Copiktra
(FQLHRUBTGKTKPZ-ZOWNYOTGSA-N)
Structure
- SMILES
- Clc1cccc2c1c(=O)n(c(c2)[C@@H](Nc1ncnc2c1[nH]cn2)C)c1ccccc1.O
- Molecular Formula:
- C22H19ClN6O2
- Molecular Weight:
- 434.878
- Log P:
- 4.4922
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 3
- TPSA:
- 97.72
- CAS Number(s):
- 1386861-49-9
Synonym(s)
1.
Copiktra
External Link(s)
| PubChem Compound | 137528190 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Product use in unapproved indication | FAERS: 7 | US FAERS | |
| 2 | Nausea | FAERS: 3 | US FAERS | |
| 3 | Pneumonia | FAERS: 3 | US FAERS | |
| 4 | Prescribed overdose | FAERS: 3 | US FAERS | |
| 5 | Prescribed underdose | FAERS: 3 | US FAERS | |
| 6 | Weight decreased | FAERS: 3 | US FAERS | |
| 7 | Asthenia | FAERS: 2 | US FAERS | |
| 8 | Constipation | FAERS: 2 | US FAERS | |
| 9 | Disease Progression | FAERS: 2 | US FAERS | |
| 10 | Malaise | FAERS: 2 | US FAERS | |
| 11 | Malignant neoplasm progression | FAERS: 2 | US FAERS | |
| 12 | Stomatitis | FAERS: 2 | US FAERS | |
| 13 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 14 | Allergic cough | FAERS: 1 | US FAERS | |
| 15 | Arthralgia | FAERS: 1 | US FAERS | |
| 16 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 17 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 18 | Bronchitis | FAERS: 1 | US FAERS | |
| 19 | Chest Pain | FAERS: 1 | US FAERS | |
| 20 | Colitis | FAERS: 1 | US FAERS | |
| 21 | Cytopenia | FAERS: 1 | US FAERS | |
| 22 | Depressed mood | FAERS: 1 | US FAERS | |
| 23 | Dyspepsia | FAERS: 1 | US FAERS | |
| 24 | Emotional distress | FAERS: 1 | US FAERS | |
| 25 | Erythema | FAERS: 1 | US FAERS | |
| 26 | Fatigue | FAERS: 1 | US FAERS | |
| 27 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 28 | Hypotension | FAERS: 1 | US FAERS | |
| 29 | Ileus | FAERS: 1 | US FAERS | |
| 30 | Infection | FAERS: 1 | US FAERS | |
| 31 | Lethargy | FAERS: 1 | US FAERS | |
| 32 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 33 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 34 | Neutropenia | FAERS: 1 | US FAERS | |
| 35 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 36 | Night sweats | FAERS: 1 | US FAERS | |
| 37 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 38 | Pancytopenia | FAERS: 1 | US FAERS | |
| 39 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 40 | Product dose omission | FAERS: 1 | US FAERS | |
| 41 | Pruritus | FAERS: 1 | US FAERS | |
| 42 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 43 | Retching | FAERS: 1 | US FAERS | |
| 44 | Rhinovirus infection | FAERS: 1 | US FAERS | |
| 45 | Sepsis | FAERS: 1 | US FAERS | |
| 46 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 47 | Splenomegaly | FAERS: 1 | US FAERS | |
| 48 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 49 | Vomiting | FAERS: 1 | US FAERS | |
| 50 | White blood cell count decreased | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120241
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.