERS | |
| 39 | Lethargy | FAERS: 2 | US FAERS | |
| 40 | Memory impairment | FAERS: 2 | US FAERS | |
| 41 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 42 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 43 | Night sweats | FAERS: 2 | US FAERS | |
| 44 | Pain | FAERS: 2 | US FAERS | |
| 45 | Palpitations | FAERS: 2 | US FAERS | |
| 46 | Product packaging quantity issue | FAERS: 2 | US FAERS | |
| 47 | Product physical issue | FAERS: 2 | US FAERS | |
| 48 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 49 | Sepsis | FAERS: 2 | US FAERS | |
| 50 | Suicide attempt | FAERS: 2 | US FAERS | |
| 51 | Suspected counterfeit product | FAERS: 2 | US FAERS | |
| 52 | Tinnitus | FAERS: 2 | US FAERS | |
| 53 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 54 | Acidosis | FAERS: 1 | US FAERS | |
| 55 | Acne | FAERS: 1 | US FAERS | |
| 56 | Acquired Immunodeficiency Syndrome | FAERS: 1 | US FAERS | |
| 57 | Angioedema | FAERS: 1 | US FAERS | |
| 58 | Autoscopy | FAERS: 1 | US FAERS | |
| 59 | Back Pain | FAERS: 1 | US FAERS | |
| 60 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 61 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 62 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 63 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 64 | Bronchitis | FAERS: 1 | US FAERS | |
| 65 | CD4 Lymphocytes Decreased | FAERS: 1 | US FAERS | |
| 66 | CD4 lymphocytes increased | FAERS: 1 | US FAERS | |
| 67 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 68 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 69 | Constipation | FAERS: 1 | US FAERS | |
| 70 | Disease Progression | FAERS: 1 | US FAERS | |
| 71 | Dissociation | FAERS: 1 | US FAERS | |
| 72 | Dizziness | FAERS: 1 | US FAERS | |
| 73 | Drug abuse | FAERS: 1 | US FAERS | |
| 74 | Dry skin | FAERS: 1 | US FAERS | |
| 75 | Dysgeusia | FAERS: 1 | US FAERS | |
| 76 | Dysphonia | FAERS: 1 | US FAERS | |
| 77 | Economic problem | FAERS: 1 | US FAERS | |
| 78 | Epistaxis | FAERS: 1 | US FAERS | |
| 79 | Epstein-Barr virus test positive | FAERS: 1 | US FAERS | |
| 80 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 81 | Eructation | FAERS: 1 | US FAERS | |
| 82 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 83 | Feeling jittery | FAERS: 1 | US FAERS | |
| 84 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 85 | Gout | FAERS: 1 | US FAERS | |
| 86 | Hodgkin's disease mixed cellularity stage II supradiaphragmatic | FAERS: 1 | US FAERS | |
| 87 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 88 | Immunosuppression | FAERS: 1 | US FAERS | |
| 89 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 90 | Infection | FAERS: 1 | US FAERS | |
| 91 | Influenza | FAERS: 1 | US FAERS | |
| 92 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 93 | Joint swelling | FAERS: 1 | US FAERS | |
| 94 | Lip swelling | FAERS: 1 | US FAERS | |
| 95 | Lipohypertrophy | FAERS: 1 | US FAERS | |
| 96 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 97 | Lumbar radiculopathy | FAERS: 1 | US FAERS | |
| 98 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 99 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 100 | Mental impairment | FAERS: 1 | US FAERS | |
| 101 | Middle insomnia | FAERS: 1 | US FAERS | |
| 102 | Mitochondrial toxicity | FAERS: 1 | US FAERS | |
| 103 | Multimorbidity | FAERS: 1 | US FAERS | |
| 104 | No adverse event | FAERS: 1 | US FAERS | |
| 105 | Obesity | FAERS: 1 | US FAERS | |
| 106 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 107 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 108 | Penile size reduced | FAERS: 1 | US FAERS | |
| 109 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 110 | Product blister packaging issue | FAERS: 1 | US FAERS | |
| 111 | Product coating issue | FAERS: 1 | US FAERS | |
| 112 | Product dispensing error | FAERS: 1 | US FAERS | |
| 113 | Product distribution issue | FAERS: 1 | US FAERS | |
| 114 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 115 | Product lot number issue | FAERS: 1 | US FAERS | |
| 116 | Product packaging counterfeit | FAERS: 1 | US FAERS | |
| 117 | Product quality issue | FAERS: 1 | US FAERS | |
| 118 | Product substitution issue | FAERS: 1 | US FAERS | |
| 119 | Product use complaint | FAERS: 1 | US FAERS | |
| 120 | Proteinuria | FAERS: 1 | US FAERS | |
| 121 | Pruritus | FAERS: 1 | US FAERS | |
| 122 | Renal aneurysm | FAERS: 1 | US FAERS | |
| 123 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 124 | Restlessness | FAERS: 1 | US FAERS | |
| 125 | Rhinovirus infection | FAERS: 1 | US FAERS | |
| 126 | Secretion discharge | FAERS: 1 | US FAERS | |
| 127 | Skin Erosion | FAERS: 1 | US FAERS | |
| 128 | Skin irritation | FAERS: 1 | US FAERS | |
| 129 | Sluggishness | FAERS: 1 | US FAERS | |
| 130 | Swelling | FAERS: 1 | US FAERS | |
| 131 | T-lymphocyte count abnormal | FAERS: 1 | US FAERS | |
| 132 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 133 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 134 | Thrombosis | FAERS: 1 | US FAERS | |
| 135 | Tremor | FAERS: 1 | US FAERS | |
| 136 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 137 | Urinary Retention | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 138 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 139 | Urticaria | FAERS: 1 | US FAERS | |
| 140 | Vertigo | FAERS: 1 | US FAERS | |
| 141 | Viral load increased | FAERS: 1 | US FAERS | |
| 142 | Virologic failure | FAERS: 1 | US FAERS | |
| 143 | Weight decreased | FAERS: 1 | US FAERS | |
| 144 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120240
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.