fosphenytoin
(GQPXYJNXTAFDLT-UHFFFAOYSA-L)
Structure
- SMILES
- O=C1N(COP(=O)([O-])[O-])C(=O)NC1(c1ccccc1)c1ccccc1.[Na+].[Na+]
- Molecular Formula:
- C16H13N2Na2O6P
- Molecular Weight:
- 406.238
- Log P:
- 2.6919
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 1
- TPSA:
- 131.64
- CAS Number(s):
- 92134-98-0
Synonym(s)
1.
fosphenytoin
2.
3-(hydroxymethyl)phenytoin disodium phosphate
3.
3-(hydroxymethyl)phenytoin phosphate ester
4.
ACC 9653
5.
ACC-9653
6.
Cerebyx
7.
HMPDP
8.
Prodilantin
9.
fosphenytoin sodium
10.
fosphenytoin, disodium salt
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Cardiac Arrest | FAERS: 17 | US FAERS | |
| 2 | Hypotension | FAERS: 14 | US FAERS | |
| 3 | Infusion Site Extravasation | FAERS: 13 | US FAERS | |
| 4 | Respiratory Depression | FAERS: 13 | US FAERS | |
| 5 | Cardiac Death | FAERS: 10 | US FAERS | |
| 6 | Respiratory arrest | FAERS: 10 | US FAERS | |
| 7 | Stevens-Johnson Syndrome | FAERS: 10 | US FAERS | |
| 8 | Toxic Epidermal Necrolysis | FAERS: 9 | US FAERS | |
| 9 | Toxicity to various agents | FAERS: 8 | US FAERS | |
| 10 | Accidental overdose | FAERS: 7 | US FAERS | |
| 11 | Acute respiratory failure | FAERS: 7 | US FAERS | |
| 12 | Incorrect dose administered | FAERS: 7 | US FAERS | |
| 13 | Anticonvulsant drug level below therapeutic | FAERS: 6 | US FAERS | |
| 14 | Bradycardia | FAERS: 6 | US FAERS | |
| 15 | Blood creatine phosphokinase increased | FAERS: 5 | US FAERS | |
| 16 | Drug ineffective | FAERS: 5 | US FAERS | |
| 17 | Extravasation | FAERS: 5 | US FAERS | |
| 18 | Medication Error | FAERS: 5 | US FAERS | |
| 19 | Overdose | FAERS: 5 | US FAERS | |
| 20 | Pruritus | FAERS: 5 | US FAERS | |
| 21 | Anticonvulsant drug level increased | FAERS: 4 | US FAERS | |
| 22 | Erythema | FAERS: 4 | US FAERS | |
| 23 | Nystagmus | FAERS: 4 | US FAERS | |
| 24 | Tachycardia | FAERS: 4 | US FAERS | |
| 25 | Agitation | FAERS: 3 | US FAERS | |
| 26 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 27 | Anticonvulsant drug level abnormal | FAERS: 3 | US FAERS | |
| 28 | Anticonvulsant drug level above therapeutic | FAERS: 3 | US FAERS | |
| 29 | Dizziness | FAERS: 3 | US FAERS | |
| 30 | Drug level decreased | FAERS: 3 | US FAERS | |
| 31 | Drug level increased | FAERS: 3 | US FAERS | |
| 32 | Hypoxia | FAERS: 3 | US FAERS | |
| 33 | Infusion site erythema | FAERS: 3 | US FAERS | |
| 34 | Injection site extravasation | FAERS: 3 | US FAERS | |
| 35 | Injection site pain | FAERS: 3 | US FAERS | |
| 36 | Neuroleptic Malignant Syndrome | FAERS: 3 | US FAERS | |
| 37 | Product use issue | FAERS: 3 | US FAERS | |
| 38 | Tinnitus | FAERS: 3 | US FAERS | |
| 39 | Vomiting | FAERS: 3 | US FAERS | |
| 40 | Ataxia | FAERS: 2 | US FAERS | |
| 41 | Capillary nail refill test abnormal | FAERS: 2 | US FAERS | |
| 42 | Drug administration error | FAERS: 2 | US FAERS | |
| 43 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 44 | Drug toxicity | FAERS: 2 | US FAERS | |
| 45 | Encephalitis | FAERS: 2 | US FAERS | |
| 46 | Lethargy | FAERS: 2 | US FAERS | |
| 47 | Purple glove syndrome | FAERS: 2 | US FAERS | |
| 48 | Skin reaction | FAERS: 2 | US FAERS | |
| 49 | Tumour haemorrhage | FAERS: 2 | US FAERS | |
| 50 | Vascular pain | FAERS: 2 | US FAERS | |
| 51 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 52 | Abasia | FAERS: 1 | US FAERS | |
| 53 | Accidental underdose | FAERS: 1 | US FAERS | |
| 54 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 55 | Acute vestibular syndrome | FAERS: 1 | US FAERS | |
| 56 | Adverse event | FAERS: 1 | US FAERS | |
| 57 | Angioedema | FAERS: 1 | US FAERS | |
| 58 | Anoxic Encephalopathy | FAERS: 1 | US FAERS | |
| 59 | Anticonvulsant drug level decreased | FAERS: 1 | US FAERS | |
| 60 | Anxiety | FAERS: 1 | US FAERS | |
| 61 | Aphagia | FAERS: 1 | US FAERS | |
| 62 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 63 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 64 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 65 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 66 | Burning sensation | FAERS: 1 | US FAERS | |
| 67 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 68 | Chills | FAERS: 1 | US FAERS | |
| 69 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 70 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 71 | Deafness | FAERS: 1 | US FAERS | |
| 72 | Decorticate posture | FAERS: 1 | US FAERS | |
| 73 | Delirium | FAERS: 1 | US FAERS | |
| 74 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 75 | Diplopia | FAERS: 1 | US FAERS | |
| 76 | Disease recurrence | FAERS: 1 | US FAERS | |
| 77 | Disorientation | FAERS: 1 | US FAERS | |
| 78 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 79 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 80 | Dysarthria | FAERS: 1 | US FAERS | |
| 81 | Eosinophilia | FAERS: 1 | US FAERS | |
| 82 | Epilepsy | FAERS: 1 | US FAERS | |
| 83 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 84 | Fluid overload | FAERS: 1 | US FAERS | |
| 85 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 86 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 87 | Hypercreatininaemia | FAERS: 1 | US FAERS | |
| 88 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 89 | Incoherent | FAERS: 1 | US FAERS | |
| 90 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 91 | Infusion site induration | FAERS: 1 | US FAERS | |
| 92 | Infusion site pain | FAERS: 1 | US FAERS | |
| 93 | Infusion site swelling | FAERS: 1 | US FAERS | |
| 94 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 95 | Injection site erythema | FAERS: 1 | US FAERS | |
| 96 | Leukopenia | FAERS: 1 | US FAERS | |
| 97 | Nausea | FAERS: 1 | US FAERS | |
| 98 | Open wound | FAERS: 1 | US FAERS | |
| 99 | Pancytopenia | FAERS: 1 | US FAERS | |
| 100 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 101 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 102 | Phlebitis | FAERS: 1 | US FAERS | |
| 103 | Pneumonia | FAERS: 1 | US FAERS | |
| 104 | Poisoning | FAERS: 1 | US FAERS | |
| 105 | Product preparation error | FAERS: 1 | US FAERS | |
| 106 | Product prescribing error | FAERS: 1 | US FAERS | |
| 107 | Productive Cough | FAERS: 1 | US FAERS | |
| 108 | Rash erythematous | FAERS: 1 | US FAERS | |
| 109 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 110 | Restlessness | FAERS: 1 | US FAERS | |
| 111 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 112 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 113 | Schizophrenia | FAERS: 1 | US FAERS | |
| 114 | Screaming | FAERS: 1 | US FAERS | |
| 115 | Sepsis | FAERS: 1 | US FAERS | |
| 116 | Serum serotonin decreased | FAERS: 1 | US FAERS | |
| 117 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 118 | Somnolence | FAERS: 1 | US FAERS | |
| 119 | Syncope | FAERS: 1 | US FAERS | |
| 120 | Tracheal Stenosis | FAERS: 1 | US FAERS | |
| 121 | Tremor | FAERS: 1 | US FAERS | |
| 122 | Urticaria | FAERS: 1 | US FAERS | |
| 123 | Vasculitis | FAERS: 1 | US FAERS | |
| 124 | Visual disturbance | FAERS: 1 | US FAERS | |
| 125 | Wheezing | FAERS: 1 | US FAERS | |
| 126 | Wrong drug administered | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.