Junel 1/20
(GEONECATAKDDLT-KZJWJZTMSA-N)
Structure
- SMILES
- C#C[C@@]1(CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCC2=CC(=O)CCC12)OC(=O)C.C#C[C@]1(O)CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCc2c1ccc(c2)O
- Molecular Formula:
- C42H52O5
- Molecular Weight:
- 636.859
- Log P:
- 7.6759
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 2
- TPSA:
- 83.83
- CAS Number(s):
- N/A
Synonym(s)
1.
Junel 1/20
External Link(s)
| PubChem Compound | 9830779 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Headache | FAERS: 13 | US FAERS | |
| 2 | Nausea | FAERS: 8 | US FAERS | |
| 3 | Dizziness | FAERS: 7 | US FAERS | |
| 4 | Product quality issue | FAERS: 7 | US FAERS | |
| 5 | Pulmonary Embolism | FAERS: 6 | US FAERS | |
| 6 | Vomiting | FAERS: 6 | US FAERS | |
| 7 | Drug ineffective | FAERS: 5 | US FAERS | |
| 8 | Menorrhagia | FAERS: 5 | US FAERS | |
| 9 | Metrorrhagia | FAERS: 5 | US FAERS | |
| 10 | Feeling abnormal | FAERS: 4 | US FAERS | |
| 11 | Product substitution issue | FAERS: 4 | US FAERS | |
| 12 | Asthenia | FAERS: 3 | US FAERS | |
| 13 | Crying | FAERS: 3 | US FAERS | |
| 14 | Deep Vein Thrombosis | FAERS: 3 | US FAERS | |
| 15 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 16 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 17 | Mood swings | FAERS: 3 | US FAERS | |
| 18 | Pregnancy on oral contraceptive | FAERS: 3 | US FAERS | |
| 19 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 20 | Thrombosis | FAERS: 3 | US FAERS | |
| 21 | Tremor | FAERS: 3 | US FAERS | |
| 22 | Acne | FAERS: 2 | US FAERS | |
| 23 | Anger | FAERS: 2 | US FAERS | |
| 24 | Anxiety | FAERS: 2 | US FAERS | |
| 25 | Apparent death | FAERS: 2 | US FAERS | |
| 26 | Breast tenderness | FAERS: 2 | US FAERS | |
| 27 | Cavernous Sinus Thrombosis | FAERS: 2 | US FAERS | |
| 28 | Cerebral Thrombosis | FAERS: 2 | US FAERS | |
| 29 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 30 | Drug dose omission | FAERS: 2 | US FAERS | |
| 31 | Ectopic Pregnancy | FAERS: 2 | US FAERS | |
| 32 | Fatigue | FAERS: 2 | US FAERS | |
| 33 | Malaise | FAERS: 2 | US FAERS | |
| 34 | Nervousness | FAERS: 2 | US FAERS | |
| 35 | Swelling | FAERS: 2 | US FAERS | |
| 36 | Vertigo | FAERS: 2 | US FAERS | |
| 37 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 38 | Adverse event | FAERS: 1 | US FAERS | |
| 39 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 40 | Aura | FAERS: 1 | US FAERS | |
| 41 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 42 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 43 | Cold sweat | FAERS: 1 | US FAERS | |
| 44 | Dyspepsia | FAERS: 1 | US FAERS | |
| 45 | Embolism | FAERS: 1 | US FAERS | |
| 46 | Emotional disorder | FAERS: 1 | US FAERS | |
| 47 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 48 | Genital swelling | FAERS: 1 | US FAERS | |
| 49 | Hyperphagia | FAERS: 1 | US FAERS | |
| 50 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 51 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 52 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 53 | Intercepted product dispensing error | FAERS: 1 | US FAERS | |
| 54 | Medication Error | FAERS: 1 | US FAERS | |
| 55 | Middle insomnia | FAERS: 1 | US FAERS | |
| 56 | Negative thoughts | FAERS: 1 | US FAERS | |
| 57 | Negativism | FAERS: 1 | US FAERS | |
| 58 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 59 | Pain | FAERS: 1 | US FAERS | |
| 60 | Paranoia | FAERS: 1 | US FAERS | |
| 61 | Peripheral artery thrombosis | FAERS: 1 | US FAERS | |
| 62 | Product dispensing error | FAERS: 1 | US FAERS | |
| 63 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 64 | Product storage error | FAERS: 1 | US FAERS | |
| 65 | Product use issue | FAERS: 1 | US FAERS | |
| 66 | Sluggishness | FAERS: 1 | US FAERS | |
| 67 | Stress | FAERS: 1 | US FAERS | |
| 68 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 69 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 70 | Tinnitus | FAERS: 1 | US FAERS | |
| 71 | Visual Impairment | FAERS: 1 | US FAERS | |
| 72 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 73 | Weight decreased | FAERS: 1 | US FAERS | |
| 74 | Wrong product administered | FAERS: 1 | US FAERS | |
| 75 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 76 | treatment failure | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.