8-((1-(3,5-bis(trifluoromethyl)phenyl)ethoxy)methyl)-8-phenyl-1,7-diazaspiro(4,5)decan-2-one
(FIVSJYGQAIEMOC-ZGNKEGEESA-N)
Structure
- SMILES
- O=C1CC[C@@]2(N1)CC[C@@](NC2)(CO[C@@H](c1cc(cc(c1)C(F)(F)F)C(F)(F)F)C)c1ccccc1
- Type(s)
- Approved; Investigational
- ATC code(s)
- A04AD14
- Molecular Formula:
- C25H26F6N2O2
- Molecular Weight:
- 500.477
- Log P:
- 6.3871
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 2
- TPSA:
- 50.36
- CAS Number(s):
- 552292-08-7; 914462-92-3
Synonym(s)
1.
8-((1-(3,5-bis(trifluoromethyl)phenyl)ethoxy)methyl)-8-phenyl-1,7-diazaspiro(4,5)decan-2-one
2.
(5S,8S)-8-(((1R)-1-(3,5-bis(trifluoromethyl)phenyl)ethoxy)methyl)-8-phenyl-1,7-diazaspiro(4.5)decan-2-one
3.
SCH 619734
4.
rolapitant
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Flushing | FAERS: 19 | US FAERS | |
| 2 | Back Pain | FAERS: 11 | US FAERS | |
| 3 | Chest discomfort | FAERS: 9 | US FAERS | |
| 4 | Urinary tract infection | FAERS: 8 | US FAERS | |
| 5 | Malaise | FAERS: 7 | US FAERS | |
| 6 | Nausea | FAERS: 7 | US FAERS | |
| 7 | Pneumonia | FAERS: 7 | US FAERS | |
| 8 | Abdominal Pain | FAERS: 5 | US FAERS | |
| 9 | Blood count abnormal | FAERS: 5 | US FAERS | |
| 10 | Infection | FAERS: 5 | US FAERS | |
| 11 | Therapy cessation | FAERS: 5 | US FAERS | |
| 12 | White blood cell count decreased | FAERS: 5 | US FAERS | |
| 13 | Anxiety | FAERS: 4 | US FAERS | |
| 14 | Chest Pain | FAERS: 4 | US FAERS | |
| 15 | Constipation | FAERS: 4 | US FAERS | |
| 16 | Disease Progression | FAERS: 4 | US FAERS | |
| 17 | Dehydration | FAERS: 3 | US FAERS | |
| 18 | Dizziness | FAERS: 3 | US FAERS | |
| 19 | Fatigue | FAERS: 3 | US FAERS | |
| 20 | Headache | FAERS: 3 | US FAERS | |
| 21 | Neutropenia | FAERS: 3 | US FAERS | |
| 22 | Vomiting | FAERS: 3 | US FAERS | |
| 23 | Arthralgia | FAERS: 2 | US FAERS | |
| 24 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 25 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 26 | Device related infection | FAERS: 2 | US FAERS | |
| 27 | Dysuria | FAERS: 2 | US FAERS | |
| 28 | Erythema | FAERS: 2 | US FAERS | |
| 29 | Hydronephrosis | FAERS: 2 | US FAERS | |
| 30 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 31 | Leukopenia | FAERS: 2 | US FAERS | |
| 32 | Malignant neoplasm progression | FAERS: 2 | US FAERS | |
| 33 | Thrombosis | FAERS: 2 | US FAERS | |
| 34 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 35 | Urticaria | FAERS: 2 | US FAERS | |
| 36 | Vitamin D Deficiency | FAERS: 2 | US FAERS | |
| 37 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 38 | Abdominal adhesions | FAERS: 1 | US FAERS | |
| 39 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 40 | Agitation | FAERS: 1 | US FAERS | |
| 41 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 42 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 43 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 44 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 45 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 46 | Burning sensation | FAERS: 1 | US FAERS | |
| 47 | Cancer Pain | FAERS: 1 | US FAERS | |
| 48 | Cellulitis | FAERS: 1 | US FAERS | |
| 49 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 50 | Disease complication | FAERS: 1 | US FAERS | |
| 51 | Drug administration error | FAERS: 1 | US FAERS | |
| 52 | Drug ineffective | FAERS: 1 | US FAERS | |
| 53 | Dyspepsia | FAERS: 1 | US FAERS | |
| 54 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 55 | Fracture | FAERS: 1 | US FAERS | |
| 56 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 57 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 58 | Hospice Care | FAERS: 1 | US FAERS | |
| 59 | Inflammation | FAERS: 1 | US FAERS | |
| 60 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 61 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 62 | Joint injury | FAERS: 1 | US FAERS | |
| 63 | Muscle tightness | FAERS: 1 | US FAERS | |
| 64 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 65 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 66 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 67 | Neck Pain | FAERS: 1 | US FAERS | |
| 68 | Neutropenic colitis | FAERS: 1 | US FAERS | |
| 69 | Neutropenic sepsis | FAERS: 1 | US FAERS | |
| 70 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 71 | No adverse event | FAERS: 1 | US FAERS | |
| 72 | Nocturia | FAERS: 1 | US FAERS | |
| 73 | Oral pain | FAERS: 1 | US FAERS | |
| 74 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 75 | Pneumothorax | FAERS: 1 | US FAERS | |
| 76 | Product dose omission | FAERS: 1 | US FAERS | |
| 77 | Productive Cough | FAERS: 1 | US FAERS | |
| 78 | Pruritus | FAERS: 1 | US FAERS | |
| 79 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 80 | Restlessness | FAERS: 1 | US FAERS | |
| 81 | Retching | FAERS: 1 | US FAERS | |
| 82 | Sepsis | FAERS: 1 | US FAERS | |
| 83 | Stomatitis | FAERS: 1 | US FAERS | |
| 84 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 85 | Therapy change | FAERS: 1 | US FAERS | |
| 86 | Throat clearing | FAERS: 1 | US FAERS | |
| 87 | Throat irritation | FAERS: 1 | US FAERS | |
| 88 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 89 | Toxic Shock Syndrome | FAERS: 1 | US FAERS | |
| 90 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 91 | Transaminases increased | FAERS: 1 | US FAERS | |
| 92 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 93 | Wound Infection | FAERS: 1 | US FAERS | |
| 94 | cancer surgery | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.