Dantrolene
(KSRLIXGNPXAZHD-HAZZGOGXSA-M)
Structure
- SMILES
- [O-]C1=NC(=O)N(C1)/N=C/c1ccc(o1)c1ccc(cc1)[N+](=O)[O-].[Na+]
- Molecular Formula:
- C14H9N4NaO5
- Molecular Weight:
- 336.235
- Log P:
- 2.3500
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 0
- TPSA:
- 127.05
- CAS Number(s):
- 14663-23-1; 24868-20-0
Synonym(s)
1.
Dantrolene
2.
Dantrium
3.
Dantrolene Sodium
4.
Sodium, Dantrolene
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Product use issue | FAERS: 8 | US FAERS | |
| 2 | Respiratory Failure | FAERS: 6 | US FAERS | |
| 3 | Infusion Site Extravasation | FAERS: 4 | US FAERS | |
| 4 | Drug ineffective | FAERS: 3 | US FAERS | |
| 5 | Nausea | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 6 | Pneumonia | FAERS: 3 | US FAERS | |
| 7 | Acute myocardial infarction | FAERS: 2 | US FAERS | |
| 8 | Acute respiratory failure | FAERS: 2 | US FAERS | |
| 9 | Asthenia | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 10 | Drug dose omission | FAERS: 2 | US FAERS | |
| 11 | Fibrosis | FAERS: 2 | US FAERS | |
| 12 | Injection site extravasation | FAERS: 2 | US FAERS | |
| 13 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 14 | Pneumothorax | FAERS: 2 | US FAERS | |
| 15 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 16 | Vomiting | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 17 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 18 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 19 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 20 | Asthma | FAERS: 1 | US FAERS | |
| 21 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 22 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 23 | Bradycardia | FAERS: 1 | US FAERS | |
| 24 | Burning sensation | FAERS: 1 | US FAERS | |
| 25 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 26 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 27 | Dehydration | FAERS: 1 | US FAERS | |
| 28 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 29 | Disease Progression | FAERS: 1 | US FAERS | |
| 30 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 31 | Dizziness | FAERS: 1 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 32 | Drooling | FAERS: 1 | US FAERS | |
| 33 | Enterocolitis | FAERS: 1 | US FAERS | |
| 34 | Epilepsy | FAERS: 1 | US FAERS | |
| 35 | Erythema | FAERS: 1 | US FAERS | |
| 36 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 37 | Hirsutism | FAERS: 1 | US FAERS | |
| 38 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 39 | Intestinal adenocarcinoma | FAERS: 1 | US FAERS | |
| 40 | Leukopenia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Obesity | FAERS: 1 | US FAERS | |
| 42 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 43 | Overdose | FAERS: 1 | US FAERS | |
| 44 | Product preparation error | FAERS: 1 | US FAERS | |
| 45 | Product quality issue | FAERS: 1 | US FAERS | |
| 46 | Respiratory distress | FAERS: 1 | US FAERS | |
| 47 | Respiratory muscle weakness | FAERS: 1 | US FAERS | |
| 48 | Shock | FAERS: 1 | US FAERS | |
| 49 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 50 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 51 | Thrombocytopenia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | furuncle | FAERS: 1 | US FAERS | |
| 53 | Acne | Canada Vigilance: 1 | Canada Vigilance | |
| 54 | Bilirubinuria | Canada Vigilance: 1 | Canada Vigilance | |
| 55 | Blood folate abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 56 | Diplopia | Canada Vigilance: 1 | Canada Vigilance | |
| 57 | Euphoric mood | Canada Vigilance: 1 | Canada Vigilance | |
| 58 | Tinnitus | Canada Vigilance: 1 | Canada Vigilance | |
| 59 | jaundice | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.