Toremifene
(IWEQQRMGNVVKQW-OQKDUQJOSA-N)
Structure
- SMILES
- OC(=O)C(CC(=O)O)(CC(=O)O)O.ClCC/C(=C(\c1ccccc1)/c1ccc(cc1)OCCN(C)C)/c1ccccc1
- Molecular Formula:
- C32H36ClNO8
- Molecular Weight:
- 598.083
- Log P:
- 4.9665
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 4
- TPSA:
- 144.6
- CAS Number(s):
- 89778-27-8
Synonym(s)
1.
Toremifene
2.
FC-1157a
3.
Fareston
4.
Toremifene Citrate
5.
Toremifene Citrate (1:1)
6.
Toremifene, (E)-Isomer
7.
Citrate, Toremifene
8.
FC 1157a
9.
FC1157a
External Link(s)
| MeSH | D017312 |
| PubChem Compound | 3005572 |
| ChEBI | 9636 |
| CHEMBL | CHEMBL1200675 |
| KEGG | dr:D00967 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Aspartate Aminotransferase Increased | FAERS: 7 | US FAERS | |
| 2 | Alanine Aminotransferase Increased | FAERS: 6 | US FAERS | |
| 3 | Endometrial hypertrophy | FAERS: 6 | US FAERS | |
| 4 | Endometrial Hyperplasia | FAERS: 5 | US FAERS | |
| 5 | Respiratory Failure | FAERS: 5 | US FAERS | |
| 6 | Deep Vein Thrombosis | FAERS: 3 | US FAERS | |
| 7 | Fatigue | FAERS: 3 | US FAERS | |
| 8 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 9 | Dehydration | FAERS: 2 | US FAERS | |
| 10 | Dizziness | FAERS: 2 | US FAERS | |
| 11 | Endometrial Stromal Sarcoma | FAERS: 2 | US FAERS | |
| 12 | Endometrial adenocarcinoma | FAERS: 2 | US FAERS | |
| 13 | Endometrial thickening | FAERS: 2 | US FAERS | |
| 14 | No adverse event | FAERS: 2 | US FAERS | |
| 15 | Pain | FAERS: 2 | US FAERS | |
| 16 | Pancreatitis | FAERS: 2 | US FAERS | |
| 17 | Product use issue | FAERS: 2 | US FAERS | |
| 18 | Pruritus | FAERS: 2 | US FAERS | |
| 19 | Pulmonary thrombosis | FAERS: 2 | US FAERS | |
| 20 | Thrombophlebitis | FAERS: 2 | US FAERS | |
| 21 | Uterine Polyp | FAERS: 2 | US FAERS | |
| 22 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 23 | jaundice | FAERS: 2 | US FAERS | |
| 24 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 25 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 26 | Arthralgia | FAERS: 1 | US FAERS | |
| 27 | Asphyxia | FAERS: 1 | US FAERS | |
| 28 | Asthenia | FAERS: 1 | US FAERS | |
| 29 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 30 | Bacterial Vaginosis | FAERS: 1 | US FAERS | |
| 31 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 32 | Blood urea increased | FAERS: 1 | US FAERS | |
| 33 | Bronchitis | FAERS: 1 | US FAERS | |
| 34 | Burning sensation | FAERS: 1 | US FAERS | |
| 35 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 36 | Cervical polyp | FAERS: 1 | US FAERS | |
| 37 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 38 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 39 | Discomfort | FAERS: 1 | US FAERS | |
| 40 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 41 | Drug dose omission | FAERS: 1 | US FAERS | |
| 42 | Dyspepsia | FAERS: 1 | US FAERS | |
| 43 | Ear discomfort | FAERS: 1 | US FAERS | |
| 44 | Endometrial cancer stage III | FAERS: 1 | US FAERS | |
| 45 | Endometrial disorder | FAERS: 1 | US FAERS | |
| 46 | Endometrial sarcoma | FAERS: 1 | US FAERS | |
| 47 | Enterocolitis | FAERS: 1 | US FAERS | |
| 48 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 49 | Flushing | FAERS: 1 | US FAERS | |
| 50 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 51 | Gastrooesophageal cancer | FAERS: 1 | US FAERS | |
| 52 | Hypokinesia | FAERS: 1 | US FAERS | |
| 53 | Hypophagia | FAERS: 1 | US FAERS | |
| 54 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 55 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 56 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 57 | Menorrhagia | FAERS: 1 | US FAERS | |
| 58 | Mood swings | FAERS: 1 | US FAERS | |
| 59 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 60 | Myalgia | FAERS: 1 | US FAERS | |
| 61 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 62 | Nausea | FAERS: 1 | US FAERS | |
| 63 | Overdose | FAERS: 1 | US FAERS | |
| 64 | Pancytopenia | FAERS: 1 | US FAERS | |
| 65 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 66 | Pelvic discomfort | FAERS: 1 | US FAERS | |
| 67 | Psychiatric decompensation | FAERS: 1 | US FAERS | |
| 68 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 69 | Rectosigmoid cancer | FAERS: 1 | US FAERS | |
| 70 | Swelling | FAERS: 1 | US FAERS | |
| 71 | Tension Headache | FAERS: 1 | US FAERS | |
| 72 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 73 | Weight decreased | FAERS: 1 | US FAERS | |
| 74 | Wrong drug administered | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.