gilteritinib
(GYQYAJJFPNQOOW-UHFFFAOYSA-N)
Structure
- SMILES
- COc1cc(ccc1N1CCC(CC1)N1CCN(CC1)C)Nc1nc(NC2CCOCC2)c(nc1C(=O)N)CC
- Type(s)
- Approved; Investigational
- Molecular Formula:
- C29H44N8O3
- Molecular Weight:
- 552.711
- Log P:
- 3.4843
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 3
- TPSA:
- 121.11
- CAS Number(s):
- 1254053-43-4
Synonym(s)
1.
gilteritinib
2.
ASP-2215
3.
ASP2215
External Link(s)
| MeSH | C000609080 |
| PubChem Compound | 49803313 |
| BindingDB | 144315 |
| ChEBI | 145372 |
| CHEMBL | CHEMBL3301622 |
| DrugBank | DB12141 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 8708 |
| KEGG | dr:D10709 |
| ZINC | 113476229 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Febrile Neutropenia | FAERS: 11 | US FAERS | |
| 2 | Fatigue | FAERS: 4 | US FAERS | |
| 3 | Intentional dose omission | FAERS: 4 | US FAERS | |
| 4 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 5 | Asthenia | FAERS: 3 | US FAERS | |
| 6 | Neutrophil count decreased | FAERS: 3 | US FAERS | |
| 7 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 8 | Cellulitis | FAERS: 2 | US FAERS | |
| 9 | Cytopenia | FAERS: 2 | US FAERS | |
| 10 | Hypotension | FAERS: 2 | US FAERS | |
| 11 | Pneumonia | FAERS: 2 | US FAERS | |
| 12 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 13 | Productive Cough | FAERS: 2 | US FAERS | |
| 14 | Upper-airway cough syndrome | FAERS: 2 | US FAERS | |
| 15 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 16 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 17 | Biliary Colic | FAERS: 1 | US FAERS | |
| 18 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 19 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 20 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 21 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 22 | Chest Pain | FAERS: 1 | US FAERS | |
| 23 | Dehydration | FAERS: 1 | US FAERS | |
| 24 | Disease recurrence | FAERS: 1 | US FAERS | |
| 25 | Dizziness | FAERS: 1 | US FAERS | |
| 26 | Drug ineffective | FAERS: 1 | US FAERS | |
| 27 | Dry skin | FAERS: 1 | US FAERS | |
| 28 | Epistaxis | FAERS: 1 | US FAERS | |
| 29 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 30 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 31 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 32 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 33 | Gene mutation identification test positive | FAERS: 1 | US FAERS | |
| 34 | Headache | FAERS: 1 | US FAERS | |
| 35 | Ileus | FAERS: 1 | US FAERS | |
| 36 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 37 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 38 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 39 | Infection | FAERS: 1 | US FAERS | |
| 40 | Influenza | FAERS: 1 | US FAERS | |
| 41 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 42 | Leukocytosis | FAERS: 1 | US FAERS | |
| 43 | Lip swelling | FAERS: 1 | US FAERS | |
| 44 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 45 | Myalgia | FAERS: 1 | US FAERS | |
| 46 | Nausea | FAERS: 1 | US FAERS | |
| 47 | Pancreatitis | FAERS: 1 | US FAERS | |
| 48 | Pancytopenia | FAERS: 1 | US FAERS | |
| 49 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 50 | Philadelphia chromosome positive | FAERS: 1 | US FAERS | |
| 51 | Product dose omission | FAERS: 1 | US FAERS | |
| 52 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 53 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 54 | Sepsis | FAERS: 1 | US FAERS | |
| 55 | Sinusitis | FAERS: 1 | US FAERS | |
| 56 | Somnolence | FAERS: 1 | US FAERS | |
| 57 | Urinary Retention | FAERS: 1 | US FAERS | |
| 58 | Venous occlusion | FAERS: 1 | US FAERS | |
| 59 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 60 | nervous system disorder | FAERS: 1 | US FAERS | |
| 61 | Erythema | Canada Vigilance: 1 | Canada Vigilance | |
| 62 | Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 63 | Soft tissue mass | Canada Vigilance: 1 | Canada Vigilance | |
| 64 | Swelling | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.