Penicillin V
(HCTVWSOKIJULET-LQDWTQKMSA-M)
Structure
- SMILES
- O=C(N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)[O-])(C)C)COc1ccccc1.[K+]
- Molecular Formula:
- C16H17KN2O5S
- Molecular Weight:
- 388.480
- Log P:
- -0.3088
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 1
- TPSA:
- 124.07
- CAS Number(s):
- 132-98-9
Synonym(s)
1.
Penicillin V
2.
Penicillin, Phenoxymethyl
3.
Apocillin
4.
Beromycin
5.
Beromycin, Penicillin
6.
Berromycin, Penicillin
7.
Betapen
8.
Fenoxymethylpenicillin
9.
Pen VK
10.
Penicillin V Potassium
11.
Penicillin V Sodium
12.
Penicillin VK
13.
Phenoxymethylpenicillin
14.
V-Cillin K
15.
Vegacillin
16.
Penicillin Beromycin
17.
Penicillin Berromycin
18.
Phenoxymethyl Penicillin
19.
Potassium, Penicillin V
20.
Sodium, Penicillin V
21.
V Cillin K
22.
V Sodium, Penicillin
23.
VCillin K
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Hypersensitivity | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Urticaria | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Malaise | FAERS: 11 | US FAERS | |
| 4 | Nausea | FAERS: 10 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 5 | Pruritus | FAERS: 9 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 6 | Headache | FAERS: 8 | US FAERS | |
| 7 | Vomiting | FAERS: 8 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 8 | Drug ineffective | FAERS: 6 | US FAERS | |
| 9 | Stevens-Johnson Syndrome | FAERS: 5 | US FAERS | |
| 10 | Abdominal discomfort | FAERS: 4 | US FAERS | |
| 11 | Dizziness | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Asthenia | FAERS: 3 | US FAERS | |
| 13 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 14 | Erythema | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Fatigue | FAERS: 3 | US FAERS | |
| 16 | Medication Error | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Swelling | FAERS: 3 | US FAERS | |
| 19 | Tremor | FAERS: 3 | US FAERS | |
| 20 | Adverse event | FAERS: 2 | US FAERS | |
| 21 | Anxiety | FAERS: 2 | US FAERS | |
| 22 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 23 | Hypotension | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 25 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 26 | Myalgia | FAERS: 2 | US FAERS | |
| 27 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 28 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 29 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 30 | Reaction to drug excipients | FAERS: 2 | US FAERS | |
| 31 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 32 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 33 | Acne | FAERS: 1 | US FAERS | |
| 34 | Anger | FAERS: 1 | US FAERS | |
| 35 | Arthralgia | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 36 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 37 | Bronchospasm | FAERS: 1 | US FAERS | |
| 38 | Burning sensation | FAERS: 1 | US FAERS | |
| 39 | Cheilitis | FAERS: 1 | US FAERS | |
| 40 | Chest Pain | FAERS: 1 | US FAERS | |
| 41 | Chest discomfort | FAERS: 1 | US FAERS | |
| 42 | Cluster Headache | FAERS: 1 | US FAERS | |
| 43 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 44 | Cystitis | FAERS: 1 | US FAERS | |
| 45 | Dermatitis | FAERS: 1 | US FAERS | |
| 46 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 47 | Dyspepsia | FAERS: 1 | US FAERS | |
| 48 | Expired product administered | FAERS: 1 | US FAERS | |
| 49 | Eye pain | FAERS: 1 | US FAERS | |
| 50 | Flatulence | FAERS: 1 | US FAERS | |
| 51 | Flushing | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 53 | Gastrointestinal mucosal exfoliation | FAERS: 1 | US FAERS | |
| 54 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 55 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 56 | Hyperacusis | FAERS: 1 | US FAERS | |
| 57 | Infection | FAERS: 1 | US FAERS | |
| 58 | Inflammation | FAERS: 1 | US FAERS | |
| 59 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 60 | Joint swelling | FAERS: 1 | US FAERS | |
| 61 | Leukocytosis | FAERS: 1 | US FAERS | |
| 62 | Leukopenia | FAERS: 1 | US FAERS | |
| 63 | Lumbar puncture abnormal | FAERS: 1 | US FAERS | |
| 64 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 65 | Medication residue present | FAERS: 1 | US FAERS | |
| 66 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 67 | Nervousness | FAERS: 1 | US FAERS | |
| 68 | Neutropenia | FAERS: 1 | US FAERS | |
| 69 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 70 | Papule | FAERS: 1 | US FAERS | |
| 71 | Paranoia | FAERS: 1 | US FAERS | |
| 72 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 73 | Product formulation issue | FAERS: 1 | US FAERS | |
| 74 | Product prescribing error | FAERS: 1 | US FAERS | |
| 75 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 76 | Product quality issue | FAERS: 1 | US FAERS | |
| 77 | Product storage error | FAERS: 1 | US FAERS | |
| 78 | Product substitution issue | FAERS: 1 | US FAERS | |
| 79 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 80 | Serum Sickness | FAERS: 1 | US FAERS | |
| 81 | Severe Acute Respiratory Syndrome | FAERS: 1 | US FAERS | |
| 82 | Somnolence | FAERS: 1 | US FAERS | |
| 83 | Sunburn | FAERS: 1 | US FAERS | |
| 84 | Syncope | FAERS: 1 | US FAERS | |
| 85 | Therapy change | FAERS: 1 | US FAERS | |
| 86 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 87 | Toothache | FAERS: 1 | US FAERS | |
| 88 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 89 | Troponin increased | FAERS: 1 | US FAERS | |
| 90 | Unevaluable event | FAERS: 1 | US FAERS | |
| 91 | Visual Impairment | FAERS: 1 | US FAERS | |
| 92 | Abdominal Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 93 | Angioedema | Canada Vigilance: 1 | Canada Vigilance | |
| 94 | Back Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 95 | Chills | Canada Vigilance: 1 | Canada Vigilance | |
| 96 | Hyperkinesia | Canada Vigilance: 1 | Canada Vigilance | |
| 97 | Memory impairment | Canada Vigilance: 1 | Canada Vigilance | |
| 98 | Nasopharyngitis | Canada Vigilance: 1 | Canada Vigilance | |
| 99 | Rash erythematous | Canada Vigilance: 1 | Canada Vigilance | |
| 100 | Suppressed lactation | Canada Vigilance: 1 | Canada Vigilance | |
| 101 | Vasculitis | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120269
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.