Cefoperazone
(NCFTXMQPRQZFMZ-WERGMSTESA-M)
Structure
- SMILES
- CCN1CCN(C(=O)C1=O)C(=O)N[C@H](c1ccc(cc1)O)C(=O)N[C@@H]1C(=O)N2[C@@H]1SCC(=C2C(=O)[O-])CSc1nnnn1C.[Na+]
- Molecular Formula:
- C25H26N9NaO8S2
- Molecular Weight:
- 667.649
- Log P:
- -1.8512
- Hydrogen Bond Acceptor:
- 19
- Hydrogen Bond Donor:
- 3
- TPSA:
- 273.69
- CAS Number(s):
- 62893-20-3; 1094606-34-4
Synonym(s)
1.
Cefoperazone
2.
Cefobid
3.
Cefoperazon
4.
Cefoperazone Sodium
5.
Cefoperazone Sodium Salt
6.
Céfobis
7.
T-1551
8.
T1551
9.
Salt, Cefoperazone Sodium
10.
Sodium Salt, Cefoperazone
11.
Sodium, Cefoperazone
12.
T 1551
External Link(s)
| MeSH | D002438 |
| PubChem Compound | 23663974 101593081 |
| ChEBI | 3494 |
| CHEMBL | CHEMBL1200482 |
| KEGG | cpd:C08112 dr:D00918 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Anaphylactic shock | FAERS: 18 | US FAERS | |
| 2 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 3 | Pruritus | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Asthma | FAERS: 2 | US FAERS | |
| 5 | Chills | FAERS: 2 | US FAERS | |
| 6 | Cyanosis | FAERS: 2 | US FAERS | |
| 7 | Erythema | FAERS: 2 | US FAERS | |
| 8 | Medication Error | FAERS: 2 | US FAERS | |
| 9 | Palpitations | FAERS: 2 | US FAERS | |
| 10 | Psychiatric symptom | FAERS: 2 | US FAERS | |
| 11 | Shock | FAERS: 2 | US FAERS | |
| 12 | Syncope | FAERS: 2 | US FAERS | |
| 13 | Tetany | FAERS: 2 | US FAERS | |
| 14 | Vomiting | FAERS: 2 | US FAERS | |
| 15 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 16 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 17 | Alcohol Intolerance | FAERS: 1 | US FAERS | |
| 18 | Asthenia | FAERS: 1 | US FAERS | |
| 19 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 20 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 21 | Blood urea increased | FAERS: 1 | US FAERS | |
| 22 | Chest Pain | FAERS: 1 | US FAERS | |
| 23 | Chest discomfort | FAERS: 1 | US FAERS | |
| 24 | Cold sweat | FAERS: 1 | US FAERS | |
| 25 | Dizziness | FAERS: 1 | US FAERS | |
| 26 | Epidermolysis Bullosa | FAERS: 1 | US FAERS | |
| 27 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 28 | Flushing | FAERS: 1 | US FAERS | |
| 29 | Gaze palsy | FAERS: 1 | US FAERS | |
| 30 | Headache | FAERS: 1 | US FAERS | |
| 31 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 32 | Hypotension | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Inflammation | FAERS: 1 | US FAERS | |
| 34 | Iritis | FAERS: 1 | US FAERS | |
| 35 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 36 | Lip swelling | FAERS: 1 | US FAERS | |
| 37 | Lymphocyte percentage increased | FAERS: 1 | US FAERS | |
| 38 | Monocyte percentage increased | FAERS: 1 | US FAERS | |
| 39 | Nausea | FAERS: 1 | US FAERS | |
| 40 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 41 | Pallor | FAERS: 1 | US FAERS | |
| 42 | Papule | FAERS: 1 | US FAERS | |
| 43 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 44 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 45 | Product use issue | FAERS: 1 | US FAERS | |
| 46 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 47 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 48 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 49 | Sudden death | FAERS: 1 | US FAERS | |
| 50 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 51 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 52 | Vitamin K Deficiency | FAERS: 1 | US FAERS | |
| 53 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 54 | Anaphylactoid Reaction | Canada Vigilance: 1 | Canada Vigilance | |
| 55 | Tachycardia | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.