esmolol
(GEKNCWBANDDJJL-UHFFFAOYSA-N)
Structure
- SMILES
- COC(=O)CCc1ccc(cc1)OCC(CNC(C)C)O.Cl
- Molecular Formula:
- C16H26ClNO4
- Molecular Weight:
- 331.835
- Log P:
- 2.7228
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 3
- TPSA:
- 67.79
- CAS Number(s):
- 81161-17-3
Synonym(s)
1.
esmolol
2.
ASL 8052
3.
ASL-8052
4.
Brevibloc
5.
esmolol hydrochloride
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 6 | US FAERS | |
| 2 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 3 | Extravasation | FAERS: 3 | US FAERS | |
| 4 | Infusion Site Extravasation | FAERS: 3 | US FAERS | |
| 5 | Occupational exposure to product | FAERS: 3 | US FAERS | |
| 6 | Oropharyngeal discomfort | FAERS: 3 | US FAERS | |
| 7 | Blindness | FAERS: 2 | US FAERS | |
| 8 | Hypotension | FAERS: 2 | US FAERS | |
| 9 | Necrosis | FAERS: 2 | US FAERS | |
| 10 | Skin necrosis | FAERS: 2 | US FAERS | |
| 11 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 12 | Administration site extravasation | FAERS: 1 | US FAERS | |
| 13 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 14 | Bradycardia | FAERS: 1 | US FAERS | |
| 15 | Bronchospasm | FAERS: 1 | US FAERS | |
| 16 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 17 | Dehydration | FAERS: 1 | US FAERS | |
| 18 | Drug dose omission | FAERS: 1 | US FAERS | |
| 19 | False positive investigation result | FAERS: 1 | US FAERS | |
| 20 | Infusion site erythema | FAERS: 1 | US FAERS | |
| 21 | Infusion site swelling | FAERS: 1 | US FAERS | |
| 22 | Medication Error | FAERS: 1 | US FAERS | |
| 23 | Overdose | FAERS: 1 | US FAERS | |
| 24 | Phlebitis | FAERS: 1 | US FAERS | |
| 25 | Pneumonia | FAERS: 1 | US FAERS | |
| 26 | Product distribution issue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 28 | Product use issue | FAERS: 1 | US FAERS | |
| 29 | Right Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 30 | Therapy cessation | FAERS: 1 | US FAERS | |
| 31 | Unevaluable event | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 33 | Urethral Obstruction | FAERS: 1 | US FAERS | |
| 34 | Product dose omission | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.