lofexidine
(KSMAGQUYOIHWFS-UHFFFAOYSA-N)
Structure
- SMILES
- CC(C1=NCCN1)Oc1c(Cl)cccc1Cl
- Type(s)
- Approved; Investigational
- ATC code(s)
- N07BC04
- Molecular Formula:
- C11H12Cl2N2O
- Molecular Weight:
- 259.132
- Log P:
- 2.5268
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 33.62
- CAS Number(s):
- 31036-80-3
Synonym(s)
1.
lofexidine
2.
2-(alpha-(2,6-dichlorophenoxy)ethyl) delta-2-imidazoline
3.
BritLofex
4.
Lofexidine mono-hydrochloride
5.
lofexidine hydrochloride
6.
lofexidine monohydrochloride
7.
lofexidine, (+-)-isomer
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Dizziness | FAERS: 9 | US FAERS | |
| 2 | Hypotension | FAERS: 5 | 3890587 15528619 | CTD US FAERS |
| 3 | Drug ineffective | FAERS: 3 | US FAERS | |
| 4 | Asthenia | FAERS: 2 | US FAERS | |
| 5 | Chills | FAERS: 2 | US FAERS | |
| 6 | Tinnitus | FAERS: 2 | US FAERS | |
| 7 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 8 | Bradycardia | FAERS: 1 | 15528619 | CTD US FAERS |
| 9 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 10 | Disorientation | FAERS: 1 | US FAERS | |
| 11 | Fatigue | FAERS: 1 | US FAERS | |
| 12 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 13 | Headache | FAERS: 1 | US FAERS | |
| 14 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 15 | Lethargy | FAERS: 1 | US FAERS | |
| 16 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 17 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 18 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 19 | Mouth swelling | FAERS: 1 | US FAERS | |
| 20 | Orthostatic hypertension | FAERS: 1 | US FAERS | |
| 21 | Overdose | FAERS: 1 | US FAERS | |
| 22 | Palpitations | FAERS: 1 | US FAERS | |
| 23 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 24 | Poisoning | FAERS: 1 | US FAERS | |
| 25 | Somnolence | FAERS: 1 | US FAERS | |
| 26 | Stress | FAERS: 1 | US FAERS | |
| 27 | Syncope | FAERS: 1 | US FAERS | |
| 28 | Tremor | FAERS: 1 | US FAERS | |
| 29 | Alcohol-Related Disorders | 3890587 | CTD | |
| 30 | Cocaine-Related Disorders | 10882840 11522461 | CTD | |
| 31 | Heroin Dependence | 11522461 | CTD | |
| 32 | Long QT Syndrome | 15528619 | CTD | |
| 33 | Opioid-Related Disorders | CTD | ||
| 34 | Substance Withdrawal Syndrome | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.