Ganciclovir
(JJICLMJFIKGAAU-UHFFFAOYSA-M)
Structure
- SMILES
- OCC(OCn1cnc2c1nc(N)nc2[O-])CO.[Na+]
- Molecular Formula:
- C9H12N5NaO4
- Molecular Weight:
- 277.212
- Log P:
- -0.5392
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 3
- TPSA:
- 142.37
- CAS Number(s):
- 84245-13-6; 107910-75-8
Synonym(s)
1.
Ganciclovir
2.
BIOLF-62
3.
BW-759
4.
Cytovene
5.
Ganciclovir Sodium
6.
Ganciclovir, Monosodium Salt
7.
Gancyclovir
8.
RS-21592
External Link(s)
| MeSH | D015774 |
| PubChem Compound | 23707495 23700083 |
| CHEMBL | CHEMBL1200850 |
| KEGG | dr:D04301 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Neutropenia | FAERS: 5 | US FAERS | |
| 2 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 3 | Drug resistance | FAERS: 2 | US FAERS | |
| 4 | Extravasation | FAERS: 2 | US FAERS | |
| 5 | Neutrophil morphology abnormal | FAERS: 2 | US FAERS | |
| 6 | Occupational exposure to product | FAERS: 2 | US FAERS | |
| 7 | Accidental exposure | FAERS: 1 | US FAERS | |
| 8 | Agitation | FAERS: 1 | US FAERS | |
| 9 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 10 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 11 | Burning sensation | FAERS: 1 | US FAERS | |
| 12 | Catheter site infection | FAERS: 1 | US FAERS | |
| 13 | Cerebellar Ataxia | FAERS: 1 | US FAERS | |
| 14 | Congenital rubella infection | FAERS: 1 | US FAERS | |
| 15 | Crying | FAERS: 1 | US FAERS | |
| 16 | Cytomegalovirus chorioretinitis | FAERS: 1 | US FAERS | |
| 17 | Cytomegalovirus test positive | FAERS: 1 | US FAERS | |
| 18 | Delirium | FAERS: 1 | US FAERS | |
| 19 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 20 | Drug administration error | FAERS: 1 | US FAERS | |
| 21 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 22 | Drug ineffective | FAERS: 1 | US FAERS | |
| 23 | Extra dose administered | FAERS: 1 | US FAERS | |
| 24 | Hepatitis | FAERS: 1 | US FAERS | |
| 25 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 26 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 27 | Neutropenic infection | FAERS: 1 | US FAERS | |
| 28 | Neutrophil Pelger-Huet anomaly present | FAERS: 1 | US FAERS | |
| 29 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 30 | No adverse event | FAERS: 1 | US FAERS | |
| 31 | Optic Atrophy | FAERS: 1 | US FAERS | |
| 32 | Pneumonia | FAERS: 1 | US FAERS | |
| 33 | Pneumonitis | FAERS: 1 | US FAERS | |
| 34 | Product contamination | FAERS: 1 | US FAERS | |
| 35 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 36 | Retinal infarction | FAERS: 1 | US FAERS | |
| 37 | Sepsis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Throat irritation | FAERS: 1 | US FAERS | |
| 39 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 40 | Tuberculosis | FAERS: 1 | US FAERS | |
| 41 | Unevaluable event | FAERS: 1 | US FAERS | |
| 42 | Weight decreased | FAERS: 1 | US FAERS | |
| 43 | White blood cell count decreased | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 44 | treatment failure | FAERS: 1 | US FAERS | |
| 45 | Overdose | Canada Vigilance: 2 | Canada Vigilance | |
| 46 | Shock | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.