Rolapitant hydrochloride
(GZQWMYVDLCUBQX-WVZIYJGPSA-N)
Structure
- SMILES
- O=C1CC[C@@]2(N1)CC[C@@](NC2)(CO[C@@H](c1cc(cc(c1)C(F)(F)F)C(F)(F)F)C)c1ccccc1.O.Cl
- Molecular Formula:
- C25H29ClF6N2O3
- Molecular Weight:
- 554.953
- Log P:
- 7.1248
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 4
- TPSA:
- 59.59
- CAS Number(s):
- 914462-92-3
Synonym(s)
1.
Rolapitant hydrochloride
External Link(s)
| PubChem Compound | 16203739 |
| ChEBI | 90911 |
| CHEMBL | CHEMBL3707330 |
| KEGG | dr:D08988 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Flushing | FAERS: 54 | US FAERS | |
| 2 | Erythema | FAERS: 40 | US FAERS | |
| 3 | Dizziness | FAERS: 28 | US FAERS | |
| 4 | Abdominal discomfort | FAERS: 23 | US FAERS | |
| 5 | Palmar erythema | FAERS: 21 | US FAERS | |
| 6 | Nausea | FAERS: 18 | US FAERS | |
| 7 | Back Pain | FAERS: 14 | US FAERS | |
| 8 | Bronchospasm | FAERS: 11 | US FAERS | |
| 9 | Chest Pain | FAERS: 11 | US FAERS | |
| 10 | Hypersensitivity | FAERS: 10 | US FAERS | |
| 11 | Malaise | FAERS: 10 | US FAERS | |
| 12 | Abdominal Pain | FAERS: 8 | US FAERS | |
| 13 | Chest discomfort | FAERS: 8 | US FAERS | |
| 14 | Fatigue | FAERS: 8 | US FAERS | |
| 15 | Vomiting | FAERS: 7 | US FAERS | |
| 16 | Blood glucose increased | FAERS: 5 | US FAERS | |
| 17 | Chills | FAERS: 5 | US FAERS | |
| 18 | Malignant neoplasm progression | FAERS: 5 | US FAERS | |
| 19 | Pruritus | FAERS: 5 | US FAERS | |
| 20 | Urinary tract infection | FAERS: 5 | US FAERS | |
| 21 | Constipation | FAERS: 4 | US FAERS | |
| 22 | Dehydration | FAERS: 4 | US FAERS | |
| 23 | Hypotension | FAERS: 4 | US FAERS | |
| 24 | Infection | FAERS: 4 | US FAERS | |
| 25 | Anaphylactoid Reaction | FAERS: 3 | US FAERS | |
| 26 | Anxiety | FAERS: 3 | US FAERS | |
| 27 | Blood albumin decreased | FAERS: 3 | US FAERS | |
| 28 | Dyspepsia | FAERS: 3 | US FAERS | |
| 29 | Pain | FAERS: 3 | US FAERS | |
| 30 | Retching | FAERS: 3 | US FAERS | |
| 31 | Urticaria | FAERS: 3 | US FAERS | |
| 32 | Weight decreased | FAERS: 3 | US FAERS | |
| 33 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 34 | Agitation | FAERS: 2 | US FAERS | |
| 35 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 36 | Asthenia | FAERS: 2 | US FAERS | |
| 37 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 38 | Blood urea increased | FAERS: 2 | US FAERS | |
| 39 | Bone pain | FAERS: 2 | US FAERS | |
| 40 | Clostridium difficile infection | FAERS: 2 | US FAERS | |
| 41 | Drug ineffective | FAERS: 2 | US FAERS | |
| 42 | Febrile Neutropenia | FAERS: 2 | US FAERS | |
| 43 | Neutropenia | FAERS: 2 | US FAERS | |
| 44 | Palpitations | FAERS: 2 | US FAERS | |
| 45 | Stomatitis | FAERS: 2 | US FAERS | |
| 46 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 47 | Thrombosis | FAERS: 2 | US FAERS | |
| 48 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 49 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 50 | Adverse event | FAERS: 1 | US FAERS | |
| 51 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 52 | Arthralgia | FAERS: 1 | US FAERS | |
| 53 | Ascites | FAERS: 1 | US FAERS | |
| 54 | Blindness | FAERS: 1 | US FAERS | |
| 55 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 56 | Blood chloride decreased | FAERS: 1 | US FAERS | |
| 57 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 58 | Blood osmolarity decreased | FAERS: 1 | US FAERS | |
| 59 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 60 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 61 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 62 | Cancer Pain | FAERS: 1 | US FAERS | |
| 63 | Carbohydrate antigen 19-9 increased | FAERS: 1 | US FAERS | |
| 64 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 65 | Catatonia | FAERS: 1 | US FAERS | |
| 66 | Complication associated with device | FAERS: 1 | US FAERS | |
| 67 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 68 | Cortisol decreased | FAERS: 1 | US FAERS | |
| 69 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 70 | Dysgeusia | FAERS: 1 | US FAERS | |
| 71 | Embolic stroke | FAERS: 1 | US FAERS | |
| 72 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 73 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 74 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 75 | Headache | FAERS: 1 | US FAERS | |
| 76 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 77 | Incontinence | FAERS: 1 | US FAERS | |
| 78 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 79 | Influenza | FAERS: 1 | US FAERS | |
| 80 | Lipase decreased | FAERS: 1 | US FAERS | |
| 81 | Lymphocyte percentage decreased | FAERS: 1 | US FAERS | |
| 82 | Medical device site pain | FAERS: 1 | US FAERS | |
| 83 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 84 | Muscle tightness | FAERS: 1 | US FAERS | |
| 85 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 86 | N-terminal prohormone brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 87 | Neck Pain | FAERS: 1 | US FAERS | |
| 88 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 89 | Oral pain | FAERS: 1 | US FAERS | |
| 90 | Pneumonia | FAERS: 1 | US FAERS | |
| 91 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 92 | Red cell distribution width decreased | FAERS: 1 | US FAERS | |
| 93 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 94 | Restlessness | FAERS: 1 | US FAERS | |
| 95 | Tachycardia | FAERS: 1 | US FAERS | |
| 96 | Tinnitus | FAERS: 1 | US FAERS | |
| 97 | Visual Impairment | FAERS: 1 | US FAERS | |
| 98 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 99 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 100 | Wheezing | FAERS: 1 | US FAERS | |
| 101 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 102 | jaundice | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.