Ropivacaine
(NDNSIBYYUOEUSV-RSAXXLAASA-N)
Structure
- SMILES
- CCCN1CCCC[C@H]1C(=O)Nc1c(C)cccc1C.Cl
- Molecular Formula:
- C17H27ClN2O
- Molecular Weight:
- 310.862
- Log P:
- 4.3193
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 2
- TPSA:
- 32.34
- CAS Number(s):
- 98717-15-8; 132112-35-7
Synonym(s)
1.
Ropivacaine
2.
1-Propyl-2',6'-pipecoloxylidide
3.
AL 381
4.
AL-381
5.
LEA 103
6.
LEA-103
7.
Naropeine
8.
Naropin
9.
Ropivacaine Hydrochloride
10.
Ropivacaine Monohydrochloride
11.
Ropivacaine Monohydrochloride, (S)-isomer
12.
1 Propyl 2',6' pipecoloxylidide
13.
AL381
14.
LEA103
External Link(s)
| MeSH | D000077212 |
| PubChem Compound | 175804 46856340 53262295 |
| ChEBI | 60803 |
| CHEMBL | CHEMBL1889140 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Incorrect dose administered | FAERS: 21 | US FAERS | |
| 2 | Suspected product quality issue | FAERS: 20 | US FAERS | |
| 3 | Therapeutic product effect prolonged | FAERS: 20 | US FAERS | |
| 4 | Arthropathy | FAERS: 18 | US FAERS | |
| 5 | Toxicity to various agents | FAERS: 7 | US FAERS | |
| 6 | Bradycardia | FAERS: 5 | US FAERS | |
| 7 | Sinus Tachycardia | FAERS: 5 | US FAERS | |
| 8 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 9 | Chest Pain | FAERS: 4 | US FAERS | |
| 10 | Drug ineffective | FAERS: 4 | US FAERS | |
| 11 | Paresis | FAERS: 4 | US FAERS | |
| 12 | Tachycardia | FAERS: 4 | US FAERS | |
| 13 | Diplegia | FAERS: 3 | US FAERS | |
| 14 | Pain | FAERS: 3 | US FAERS | |
| 15 | Phrenic nerve paralysis | FAERS: 3 | US FAERS | |
| 16 | Respiratory distress | FAERS: 3 | US FAERS | |
| 17 | Aphonia | FAERS: 2 | US FAERS | |
| 18 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 19 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 20 | Headache | FAERS: 2 | US FAERS | |
| 21 | Hypercapnia | FAERS: 2 | US FAERS | |
| 22 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 23 | Medication Error | FAERS: 2 | US FAERS | |
| 24 | Overdose | FAERS: 2 | US FAERS | |
| 25 | Stridor | FAERS: 2 | US FAERS | |
| 26 | Amaurosis | FAERS: 1 | US FAERS | |
| 27 | Amputation | FAERS: 1 | US FAERS | |
| 28 | Apathy | FAERS: 1 | US FAERS | |
| 29 | Asthenia | FAERS: 1 | US FAERS | |
| 30 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 31 | Chest discomfort | FAERS: 1 | US FAERS | |
| 32 | Cyanosis | FAERS: 1 | US FAERS | |
| 33 | Disorientation | FAERS: 1 | US FAERS | |
| 34 | Dizziness | FAERS: 1 | US FAERS | |
| 35 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 36 | Drug level above therapeutic | FAERS: 1 | US FAERS | |
| 37 | Drug toxicity | FAERS: 1 | US FAERS | |
| 38 | Hemiplegia | FAERS: 1 | US FAERS | |
| 39 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 40 | Maternal exposure during delivery | FAERS: 1 | US FAERS | |
| 41 | Monoparesis | FAERS: 1 | US FAERS | |
| 42 | Monoplegia | FAERS: 1 | US FAERS | |
| 43 | Muscle tightness | FAERS: 1 | US FAERS | |
| 44 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 45 | Nausea | FAERS: 1 | US FAERS | |
| 46 | Nerve Block | FAERS: 1 | US FAERS | |
| 47 | Pallor | FAERS: 1 | US FAERS | |
| 48 | Paraparesis | FAERS: 1 | US FAERS | |
| 49 | Peripheral motor neuropathy | FAERS: 1 | US FAERS | |
| 50 | Peripheral nerve palsy | FAERS: 1 | US FAERS | |
| 51 | Physical product label issue | FAERS: 1 | US FAERS | |
| 52 | Product compounding quality issue | FAERS: 1 | US FAERS | |
| 53 | Product quality issue | FAERS: 1 | US FAERS | |
| 54 | Pruritus | FAERS: 1 | US FAERS | |
| 55 | Quadriparesis | FAERS: 1 | US FAERS | |
| 56 | Radiculopathy | FAERS: 1 | US FAERS | |
| 57 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 58 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 59 | Restlessness | FAERS: 1 | US FAERS | |
| 60 | Sensorimotor disorder | FAERS: 1 | US FAERS | |
| 61 | Shock | FAERS: 1 | US FAERS | |
| 62 | Somnolence | FAERS: 1 | US FAERS | |
| 63 | Tremor | FAERS: 1 | US FAERS | |
| 64 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 65 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 66 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 67 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120240
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.