Carteolol
(FYBXRCFPOTXTJF-UHFFFAOYSA-N)
Structure
- SMILES
- OC(COc1cccc2c1CCC(=O)N2)CNC(C)(C)C.Cl
- Molecular Formula:
- C16H25ClN2O3
- Molecular Weight:
- 328.834
- Log P:
- 3.0300
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 4
- TPSA:
- 70.59
- CAS Number(s):
- 51781-21-6
Synonym(s)
1.
Carteolol
2.
Carteolol Hydrochloride
3.
Carteolol Monohydrochloride
4.
OPC-1085
5.
Hydrochloride, Carteolol
6.
Monohydrochloride, Carteolol
7.
OPC 1085
8.
OPC1085
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Bradycardia | FAERS: 4 | US FAERS | |
| 2 | Meningioma | FAERS: 4 | US FAERS | |
| 3 | Syncope | FAERS: 4 | US FAERS | |
| 4 | Atrioventricular Block | FAERS: 3 | US FAERS | |
| 5 | Blood creatinine increased | FAERS: 3 | US FAERS | |
| 6 | Blood potassium increased | FAERS: 3 | US FAERS | |
| 7 | Blood sodium decreased | FAERS: 3 | US FAERS | |
| 8 | Disorientation | FAERS: 3 | US FAERS | |
| 9 | Escherichia infection | FAERS: 3 | US FAERS | |
| 10 | Metabolic acidosis | FAERS: 3 | US FAERS | |
| 11 | Headache | FAERS: 2 | US FAERS | |
| 12 | Hemiplegia | FAERS: 2 | US FAERS | |
| 13 | Meningioma surgery | FAERS: 2 | US FAERS | |
| 14 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 15 | Sinoatrial Block | FAERS: 2 | US FAERS | |
| 16 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 17 | Ageusia | FAERS: 1 | US FAERS | |
| 18 | Ankle brachial index decreased | FAERS: 1 | US FAERS | |
| 19 | Anosmia | FAERS: 1 | US FAERS | |
| 20 | Asphyxia | FAERS: 1 | US FAERS | |
| 21 | Asthma | FAERS: 1 | US FAERS | |
| 22 | Atrial conduction time prolongation | FAERS: 1 | US FAERS | |
| 23 | Biopsy | FAERS: 1 | US FAERS | |
| 24 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 25 | Cataract operation | FAERS: 1 | US FAERS | |
| 26 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 27 | Chest Pain | FAERS: 1 | US FAERS | |
| 28 | Cold sweat | FAERS: 1 | US FAERS | |
| 29 | Cyanosis | FAERS: 1 | US FAERS | |
| 30 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 31 | Disease Progression | FAERS: 1 | US FAERS | |
| 32 | Dizziness | FAERS: 1 | US FAERS | |
| 33 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 34 | Eye Redness | FAERS: 1 | US FAERS | |
| 35 | Eye irritation | FAERS: 1 | US FAERS | |
| 36 | Eye pain | FAERS: 1 | US FAERS | |
| 37 | Granuloma | FAERS: 1 | US FAERS | |
| 38 | Hypotension | FAERS: 1 | US FAERS | |
| 39 | Intermittent Claudication | FAERS: 1 | US FAERS | |
| 40 | Macrophages increased | FAERS: 1 | US FAERS | |
| 41 | Medication Error | FAERS: 1 | US FAERS | |
| 42 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 43 | Mycosis Fungoides | FAERS: 1 | US FAERS | |
| 44 | Pallor | FAERS: 1 | US FAERS | |
| 45 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 46 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 47 | Rash erythematous | FAERS: 1 | US FAERS | |
| 48 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 49 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 50 | Skin lesion | FAERS: 1 | US FAERS | |
| 51 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 52 | Tongue movement disturbance | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.